commit eecaf11adbb6f6698c96e579718e98f1ba8bdf5e Author: Dinesh Salunke Date: Thu Nov 2 13:49:00 2023 +0530 chore: initial commit diff --git a/.editorconfig b/.editorconfig new file mode 100644 index 0000000..2a78ee2 --- /dev/null +++ b/.editorconfig @@ -0,0 +1,6 @@ +root = true + +[*] +indent_size = 2 +indent_style = space + diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..3c3629e --- /dev/null +++ b/.gitignore @@ -0,0 +1 @@ +node_modules diff --git a/_dev/elegance.css b/_dev/elegance.css new file mode 100644 index 0000000..1778147 --- /dev/null +++ b/_dev/elegance.css @@ -0,0 +1,15 @@ +@tailwind base; +@tailwind components; +@tailwind utilities; + +body { + @apply bg-white; + @apply text-gray-700; + @apply font-medium; +} + +.icon-tabler { + stroke-width: 1px; + fill: none; + @apply stroke-current; +} diff --git a/_dev/package.json b/_dev/package.json new file mode 100644 index 0000000..ef84977 --- /dev/null +++ b/_dev/package.json @@ -0,0 +1,12 @@ +{ + "name": "elegance", + "version": "1.0.0", + "main": "index.js", + "license": "MIT", + "devDependencies": { + "tailwindcss": "^3.3.5" + }, + "scripts": { + "dev": "tailwindcss -i ./elegance.css -o ../assets/css/theme.css --watch" + } +} diff --git a/_dev/tailwind.config.js b/_dev/tailwind.config.js new file mode 100644 index 0000000..c2ef0e9 --- /dev/null +++ b/_dev/tailwind.config.js @@ -0,0 +1,12 @@ +/** @type {import('tailwindcss').Config} */ +module.exports = { + content: ["../templates/**/*.tpl", "../modules/**/*.tpl"], + theme: { + fontFamily: { + sans: ["Cairo"], + serif: ["Cairo"] + } + }, + plugins: [], +} + diff --git a/_dev/yarn.lock b/_dev/yarn.lock new file mode 100644 index 0000000..8f99ffd --- /dev/null +++ b/_dev/yarn.lock @@ -0,0 +1,552 @@ +# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. +# yarn lockfile v1 + + +"@alloc/quick-lru@^5.2.0": + version "5.2.0" + resolved "https://registry.yarnpkg.com/@alloc/quick-lru/-/quick-lru-5.2.0.tgz#7bf68b20c0a350f936915fcae06f58e32007ce30" + integrity sha512-UrcABB+4bUrFABwbluTIBErXwvbsU/V7TZWfmbgJfbkwiBuziS9gxdODUyuiecfdGQ85jglMW6juS3+z5TsKLw== + +"@jridgewell/gen-mapping@^0.3.2": + version "0.3.3" + resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.3.tgz#7e02e6eb5df901aaedb08514203b096614024098" + integrity sha512-HLhSWOLRi875zjjMG/r+Nv0oCW8umGb0BgEhyX3dDX3egwZtB8PqLnjz3yedt8R5StBrzcg4aBpnh8UA9D1BoQ== + dependencies: + "@jridgewell/set-array" "^1.0.1" + "@jridgewell/sourcemap-codec" "^1.4.10" + "@jridgewell/trace-mapping" "^0.3.9" + +"@jridgewell/resolve-uri@^3.1.0": + version "3.1.1" + resolved "https://registry.yarnpkg.com/@jridgewell/resolve-uri/-/resolve-uri-3.1.1.tgz#c08679063f279615a3326583ba3a90d1d82cc721" + integrity sha512-dSYZh7HhCDtCKm4QakX0xFpsRDqjjtZf/kjI/v3T3Nwt5r8/qz/M19F9ySyOqU94SXBmeG9ttTul+YnR4LOxFA== + +"@jridgewell/set-array@^1.0.1": + version "1.1.2" + resolved "https://registry.yarnpkg.com/@jridgewell/set-array/-/set-array-1.1.2.tgz#7c6cf998d6d20b914c0a55a91ae928ff25965e72" + integrity sha512-xnkseuNADM0gt2bs+BvhO0p78Mk762YnZdsuzFV018NoG1Sj1SCQvpSqa7XUaTam5vAGasABV9qXASMKnFMwMw== + +"@jridgewell/sourcemap-codec@^1.4.10", "@jridgewell/sourcemap-codec@^1.4.14": + version "1.4.15" + resolved "https://registry.yarnpkg.com/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz#d7c6e6755c78567a951e04ab52ef0fd26de59f32" + integrity sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg== + +"@jridgewell/trace-mapping@^0.3.9": + version "0.3.20" + resolved "https://registry.yarnpkg.com/@jridgewell/trace-mapping/-/trace-mapping-0.3.20.tgz#72e45707cf240fa6b081d0366f8265b0cd10197f" + integrity sha512-R8LcPeWZol2zR8mmH3JeKQ6QRCFb7XgUhV9ZlGhHLGyg4wpPiPZNQOOWhFZhxKw8u//yTbNGI42Bx/3paXEQ+Q== + dependencies: + "@jridgewell/resolve-uri" "^3.1.0" + "@jridgewell/sourcemap-codec" "^1.4.14" + +"@nodelib/fs.scandir@2.1.5": + version "2.1.5" + resolved "https://registry.yarnpkg.com/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz#7619c2eb21b25483f6d167548b4cfd5a7488c3d5" + integrity sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g== + dependencies: + "@nodelib/fs.stat" "2.0.5" + run-parallel "^1.1.9" + +"@nodelib/fs.stat@2.0.5", "@nodelib/fs.stat@^2.0.2": + version "2.0.5" + resolved "https://registry.yarnpkg.com/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz#5bd262af94e9d25bd1e71b05deed44876a222e8b" + integrity sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A== + +"@nodelib/fs.walk@^1.2.3": + version "1.2.8" + resolved "https://registry.yarnpkg.com/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz#e95737e8bb6746ddedf69c556953494f196fe69a" + integrity sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg== + dependencies: + "@nodelib/fs.scandir" "2.1.5" + fastq "^1.6.0" + +any-promise@^1.0.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/any-promise/-/any-promise-1.3.0.tgz#abc6afeedcea52e809cdc0376aed3ce39635d17f" + integrity sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A== + +anymatch@~3.1.2: + version "3.1.3" + resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-3.1.3.tgz#790c58b19ba1720a84205b57c618d5ad8524973e" + integrity sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw== + dependencies: + normalize-path "^3.0.0" + picomatch "^2.0.4" + +arg@^5.0.2: + version "5.0.2" + resolved "https://registry.yarnpkg.com/arg/-/arg-5.0.2.tgz#c81433cc427c92c4dcf4865142dbca6f15acd59c" + integrity sha512-PYjyFOLKQ9y57JvQ6QLo8dAgNqswh8M1RMJYdQduT6xbWSgK36P/Z/v+p888pM69jMMfS8Xd8F6I1kQ/I9HUGg== + +balanced-match@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.2.tgz#e83e3a7e3f300b34cb9d87f615fa0cbf357690ee" + integrity sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw== + +binary-extensions@^2.0.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-2.2.0.tgz#75f502eeaf9ffde42fc98829645be4ea76bd9e2d" + integrity sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA== + +brace-expansion@^1.1.7: + version "1.1.11" + resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd" + integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA== + dependencies: + balanced-match "^1.0.0" + concat-map "0.0.1" + +braces@^3.0.2, braces@~3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/braces/-/braces-3.0.2.tgz#3454e1a462ee8d599e236df336cd9ea4f8afe107" + integrity sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A== + dependencies: + fill-range "^7.0.1" + +camelcase-css@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/camelcase-css/-/camelcase-css-2.0.1.tgz#ee978f6947914cc30c6b44741b6ed1df7f043fd5" + integrity sha512-QOSvevhslijgYwRx6Rv7zKdMF8lbRmx+uQGx2+vDc+KI/eBnsy9kit5aj23AgGu3pa4t9AgwbnXWqS+iOY+2aA== + +chokidar@^3.5.3: + version "3.5.3" + resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-3.5.3.tgz#1cf37c8707b932bd1af1ae22c0432e2acd1903bd" + integrity sha512-Dr3sfKRP6oTcjf2JmUmFJfeVMvXBdegxB0iVQ5eb2V10uFJUCAS8OByZdVAyVb8xXNz3GjjTgj9kLWsZTqE6kw== + dependencies: + anymatch "~3.1.2" + braces "~3.0.2" + glob-parent "~5.1.2" + is-binary-path "~2.1.0" + is-glob "~4.0.1" + normalize-path "~3.0.0" + readdirp "~3.6.0" + optionalDependencies: + fsevents "~2.3.2" + +commander@^4.0.0: + version "4.1.1" + resolved "https://registry.yarnpkg.com/commander/-/commander-4.1.1.tgz#9fd602bd936294e9e9ef46a3f4d6964044b18068" + integrity sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA== + +concat-map@0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b" + integrity sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg== + +cssesc@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/cssesc/-/cssesc-3.0.0.tgz#37741919903b868565e1c09ea747445cd18983ee" + integrity sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg== + +didyoumean@^1.2.2: + version "1.2.2" + resolved "https://registry.yarnpkg.com/didyoumean/-/didyoumean-1.2.2.tgz#989346ffe9e839b4555ecf5666edea0d3e8ad037" + integrity sha512-gxtyfqMg7GKyhQmb056K7M3xszy/myH8w+B4RT+QXBQsvAOdc3XymqDDPHx1BgPgsdAA5SIifona89YtRATDzw== + +dlv@^1.1.3: + version "1.1.3" + resolved "https://registry.yarnpkg.com/dlv/-/dlv-1.1.3.tgz#5c198a8a11453596e751494d49874bc7732f2e79" + integrity sha512-+HlytyjlPKnIG8XuRG8WvmBP8xs8P71y+SKKS6ZXWoEgLuePxtDoUEiH7WkdePWrQ5JBpE6aoVqfZfJUQkjXwA== + +fast-glob@^3.3.0: + version "3.3.1" + resolved "https://registry.yarnpkg.com/fast-glob/-/fast-glob-3.3.1.tgz#784b4e897340f3dbbef17413b3f11acf03c874c4" + integrity sha512-kNFPyjhh5cKjrUltxs+wFx+ZkbRaxxmZ+X0ZU31SOsxCEtP9VPgtq2teZw1DebupL5GmDaNQ6yKMMVcM41iqDg== + dependencies: + "@nodelib/fs.stat" "^2.0.2" + "@nodelib/fs.walk" "^1.2.3" + glob-parent "^5.1.2" + merge2 "^1.3.0" + micromatch "^4.0.4" + +fastq@^1.6.0: + version "1.15.0" + resolved "https://registry.yarnpkg.com/fastq/-/fastq-1.15.0.tgz#d04d07c6a2a68fe4599fea8d2e103a937fae6b3a" + integrity sha512-wBrocU2LCXXa+lWBt8RoIRD89Fi8OdABODa/kEnyeyjS5aZO5/GNvI5sEINADqP/h8M29UHTHUb53sUu5Ihqdw== + dependencies: + reusify "^1.0.4" + +fill-range@^7.0.1: + version "7.0.1" + resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-7.0.1.tgz#1919a6a7c75fe38b2c7c77e5198535da9acdda40" + integrity sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ== + dependencies: + to-regex-range "^5.0.1" + +fs.realpath@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f" + integrity sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw== + +fsevents@~2.3.2: + version "2.3.3" + resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-2.3.3.tgz#cac6407785d03675a2a5e1a5305c697b347d90d6" + integrity sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw== + +function-bind@^1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.2.tgz#2c02d864d97f3ea6c8830c464cbd11ab6eab7a1c" + integrity sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA== + +glob-parent@^5.1.2, glob-parent@~5.1.2: + version "5.1.2" + resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.2.tgz#869832c58034fe68a4093c17dc15e8340d8401c4" + integrity sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow== + dependencies: + is-glob "^4.0.1" + +glob-parent@^6.0.2: + version "6.0.2" + resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-6.0.2.tgz#6d237d99083950c79290f24c7642a3de9a28f9e3" + integrity sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A== + dependencies: + is-glob "^4.0.3" + +glob@7.1.6: + version "7.1.6" + resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.6.tgz#141f33b81a7c2492e125594307480c46679278a6" + integrity sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA== + dependencies: + fs.realpath "^1.0.0" + inflight "^1.0.4" + inherits "2" + minimatch "^3.0.4" + once "^1.3.0" + path-is-absolute "^1.0.0" + +hasown@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/hasown/-/hasown-2.0.0.tgz#f4c513d454a57b7c7e1650778de226b11700546c" + integrity sha512-vUptKVTpIJhcczKBbgnS+RtcuYMB8+oNzPK2/Hp3hanz8JmpATdmmgLgSaadVREkDm+e2giHwY3ZRkyjSIDDFA== + dependencies: + function-bind "^1.1.2" + +inflight@^1.0.4: + version "1.0.6" + resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9" + integrity sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA== + dependencies: + once "^1.3.0" + wrappy "1" + +inherits@2: + version "2.0.4" + resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c" + integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ== + +is-binary-path@~2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-2.1.0.tgz#ea1f7f3b80f064236e83470f86c09c254fb45b09" + integrity sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw== + dependencies: + binary-extensions "^2.0.0" + +is-core-module@^2.13.0: + version "2.13.1" + resolved "https://registry.yarnpkg.com/is-core-module/-/is-core-module-2.13.1.tgz#ad0d7532c6fea9da1ebdc82742d74525c6273384" + integrity sha512-hHrIjvZsftOsvKSn2TRYl63zvxsgE0K+0mYMoH6gD4omR5IWB2KynivBQczo3+wF1cCkjzvptnI9Q0sPU66ilw== + dependencies: + hasown "^2.0.0" + +is-extglob@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2" + integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ== + +is-glob@^4.0.1, is-glob@^4.0.3, is-glob@~4.0.1: + version "4.0.3" + resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084" + integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg== + dependencies: + is-extglob "^2.1.1" + +is-number@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/is-number/-/is-number-7.0.0.tgz#7535345b896734d5f80c4d06c50955527a14f12b" + integrity sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng== + +jiti@^1.19.1: + version "1.21.0" + resolved "https://registry.yarnpkg.com/jiti/-/jiti-1.21.0.tgz#7c97f8fe045724e136a397f7340475244156105d" + integrity sha512-gFqAIbuKyyso/3G2qhiO2OM6shY6EPP/R0+mkDbyspxKazh8BXDC5FiFsUjlczgdNz/vfra0da2y+aHrusLG/Q== + +lilconfig@^2.0.5, lilconfig@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/lilconfig/-/lilconfig-2.1.0.tgz#78e23ac89ebb7e1bfbf25b18043de756548e7f52" + integrity sha512-utWOt/GHzuUxnLKxB6dk81RoOeoNeHgbrXiuGk4yyF5qlRz+iIVWu56E2fqGHFrXz0QNUhLB/8nKqvRH66JKGQ== + +lines-and-columns@^1.1.6: + version "1.2.4" + resolved "https://registry.yarnpkg.com/lines-and-columns/-/lines-and-columns-1.2.4.tgz#eca284f75d2965079309dc0ad9255abb2ebc1632" + integrity sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg== + +merge2@^1.3.0: + version "1.4.1" + resolved "https://registry.yarnpkg.com/merge2/-/merge2-1.4.1.tgz#4368892f885e907455a6fd7dc55c0c9d404990ae" + integrity sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg== + +micromatch@^4.0.4, micromatch@^4.0.5: + version "4.0.5" + resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-4.0.5.tgz#bc8999a7cbbf77cdc89f132f6e467051b49090c6" + integrity sha512-DMy+ERcEW2q8Z2Po+WNXuw3c5YaUSFjAO5GsJqfEl7UjvtIuFKO6ZrKvcItdy98dwFI2N1tg3zNIdKaQT+aNdA== + dependencies: + braces "^3.0.2" + picomatch "^2.3.1" + +minimatch@^3.0.4: + version "3.1.2" + resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.1.2.tgz#19cd194bfd3e428f049a70817c038d89ab4be35b" + integrity sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw== + dependencies: + brace-expansion "^1.1.7" + +mz@^2.7.0: + version "2.7.0" + resolved "https://registry.yarnpkg.com/mz/-/mz-2.7.0.tgz#95008057a56cafadc2bc63dde7f9ff6955948e32" + integrity sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q== + dependencies: + any-promise "^1.0.0" + object-assign "^4.0.1" + thenify-all "^1.0.0" + +nanoid@^3.3.6: + version "3.3.6" + resolved "https://registry.yarnpkg.com/nanoid/-/nanoid-3.3.6.tgz#443380c856d6e9f9824267d960b4236ad583ea4c" + integrity sha512-BGcqMMJuToF7i1rt+2PWSNVnWIkGCU78jBG3RxO/bZlnZPK2Cmi2QaffxGO/2RvWi9sL+FAiRiXMgsyxQ1DIDA== + +normalize-path@^3.0.0, normalize-path@~3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-3.0.0.tgz#0dcd69ff23a1c9b11fd0978316644a0388216a65" + integrity sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA== + +object-assign@^4.0.1: + version "4.1.1" + resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" + integrity sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg== + +object-hash@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/object-hash/-/object-hash-3.0.0.tgz#73f97f753e7baffc0e2cc9d6e079079744ac82e9" + integrity sha512-RSn9F68PjH9HqtltsSnqYC1XXoWe9Bju5+213R98cNGttag9q9yAOTzdbsqvIa7aNm5WffBZFpWYr2aWrklWAw== + +once@^1.3.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1" + integrity sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w== + dependencies: + wrappy "1" + +path-is-absolute@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f" + integrity sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg== + +path-parse@^1.0.7: + version "1.0.7" + resolved "https://registry.yarnpkg.com/path-parse/-/path-parse-1.0.7.tgz#fbc114b60ca42b30d9daf5858e4bd68bbedb6735" + integrity sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw== + +picocolors@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.0.0.tgz#cb5bdc74ff3f51892236eaf79d68bc44564ab81c" + integrity sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ== + +picomatch@^2.0.4, picomatch@^2.2.1, picomatch@^2.3.1: + version "2.3.1" + resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.3.1.tgz#3ba3833733646d9d3e4995946c1365a67fb07a42" + integrity sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA== + +pify@^2.3.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c" + integrity sha512-udgsAY+fTnvv7kI7aaxbqwWNb0AHiB0qBO89PZKPkoTmGOgdbrHDKD+0B2X4uTfJ/FT1R09r9gTsjUjNJotuog== + +pirates@^4.0.1: + version "4.0.6" + resolved "https://registry.yarnpkg.com/pirates/-/pirates-4.0.6.tgz#3018ae32ecfcff6c29ba2267cbf21166ac1f36b9" + integrity sha512-saLsH7WeYYPiD25LDuLRRY/i+6HaPYr6G1OUlN39otzkSTxKnubR9RTxS3/Kk50s1g2JTgFwWQDQyplC5/SHZg== + +postcss-import@^15.1.0: + version "15.1.0" + resolved "https://registry.yarnpkg.com/postcss-import/-/postcss-import-15.1.0.tgz#41c64ed8cc0e23735a9698b3249ffdbf704adc70" + integrity sha512-hpr+J05B2FVYUAXHeK1YyI267J/dDDhMU6B6civm8hSY1jYJnBXxzKDKDswzJmtLHryrjhnDjqqp/49t8FALew== + dependencies: + postcss-value-parser "^4.0.0" + read-cache "^1.0.0" + resolve "^1.1.7" + +postcss-js@^4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/postcss-js/-/postcss-js-4.0.1.tgz#61598186f3703bab052f1c4f7d805f3991bee9d2" + integrity sha512-dDLF8pEO191hJMtlHFPRa8xsizHaM82MLfNkUHdUtVEV3tgTp5oj+8qbEqYM57SLfc74KSbw//4SeJma2LRVIw== + dependencies: + camelcase-css "^2.0.1" + +postcss-load-config@^4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/postcss-load-config/-/postcss-load-config-4.0.1.tgz#152383f481c2758274404e4962743191d73875bd" + integrity sha512-vEJIc8RdiBRu3oRAI0ymerOn+7rPuMvRXslTvZUKZonDHFIczxztIyJ1urxM1x9JXEikvpWWTUUqal5j/8QgvA== + dependencies: + lilconfig "^2.0.5" + yaml "^2.1.1" + +postcss-nested@^6.0.1: + version "6.0.1" + resolved "https://registry.yarnpkg.com/postcss-nested/-/postcss-nested-6.0.1.tgz#f83dc9846ca16d2f4fa864f16e9d9f7d0961662c" + integrity sha512-mEp4xPMi5bSWiMbsgoPfcP74lsWLHkQbZc3sY+jWYd65CUwXrUaTp0fmNpa01ZcETKlIgUdFN/MpS2xZtqL9dQ== + dependencies: + postcss-selector-parser "^6.0.11" + +postcss-selector-parser@^6.0.11: + version "6.0.13" + resolved "https://registry.yarnpkg.com/postcss-selector-parser/-/postcss-selector-parser-6.0.13.tgz#d05d8d76b1e8e173257ef9d60b706a8e5e99bf1b" + integrity sha512-EaV1Gl4mUEV4ddhDnv/xtj7sxwrwxdetHdWUGnT4VJQf+4d05v6lHYZr8N573k5Z0BViss7BDhfWtKS3+sfAqQ== + dependencies: + cssesc "^3.0.0" + util-deprecate "^1.0.2" + +postcss-value-parser@^4.0.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz#723c09920836ba6d3e5af019f92bc0971c02e514" + integrity sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ== + +postcss@^8.4.23: + version "8.4.31" + resolved "https://registry.yarnpkg.com/postcss/-/postcss-8.4.31.tgz#92b451050a9f914da6755af352bdc0192508656d" + integrity sha512-PS08Iboia9mts/2ygV3eLpY5ghnUcfLV/EXTOW1E2qYxJKGGBUtNjN76FYHnMs36RmARn41bC0AZmn+rR0OVpQ== + dependencies: + nanoid "^3.3.6" + picocolors "^1.0.0" + source-map-js "^1.0.2" + +queue-microtask@^1.2.2: + version "1.2.3" + resolved "https://registry.yarnpkg.com/queue-microtask/-/queue-microtask-1.2.3.tgz#4929228bbc724dfac43e0efb058caf7b6cfb6243" + integrity sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A== + +read-cache@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/read-cache/-/read-cache-1.0.0.tgz#e664ef31161166c9751cdbe8dbcf86b5fb58f774" + integrity sha512-Owdv/Ft7IjOgm/i0xvNDZ1LrRANRfew4b2prF3OWMQLxLfu3bS8FVhCsrSCMK4lR56Y9ya+AThoTpDCTxCmpRA== + dependencies: + pify "^2.3.0" + +readdirp@~3.6.0: + version "3.6.0" + resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-3.6.0.tgz#74a370bd857116e245b29cc97340cd431a02a6c7" + integrity sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA== + dependencies: + picomatch "^2.2.1" + +resolve@^1.1.7, resolve@^1.22.2: + version "1.22.8" + resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.22.8.tgz#b6c87a9f2aa06dfab52e3d70ac8cde321fa5a48d" + integrity sha512-oKWePCxqpd6FlLvGV1VU0x7bkPmmCNolxzjMf4NczoDnQcIWrAF+cPtZn5i6n+RfD2d9i0tzpKnG6Yk168yIyw== + dependencies: + is-core-module "^2.13.0" + path-parse "^1.0.7" + supports-preserve-symlinks-flag "^1.0.0" + +reusify@^1.0.4: + version "1.0.4" + resolved "https://registry.yarnpkg.com/reusify/-/reusify-1.0.4.tgz#90da382b1e126efc02146e90845a88db12925d76" + integrity sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw== + +run-parallel@^1.1.9: + version "1.2.0" + resolved "https://registry.yarnpkg.com/run-parallel/-/run-parallel-1.2.0.tgz#66d1368da7bdf921eb9d95bd1a9229e7f21a43ee" + integrity sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA== + dependencies: + queue-microtask "^1.2.2" + +source-map-js@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/source-map-js/-/source-map-js-1.0.2.tgz#adbc361d9c62df380125e7f161f71c826f1e490c" + integrity sha512-R0XvVJ9WusLiqTCEiGCmICCMplcCkIwwR11mOSD9CR5u+IXYdiseeEuXCVAjS54zqwkLcPNnmU4OeJ6tUrWhDw== + +sucrase@^3.32.0: + version "3.34.0" + resolved "https://registry.yarnpkg.com/sucrase/-/sucrase-3.34.0.tgz#1e0e2d8fcf07f8b9c3569067d92fbd8690fb576f" + integrity sha512-70/LQEZ07TEcxiU2dz51FKaE6hCTWC6vr7FOk3Gr0U60C3shtAN+H+BFr9XlYe5xqf3RA8nrc+VIwzCfnxuXJw== + dependencies: + "@jridgewell/gen-mapping" "^0.3.2" + commander "^4.0.0" + glob "7.1.6" + lines-and-columns "^1.1.6" + mz "^2.7.0" + pirates "^4.0.1" + ts-interface-checker "^0.1.9" + +supports-preserve-symlinks-flag@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz#6eda4bd344a3c94aea376d4cc31bc77311039e09" + integrity sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w== + +tailwindcss@^3.3.5: + version "3.3.5" + resolved "https://registry.yarnpkg.com/tailwindcss/-/tailwindcss-3.3.5.tgz#22a59e2fbe0ecb6660809d9cc5f3976b077be3b8" + integrity sha512-5SEZU4J7pxZgSkv7FP1zY8i2TIAOooNZ1e/OGtxIEv6GltpoiXUqWvLy89+a10qYTB1N5Ifkuw9lqQkN9sscvA== + dependencies: + "@alloc/quick-lru" "^5.2.0" + arg "^5.0.2" + chokidar "^3.5.3" + didyoumean "^1.2.2" + dlv "^1.1.3" + fast-glob "^3.3.0" + glob-parent "^6.0.2" + is-glob "^4.0.3" + jiti "^1.19.1" + lilconfig "^2.1.0" + micromatch "^4.0.5" + normalize-path "^3.0.0" + object-hash "^3.0.0" + picocolors "^1.0.0" + postcss "^8.4.23" + postcss-import "^15.1.0" + postcss-js "^4.0.1" + postcss-load-config "^4.0.1" + postcss-nested "^6.0.1" + postcss-selector-parser "^6.0.11" + resolve "^1.22.2" + sucrase "^3.32.0" + +thenify-all@^1.0.0: + version "1.6.0" + resolved "https://registry.yarnpkg.com/thenify-all/-/thenify-all-1.6.0.tgz#1a1918d402d8fc3f98fbf234db0bcc8cc10e9726" + integrity sha512-RNxQH/qI8/t3thXJDwcstUO4zeqo64+Uy/+sNVRBx4Xn2OX+OZ9oP+iJnNFqplFra2ZUVeKCSa2oVWi3T4uVmA== + dependencies: + thenify ">= 3.1.0 < 4" + +"thenify@>= 3.1.0 < 4": + version "3.3.1" + resolved "https://registry.yarnpkg.com/thenify/-/thenify-3.3.1.tgz#8932e686a4066038a016dd9e2ca46add9838a95f" + integrity sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw== + dependencies: + any-promise "^1.0.0" + +to-regex-range@^5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/to-regex-range/-/to-regex-range-5.0.1.tgz#1648c44aae7c8d988a326018ed72f5b4dd0392e4" + integrity sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ== + dependencies: + is-number "^7.0.0" + +ts-interface-checker@^0.1.9: + version "0.1.13" + resolved "https://registry.yarnpkg.com/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz#784fd3d679722bc103b1b4b8030bcddb5db2a699" + integrity sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA== + +util-deprecate@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf" + integrity sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw== + +wrappy@1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f" + integrity sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ== + +yaml@^2.1.1: + version "2.3.3" + resolved "https://registry.yarnpkg.com/yaml/-/yaml-2.3.3.tgz#01f6d18ef036446340007db8e016810e5d64aad9" + integrity sha512-zw0VAJxgeZ6+++/su5AFoqBbZbrEakwu+X0M5HmcwUiBL7AzcuPKjj5we4xfQLp78LkEMpD0cOnUhmgOVy3KdQ== diff --git a/assets/css/elegance.css b/assets/css/elegance.css new file mode 100644 index 0000000..2fc9a8e --- /dev/null +++ b/assets/css/elegance.css @@ -0,0 +1,647 @@ +/* +! tailwindcss v3.3.5 | MIT License | https://tailwindcss.com +*/ + +/* +1. Prevent padding and border from affecting element width. (https://github.com/mozdevs/cssremedy/issues/4) +2. Allow adding a border to an element by just adding a border-width. (https://github.com/tailwindcss/tailwindcss/pull/116) +*/ + +*, +::before, +::after { + box-sizing: border-box; + /* 1 */ + border-width: 0; + /* 2 */ + border-style: solid; + /* 2 */ + border-color: #e5e7eb; + /* 2 */ +} + +::before, +::after { + --tw-content: ''; +} + +/* +1. Use a consistent sensible line-height in all browsers. +2. Prevent adjustments of font size after orientation changes in iOS. +3. Use a more readable tab size. +4. Use the user's configured `sans` font-family by default. +5. Use the user's configured `sans` font-feature-settings by default. +6. Use the user's configured `sans` font-variation-settings by default. +*/ + +html { + line-height: 1.5; + /* 1 */ + -webkit-text-size-adjust: 100%; + /* 2 */ + -moz-tab-size: 4; + /* 3 */ + -o-tab-size: 4; + tab-size: 4; + /* 3 */ + font-family: Cairo; + /* 4 */ + font-feature-settings: normal; + /* 5 */ + font-variation-settings: normal; + /* 6 */ +} + +/* +1. Remove the margin in all browsers. +2. Inherit line-height from `html` so users can set them as a class directly on the `html` element. +*/ + +body { + margin: 0; + /* 1 */ + line-height: inherit; + /* 2 */ +} + +/* +1. Add the correct height in Firefox. +2. Correct the inheritance of border color in Firefox. (https://bugzilla.mozilla.org/show_bug.cgi?id=190655) +3. Ensure horizontal rules are visible by default. +*/ + +hr { + height: 0; + /* 1 */ + color: inherit; + /* 2 */ + border-top-width: 1px; + /* 3 */ +} + +/* +Add the correct text decoration in Chrome, Edge, and Safari. +*/ + +abbr:where([title]) { + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; +} + +/* +Remove the default font size and weight for headings. +*/ + +h1, +h2, +h3, +h4, +h5, +h6 { + font-size: inherit; + font-weight: inherit; +} + +/* +Reset links to optimize for opt-in styling instead of opt-out. +*/ + +a { + color: inherit; + text-decoration: inherit; +} + +/* +Add the correct font weight in Edge and Safari. +*/ + +b, +strong { + font-weight: bolder; +} + +/* +1. Use the user's configured `mono` font family by default. +2. Correct the odd `em` font sizing in all browsers. +*/ + +code, +kbd, +samp, +pre { + font-family: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; + /* 1 */ + font-size: 1em; + /* 2 */ +} + +/* +Add the correct font size in all browsers. +*/ + +small { + font-size: 80%; +} + +/* +Prevent `sub` and `sup` elements from affecting the line height in all browsers. +*/ + +sub, +sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} + +sub { + bottom: -0.25em; +} + +sup { + top: -0.5em; +} + +/* +1. Remove text indentation from table contents in Chrome and Safari. (https://bugs.chromium.org/p/chromium/issues/detail?id=999088, https://bugs.webkit.org/show_bug.cgi?id=201297) +2. Correct table border color inheritance in all Chrome and Safari. (https://bugs.chromium.org/p/chromium/issues/detail?id=935729, https://bugs.webkit.org/show_bug.cgi?id=195016) +3. Remove gaps between table borders by default. +*/ + +table { + text-indent: 0; + /* 1 */ + border-color: inherit; + /* 2 */ + border-collapse: collapse; + /* 3 */ +} + +/* +1. Change the font styles in all browsers. +2. Remove the margin in Firefox and Safari. +3. Remove default padding in all browsers. +*/ + +button, +input, +optgroup, +select, +textarea { + font-family: inherit; + /* 1 */ + font-feature-settings: inherit; + /* 1 */ + font-variation-settings: inherit; + /* 1 */ + font-size: 100%; + /* 1 */ + font-weight: inherit; + /* 1 */ + line-height: inherit; + /* 1 */ + color: inherit; + /* 1 */ + margin: 0; + /* 2 */ + padding: 0; + /* 3 */ +} + +/* +Remove the inheritance of text transform in Edge and Firefox. +*/ + +button, +select { + text-transform: none; +} + +/* +1. Correct the inability to style clickable types in iOS and Safari. +2. Remove default button styles. +*/ + +button, +[type='button'], +[type='reset'], +[type='submit'] { + -webkit-appearance: button; + /* 1 */ + background-color: transparent; + /* 2 */ + background-image: none; + /* 2 */ +} + +/* +Use the modern Firefox focus style for all focusable elements. +*/ + +:-moz-focusring { + outline: auto; +} + +/* +Remove the additional `:invalid` styles in Firefox. (https://github.com/mozilla/gecko-dev/blob/2f9eacd9d3d995c937b4251a5557d95d494c9be1/layout/style/res/forms.css#L728-L737) +*/ + +:-moz-ui-invalid { + box-shadow: none; +} + +/* +Add the correct vertical alignment in Chrome and Firefox. +*/ + +progress { + vertical-align: baseline; +} + +/* +Correct the cursor style of increment and decrement buttons in Safari. +*/ + +::-webkit-inner-spin-button, +::-webkit-outer-spin-button { + height: auto; +} + +/* +1. Correct the odd appearance in Chrome and Safari. +2. Correct the outline style in Safari. +*/ + +[type='search'] { + -webkit-appearance: textfield; + /* 1 */ + outline-offset: -2px; + /* 2 */ +} + +/* +Remove the inner padding in Chrome and Safari on macOS. +*/ + +::-webkit-search-decoration { + -webkit-appearance: none; +} + +/* +1. Correct the inability to style clickable types in iOS and Safari. +2. Change font properties to `inherit` in Safari. +*/ + +::-webkit-file-upload-button { + -webkit-appearance: button; + /* 1 */ + font: inherit; + /* 2 */ +} + +/* +Add the correct display in Chrome and Safari. +*/ + +summary { + display: list-item; +} + +/* +Removes the default spacing and border for appropriate elements. +*/ + +blockquote, +dl, +dd, +h1, +h2, +h3, +h4, +h5, +h6, +hr, +figure, +p, +pre { + margin: 0; +} + +fieldset { + margin: 0; + padding: 0; +} + +legend { + padding: 0; +} + +ol, +ul, +menu { + list-style: none; + margin: 0; + padding: 0; +} + +/* +Reset default styling for dialogs. +*/ + +dialog { + padding: 0; +} + +/* +Prevent resizing textareas horizontally by default. +*/ + +textarea { + resize: vertical; +} + +/* +1. Reset the default placeholder opacity in Firefox. (https://github.com/tailwindlabs/tailwindcss/issues/3300) +2. Set the default placeholder color to the user's configured gray 400 color. +*/ + +input::-moz-placeholder, textarea::-moz-placeholder { + opacity: 1; + /* 1 */ + color: #9ca3af; + /* 2 */ +} + +input::placeholder, +textarea::placeholder { + opacity: 1; + /* 1 */ + color: #9ca3af; + /* 2 */ +} + +/* +Set the default cursor for buttons. +*/ + +button, +[role="button"] { + cursor: pointer; +} + +/* +Make sure disabled buttons don't get the pointer cursor. +*/ + +:disabled { + cursor: default; +} + +/* +1. Make replaced elements `display: block` by default. (https://github.com/mozdevs/cssremedy/issues/14) +2. Add `vertical-align: middle` to align replaced elements more sensibly by default. (https://github.com/jensimmons/cssremedy/issues/14#issuecomment-634934210) + This can trigger a poorly considered lint error in some tools but is included by design. +*/ + +img, +svg, +video, +canvas, +audio, +iframe, +embed, +object { + display: block; + /* 1 */ + vertical-align: middle; + /* 2 */ +} + +/* +Constrain images and videos to the parent width and preserve their intrinsic aspect ratio. (https://github.com/mozdevs/cssremedy/issues/14) +*/ + +img, +video { + max-width: 100%; + height: auto; +} + +/* Make elements with the HTML hidden attribute stay hidden by default */ + +[hidden] { + display: none; +} + +*, ::before, ::after { + --tw-border-spacing-x: 0; + --tw-border-spacing-y: 0; + --tw-translate-x: 0; + --tw-translate-y: 0; + --tw-rotate: 0; + --tw-skew-x: 0; + --tw-skew-y: 0; + --tw-scale-x: 1; + --tw-scale-y: 1; + --tw-pan-x: ; + --tw-pan-y: ; + --tw-pinch-zoom: ; + --tw-scroll-snap-strictness: proximity; + --tw-gradient-from-position: ; + --tw-gradient-via-position: ; + --tw-gradient-to-position: ; + --tw-ordinal: ; + --tw-slashed-zero: ; + --tw-numeric-figure: ; + --tw-numeric-spacing: ; + --tw-numeric-fraction: ; + --tw-ring-inset: ; + --tw-ring-offset-width: 0px; + --tw-ring-offset-color: #fff; + --tw-ring-color: rgb(59 130 246 / 0.5); + --tw-ring-offset-shadow: 0 0 #0000; + --tw-ring-shadow: 0 0 #0000; + --tw-shadow: 0 0 #0000; + --tw-shadow-colored: 0 0 #0000; + --tw-blur: ; + --tw-brightness: ; + --tw-contrast: ; + --tw-grayscale: ; + --tw-hue-rotate: ; + --tw-invert: ; + --tw-saturate: ; + --tw-sepia: ; + --tw-drop-shadow: ; + --tw-backdrop-blur: ; + --tw-backdrop-brightness: ; + --tw-backdrop-contrast: ; + --tw-backdrop-grayscale: ; + --tw-backdrop-hue-rotate: ; + --tw-backdrop-invert: ; + --tw-backdrop-opacity: ; + --tw-backdrop-saturate: ; + --tw-backdrop-sepia: ; +} + +::backdrop { + --tw-border-spacing-x: 0; + --tw-border-spacing-y: 0; + --tw-translate-x: 0; + --tw-translate-y: 0; + --tw-rotate: 0; + --tw-skew-x: 0; + --tw-skew-y: 0; + --tw-scale-x: 1; + --tw-scale-y: 1; + --tw-pan-x: ; + --tw-pan-y: ; + --tw-pinch-zoom: ; + --tw-scroll-snap-strictness: proximity; + --tw-gradient-from-position: ; + --tw-gradient-via-position: ; + --tw-gradient-to-position: ; + --tw-ordinal: ; + --tw-slashed-zero: ; + --tw-numeric-figure: ; + --tw-numeric-spacing: ; + --tw-numeric-fraction: ; + --tw-ring-inset: ; + --tw-ring-offset-width: 0px; + --tw-ring-offset-color: #fff; + --tw-ring-color: rgb(59 130 246 / 0.5); + --tw-ring-offset-shadow: 0 0 #0000; + --tw-ring-shadow: 0 0 #0000; + --tw-shadow: 0 0 #0000; + --tw-shadow-colored: 0 0 #0000; + --tw-blur: ; + --tw-brightness: ; + --tw-contrast: ; + --tw-grayscale: ; + --tw-hue-rotate: ; + --tw-invert: ; + --tw-saturate: ; + --tw-sepia: ; + --tw-drop-shadow: ; + --tw-backdrop-blur: ; + --tw-backdrop-brightness: ; + --tw-backdrop-contrast: ; + --tw-backdrop-grayscale: ; + --tw-backdrop-hue-rotate: ; + --tw-backdrop-invert: ; + --tw-backdrop-opacity: ; + --tw-backdrop-saturate: ; + --tw-backdrop-sepia: ; +} + +.container { + width: 100%; +} + +@media (min-width: 640px) { + .container { + max-width: 640px; + } +} + +@media (min-width: 768px) { + .container { + max-width: 768px; + } +} + +@media (min-width: 1024px) { + .container { + max-width: 1024px; + } +} + +@media (min-width: 1280px) { + .container { + max-width: 1280px; + } +} + +@media (min-width: 1536px) { + .container { + max-width: 1536px; + } +} + +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + margin: -1px; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border-width: 0; +} + +.collapse { + visibility: collapse; +} + +.my-2 { + margin-top: 0.5rem; + margin-bottom: 0.5rem; +} + +.ml-1 { + margin-left: 0.25rem; +} + +.mt-1 { + margin-top: 0.25rem; +} + +.mt-2 { + margin-top: 0.5rem; +} + +.mt-3 { + margin-top: 0.75rem; +} + +.block { + display: block; +} + +.inline { + display: inline; +} + +.table { + display: table; +} + +.hidden { + display: none; +} + +.truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; +} + +.pr-0 { + padding-right: 0px; +} + +.text-justify { + text-align: justify; +} + +.filter { + filter: var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow); +} + +body { + --tw-bg-opacity: 1; + background-color: rgb(243 244 246 / var(--tw-bg-opacity)); + --tw-text-opacity: 1; + color: rgb(55 65 81 / var(--tw-text-opacity)); +} diff --git a/assets/css/theme.css b/assets/css/theme.css new file mode 100644 index 0000000..eecf40a --- /dev/null +++ b/assets/css/theme.css @@ -0,0 +1,994 @@ +/* +! tailwindcss v3.3.5 | MIT License | https://tailwindcss.com +*/ + +/* +1. Prevent padding and border from affecting element width. (https://github.com/mozdevs/cssremedy/issues/4) +2. Allow adding a border to an element by just adding a border-width. (https://github.com/tailwindcss/tailwindcss/pull/116) +*/ + +*, +::before, +::after { + box-sizing: border-box; + /* 1 */ + border-width: 0; + /* 2 */ + border-style: solid; + /* 2 */ + border-color: #e5e7eb; + /* 2 */ +} + +::before, +::after { + --tw-content: ''; +} + +/* +1. Use a consistent sensible line-height in all browsers. +2. Prevent adjustments of font size after orientation changes in iOS. +3. Use a more readable tab size. +4. Use the user's configured `sans` font-family by default. +5. Use the user's configured `sans` font-feature-settings by default. +6. Use the user's configured `sans` font-variation-settings by default. +*/ + +html { + line-height: 1.5; + /* 1 */ + -webkit-text-size-adjust: 100%; + /* 2 */ + -moz-tab-size: 4; + /* 3 */ + -o-tab-size: 4; + tab-size: 4; + /* 3 */ + font-family: Cairo; + /* 4 */ + font-feature-settings: normal; + /* 5 */ + font-variation-settings: normal; + /* 6 */ +} + +/* +1. Remove the margin in all browsers. +2. Inherit line-height from `html` so users can set them as a class directly on the `html` element. +*/ + +body { + margin: 0; + /* 1 */ + line-height: inherit; + /* 2 */ +} + +/* +1. Add the correct height in Firefox. +2. Correct the inheritance of border color in Firefox. (https://bugzilla.mozilla.org/show_bug.cgi?id=190655) +3. Ensure horizontal rules are visible by default. +*/ + +hr { + height: 0; + /* 1 */ + color: inherit; + /* 2 */ + border-top-width: 1px; + /* 3 */ +} + +/* +Add the correct text decoration in Chrome, Edge, and Safari. +*/ + +abbr:where([title]) { + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; +} + +/* +Remove the default font size and weight for headings. +*/ + +h1, +h2, +h3, +h4, +h5, +h6 { + font-size: inherit; + font-weight: inherit; +} + +/* +Reset links to optimize for opt-in styling instead of opt-out. +*/ + +a { + color: inherit; + text-decoration: inherit; +} + +/* +Add the correct font weight in Edge and Safari. +*/ + +b, +strong { + font-weight: bolder; +} + +/* +1. Use the user's configured `mono` font family by default. +2. Correct the odd `em` font sizing in all browsers. +*/ + +code, +kbd, +samp, +pre { + font-family: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; + /* 1 */ + font-size: 1em; + /* 2 */ +} + +/* +Add the correct font size in all browsers. +*/ + +small { + font-size: 80%; +} + +/* +Prevent `sub` and `sup` elements from affecting the line height in all browsers. +*/ + +sub, +sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} + +sub { + bottom: -0.25em; +} + +sup { + top: -0.5em; +} + +/* +1. Remove text indentation from table contents in Chrome and Safari. (https://bugs.chromium.org/p/chromium/issues/detail?id=999088, https://bugs.webkit.org/show_bug.cgi?id=201297) +2. Correct table border color inheritance in all Chrome and Safari. (https://bugs.chromium.org/p/chromium/issues/detail?id=935729, https://bugs.webkit.org/show_bug.cgi?id=195016) +3. Remove gaps between table borders by default. +*/ + +table { + text-indent: 0; + /* 1 */ + border-color: inherit; + /* 2 */ + border-collapse: collapse; + /* 3 */ +} + +/* +1. Change the font styles in all browsers. +2. Remove the margin in Firefox and Safari. +3. Remove default padding in all browsers. +*/ + +button, +input, +optgroup, +select, +textarea { + font-family: inherit; + /* 1 */ + font-feature-settings: inherit; + /* 1 */ + font-variation-settings: inherit; + /* 1 */ + font-size: 100%; + /* 1 */ + font-weight: inherit; + /* 1 */ + line-height: inherit; + /* 1 */ + color: inherit; + /* 1 */ + margin: 0; + /* 2 */ + padding: 0; + /* 3 */ +} + +/* +Remove the inheritance of text transform in Edge and Firefox. +*/ + +button, +select { + text-transform: none; +} + +/* +1. Correct the inability to style clickable types in iOS and Safari. +2. Remove default button styles. +*/ + +button, +[type='button'], +[type='reset'], +[type='submit'] { + -webkit-appearance: button; + /* 1 */ + background-color: transparent; + /* 2 */ + background-image: none; + /* 2 */ +} + +/* +Use the modern Firefox focus style for all focusable elements. +*/ + +:-moz-focusring { + outline: auto; +} + +/* +Remove the additional `:invalid` styles in Firefox. (https://github.com/mozilla/gecko-dev/blob/2f9eacd9d3d995c937b4251a5557d95d494c9be1/layout/style/res/forms.css#L728-L737) +*/ + +:-moz-ui-invalid { + box-shadow: none; +} + +/* +Add the correct vertical alignment in Chrome and Firefox. +*/ + +progress { + vertical-align: baseline; +} + +/* +Correct the cursor style of increment and decrement buttons in Safari. +*/ + +::-webkit-inner-spin-button, +::-webkit-outer-spin-button { + height: auto; +} + +/* +1. Correct the odd appearance in Chrome and Safari. +2. Correct the outline style in Safari. +*/ + +[type='search'] { + -webkit-appearance: textfield; + /* 1 */ + outline-offset: -2px; + /* 2 */ +} + +/* +Remove the inner padding in Chrome and Safari on macOS. +*/ + +::-webkit-search-decoration { + -webkit-appearance: none; +} + +/* +1. Correct the inability to style clickable types in iOS and Safari. +2. Change font properties to `inherit` in Safari. +*/ + +::-webkit-file-upload-button { + -webkit-appearance: button; + /* 1 */ + font: inherit; + /* 2 */ +} + +/* +Add the correct display in Chrome and Safari. +*/ + +summary { + display: list-item; +} + +/* +Removes the default spacing and border for appropriate elements. +*/ + +blockquote, +dl, +dd, +h1, +h2, +h3, +h4, +h5, +h6, +hr, +figure, +p, +pre { + margin: 0; +} + +fieldset { + margin: 0; + padding: 0; +} + +legend { + padding: 0; +} + +ol, +ul, +menu { + list-style: none; + margin: 0; + padding: 0; +} + +/* +Reset default styling for dialogs. +*/ + +dialog { + padding: 0; +} + +/* +Prevent resizing textareas horizontally by default. +*/ + +textarea { + resize: vertical; +} + +/* +1. Reset the default placeholder opacity in Firefox. (https://github.com/tailwindlabs/tailwindcss/issues/3300) +2. Set the default placeholder color to the user's configured gray 400 color. +*/ + +input::-moz-placeholder, textarea::-moz-placeholder { + opacity: 1; + /* 1 */ + color: #9ca3af; + /* 2 */ +} + +input::placeholder, +textarea::placeholder { + opacity: 1; + /* 1 */ + color: #9ca3af; + /* 2 */ +} + +/* +Set the default cursor for buttons. +*/ + +button, +[role="button"] { + cursor: pointer; +} + +/* +Make sure disabled buttons don't get the pointer cursor. +*/ + +:disabled { + cursor: default; +} + +/* +1. Make replaced elements `display: block` by default. (https://github.com/mozdevs/cssremedy/issues/14) +2. Add `vertical-align: middle` to align replaced elements more sensibly by default. (https://github.com/jensimmons/cssremedy/issues/14#issuecomment-634934210) + This can trigger a poorly considered lint error in some tools but is included by design. +*/ + +img, +svg, +video, +canvas, +audio, +iframe, +embed, +object { + display: block; + /* 1 */ + vertical-align: middle; + /* 2 */ +} + +/* +Constrain images and videos to the parent width and preserve their intrinsic aspect ratio. (https://github.com/mozdevs/cssremedy/issues/14) +*/ + +img, +video { + max-width: 100%; + height: auto; +} + +/* Make elements with the HTML hidden attribute stay hidden by default */ + +[hidden] { + display: none; +} + +*, ::before, ::after { + --tw-border-spacing-x: 0; + --tw-border-spacing-y: 0; + --tw-translate-x: 0; + --tw-translate-y: 0; + --tw-rotate: 0; + --tw-skew-x: 0; + --tw-skew-y: 0; + --tw-scale-x: 1; + --tw-scale-y: 1; + --tw-pan-x: ; + --tw-pan-y: ; + --tw-pinch-zoom: ; + --tw-scroll-snap-strictness: proximity; + --tw-gradient-from-position: ; + --tw-gradient-via-position: ; + --tw-gradient-to-position: ; + --tw-ordinal: ; + --tw-slashed-zero: ; + --tw-numeric-figure: ; + --tw-numeric-spacing: ; + --tw-numeric-fraction: ; + --tw-ring-inset: ; + --tw-ring-offset-width: 0px; + --tw-ring-offset-color: #fff; + --tw-ring-color: rgb(59 130 246 / 0.5); + --tw-ring-offset-shadow: 0 0 #0000; + --tw-ring-shadow: 0 0 #0000; + --tw-shadow: 0 0 #0000; + --tw-shadow-colored: 0 0 #0000; + --tw-blur: ; + --tw-brightness: ; + --tw-contrast: ; + --tw-grayscale: ; + --tw-hue-rotate: ; + --tw-invert: ; + --tw-saturate: ; + --tw-sepia: ; + --tw-drop-shadow: ; + --tw-backdrop-blur: ; + --tw-backdrop-brightness: ; + --tw-backdrop-contrast: ; + --tw-backdrop-grayscale: ; + --tw-backdrop-hue-rotate: ; + --tw-backdrop-invert: ; + --tw-backdrop-opacity: ; + --tw-backdrop-saturate: ; + --tw-backdrop-sepia: ; +} + +::backdrop { + --tw-border-spacing-x: 0; + --tw-border-spacing-y: 0; + --tw-translate-x: 0; + --tw-translate-y: 0; + --tw-rotate: 0; + --tw-skew-x: 0; + --tw-skew-y: 0; + --tw-scale-x: 1; + --tw-scale-y: 1; + --tw-pan-x: ; + --tw-pan-y: ; + --tw-pinch-zoom: ; + --tw-scroll-snap-strictness: proximity; + --tw-gradient-from-position: ; + --tw-gradient-via-position: ; + --tw-gradient-to-position: ; + --tw-ordinal: ; + --tw-slashed-zero: ; + --tw-numeric-figure: ; + --tw-numeric-spacing: ; + --tw-numeric-fraction: ; + --tw-ring-inset: ; + --tw-ring-offset-width: 0px; + --tw-ring-offset-color: #fff; + --tw-ring-color: rgb(59 130 246 / 0.5); + --tw-ring-offset-shadow: 0 0 #0000; + --tw-ring-shadow: 0 0 #0000; + --tw-shadow: 0 0 #0000; + --tw-shadow-colored: 0 0 #0000; + --tw-blur: ; + --tw-brightness: ; + --tw-contrast: ; + --tw-grayscale: ; + --tw-hue-rotate: ; + --tw-invert: ; + --tw-saturate: ; + --tw-sepia: ; + --tw-drop-shadow: ; + --tw-backdrop-blur: ; + --tw-backdrop-brightness: ; + --tw-backdrop-contrast: ; + --tw-backdrop-grayscale: ; + --tw-backdrop-hue-rotate: ; + --tw-backdrop-invert: ; + --tw-backdrop-opacity: ; + --tw-backdrop-saturate: ; + --tw-backdrop-sepia: ; +} + +.container { + width: 100%; +} + +@media (min-width: 640px) { + .container { + max-width: 640px; + } +} + +@media (min-width: 768px) { + .container { + max-width: 768px; + } +} + +@media (min-width: 1024px) { + .container { + max-width: 1024px; + } +} + +@media (min-width: 1280px) { + .container { + max-width: 1280px; + } +} + +@media (min-width: 1536px) { + .container { + max-width: 1536px; + } +} + +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + margin: -1px; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border-width: 0; +} + +.collapse { + visibility: collapse; +} + +.static { + position: static; +} + +.absolute { + position: absolute; +} + +.relative { + position: relative; +} + +.bottom-0 { + bottom: 0px; +} + +.bottom-\[50\%\] { + bottom: 50%; +} + +.left-0 { + left: 0px; +} + +.left-\[100\%\] { + left: 100%; +} + +.right-0 { + right: 0px; +} + +.top-0 { + top: 0px; +} + +.z-0 { + z-index: 0; +} + +.z-10 { + z-index: 10; +} + +.mx-auto { + margin-left: auto; + margin-right: auto; +} + +.my-2 { + margin-top: 0.5rem; + margin-bottom: 0.5rem; +} + +.my-4 { + margin-top: 1rem; + margin-bottom: 1rem; +} + +.ml-1 { + margin-left: 0.25rem; +} + +.mt-1 { + margin-top: 0.25rem; +} + +.mt-2 { + margin-top: 0.5rem; +} + +.mt-3 { + margin-top: 0.75rem; +} + +.mb-8 { + margin-bottom: 2rem; +} + +.mt-8 { + margin-top: 2rem; +} + +.mt-16 { + margin-top: 4rem; +} + +.mb-4 { + margin-bottom: 1rem; +} + +.block { + display: block; +} + +.inline { + display: inline; +} + +.flex { + display: flex; +} + +.table { + display: table; +} + +.grid { + display: grid; +} + +.hidden { + display: none; +} + +.aspect-square { + aspect-ratio: 1 / 1; +} + +.aspect-\[9\/16\] { + aspect-ratio: 9/16; +} + +.aspect-\[342\/513\] { + aspect-ratio: 342/513; +} + +.h-24 { + height: 6rem; +} + +.h-6 { + height: 1.5rem; +} + +.h-8 { + height: 2rem; +} + +.h-full { + height: 100%; +} + +.h-screen { + height: 100vh; +} + +.h-auto { + height: auto; +} + +.h-48 { + height: 12rem; +} + +.h-12 { + height: 3rem; +} + +.h-52 { + height: 13rem; +} + +.h-96 { + height: 24rem; +} + +.w-6 { + width: 1.5rem; +} + +.w-8 { + width: 2rem; +} + +.w-80 { + width: 20rem; +} + +.w-full { + width: 100%; +} + +.w-48 { + width: 12rem; +} + +.w-24 { + width: 6rem; +} + +.w-12 { + width: 3rem; +} + +.flex-1 { + flex: 1 1 0%; +} + +.flex-none { + flex: none; +} + +.shrink-0 { + flex-shrink: 0; +} + +.grid-cols-4 { + grid-template-columns: repeat(4, minmax(0, 1fr)); +} + +.grid-cols-2 { + grid-template-columns: repeat(2, minmax(0, 1fr)); +} + +.grid-cols-1 { + grid-template-columns: repeat(1, minmax(0, 1fr)); +} + +.grid-cols-3 { + grid-template-columns: repeat(3, minmax(0, 1fr)); +} + +.flex-row { + flex-direction: row; +} + +.flex-col { + flex-direction: column; +} + +.items-center { + align-items: center; +} + +.justify-center { + justify-content: center; +} + +.justify-between { + justify-content: space-between; +} + +.gap-4 { + gap: 1rem; +} + +.gap-8 { + gap: 2rem; +} + +.gap-16 { + gap: 4rem; +} + +.truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; +} + +.bg-slate-400 { + --tw-bg-opacity: 1; + background-color: rgb(148 163 184 / var(--tw-bg-opacity)); +} + +.bg-gray-400 { + --tw-bg-opacity: 1; + background-color: rgb(156 163 175 / var(--tw-bg-opacity)); +} + +.bg-gray-200 { + --tw-bg-opacity: 1; + background-color: rgb(229 231 235 / var(--tw-bg-opacity)); +} + +.bg-cover { + background-size: cover; +} + +.object-cover { + -o-object-fit: cover; + object-fit: cover; +} + +.px-2 { + padding-left: 0.5rem; + padding-right: 0.5rem; +} + +.py-1 { + padding-top: 0.25rem; + padding-bottom: 0.25rem; +} + +.py-2 { + padding-top: 0.5rem; + padding-bottom: 0.5rem; +} + +.py-8 { + padding-top: 2rem; + padding-bottom: 2rem; +} + +.pl-2 { + padding-left: 0.5rem; +} + +.pr-0 { + padding-right: 0px; +} + +.pr-8 { + padding-right: 2rem; +} + +.text-justify { + text-align: justify; +} + +.text-2xl { + font-size: 1.5rem; + line-height: 2rem; +} + +.text-lg { + font-size: 1.125rem; + line-height: 1.75rem; +} + +.text-sm { + font-size: 0.875rem; + line-height: 1.25rem; +} + +.text-3xl { + font-size: 1.875rem; + line-height: 2.25rem; +} + +.text-base { + font-size: 1rem; + line-height: 1.5rem; +} + +.text-xl { + font-size: 1.25rem; + line-height: 1.75rem; +} + +.font-bold { + font-weight: 700; +} + +.filter { + filter: var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow); +} + +body { + --tw-bg-opacity: 1; + background-color: rgb(255 255 255 / var(--tw-bg-opacity)); + --tw-text-opacity: 1; + color: rgb(55 65 81 / var(--tw-text-opacity)); + font-weight: 500; +} + +.icon-tabler { + stroke-width: 1px; + fill: none; + stroke: currentColor; +} + +@media (min-width: 768px) { + .md\:flex { + display: flex; + } + + .md\:grid-cols-4 { + grid-template-columns: repeat(4, minmax(0, 1fr)); + } + + .md\:grid-cols-3 { + grid-template-columns: repeat(3, minmax(0, 1fr)); + } + + .md\:grid-cols-2 { + grid-template-columns: repeat(2, minmax(0, 1fr)); + } +} + +@media (min-width: 1024px) { + .lg\:flex { + display: flex; + } + + .lg\:flex-1 { + flex: 1 1 0%; + } + + .lg\:grid-cols-4 { + grid-template-columns: repeat(4, minmax(0, 1fr)); + } + + .lg\:items-center { + align-items: center; + } +} diff --git a/assets/js/custom.js b/assets/js/custom.js new file mode 100644 index 0000000..f4c0bc8 --- /dev/null +++ b/assets/js/custom.js @@ -0,0 +1,4 @@ +/* + * Custom code goes here. + * A template should always ship with an empty custom.js + */ diff --git a/assets/js/theme.js b/assets/js/theme.js new file mode 100644 index 0000000..d1b0e87 --- /dev/null +++ b/assets/js/theme.js @@ -0,0 +1 @@ +!function(t){function e(i){if(n[i])return n[i].exports;var r=n[i]={i:i,l:!1,exports:{}};return t[i].call(r.exports,r,r.exports,e),r.l=!0,r.exports}var n={};e.m=t,e.c=n,e.i=function(t){return t},e.d=function(t,n,i){e.o(t,n)||Object.defineProperty(t,n,{configurable:!1,enumerable:!0,get:i})},e.n=function(t){var n=t&&t.__esModule?function(){return t.default}:function(){return t};return e.d(n,"a",n),n},e.o=function(t,e){return Object.prototype.hasOwnProperty.call(t,e)},e.p="",e(e.s=26)}([function(t,e){t.exports=jQuery},function(t,e){t.exports=prestashop},function(t,e,n){"use strict";function i(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}Object.defineProperty(e,"__esModule",{value:!0});var r=function(){function t(t,e){for(var n=0;n5&&function(){var t=0;(0,a.default)(e).find(".color").each(function(e,n){e>4&&((0,a.default)(n).hide(),t++)}),(0,a.default)(e).find(".js-count").append("+"+t)}()})}}]),t}();e.default=s,t.exports=e.default},function(t,e,n){"use strict";var i,r;!function(t){function e(t){var e=t.length,i=n.type(t);return"function"!==i&&!n.isWindow(t)&&(!(1!==t.nodeType||!e)||("array"===i||0===e||"number"==typeof e&&e>0&&e-1 in t))}if(!t.jQuery){var n=function t(e,n){return new t.fn.init(e,n)};n.isWindow=function(t){return t&&t===t.window},n.type=function(t){return t?"object"==typeof t||"function"==typeof t?r[a.call(t)]||"object":typeof t:t+""},n.isArray=Array.isArray||function(t){return"array"===n.type(t)},n.isPlainObject=function(t){var e;if(!t||"object"!==n.type(t)||t.nodeType||n.isWindow(t))return!1;try{if(t.constructor&&!o.call(t,"constructor")&&!o.call(t.constructor.prototype,"isPrototypeOf"))return!1}catch(t){return!1}for(e in t);return void 0===e||o.call(t,e)},n.each=function(t,n,i){var r=0,o=t.length,a=e(t);if(i){if(a)for(;r0?r=a:n=a}while(Math.abs(o)>v&&++s=g?c(e,s):0===l?s:d(e,n,n+_)}function h(){E=!0,t===n&&i===r||f()}var m=4,g=.001,v=1e-7,y=10,b=11,_=1/(b-1),x="Float32Array"in e;if(4!==arguments.length)return!1;for(var w=0;w<4;++w)if("number"!=typeof arguments[w]||isNaN(arguments[w])||!isFinite(arguments[w]))return!1;t=Math.min(t,1),i=Math.min(i,1),t=Math.max(t,0),i=Math.max(i,0);var S=x?new Float32Array(b):new Array(b),E=!1,C=function(e){return E||h(),t===n&&i===r?e:0===e?0:1===e?1:l(p(e),n,r)};C.getControlPoints=function(){return[{x:t,y:n},{x:i,y:r}]};var T="generateBezier("+[t,n,i,r]+")";return C.toString=function(){return T},C}function f(t,e){var n=t;return _.isString(t)?E.Easings[t]||(n=!1):n=_.isArray(t)&&1===t.length?u.apply(null,t):_.isArray(t)&&2===t.length?C.apply(null,t.concat([e])):!(!_.isArray(t)||4!==t.length)&&c.apply(null,t),!1===n&&(n=E.Easings[E.defaults.easing]?E.defaults.easing:S),n}function d(t){if(t){var e=E.timestamp&&!0!==t?t:v.now(),n=E.State.calls.length;n>1e4&&(E.State.calls=r(E.State.calls),n=E.State.calls.length);for(var o=0;o4;t--){var e=n.createElement("div");if(e.innerHTML="\x3c!--[if IE "+t+"]>=0?e:Math.max(0,i+e),s=n<0?i+n:Math.min(n,i),l=s-a;if(l>0)if(o=new Array(l),this.charAt)for(r=0;r=0}:function(t,e){for(var n=0;n1e-4&&Math.abs(s.v)>1e-4))break;return o?function(t){return u[t*(u.length-1)|0]}:c}}();E.Easings={linear:function(t){return t},swing:function(t){return.5-Math.cos(t*Math.PI)/2},spring:function(t){return 1-Math.cos(4.5*t*Math.PI)*Math.exp(6*-t)}},h.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(t,e){E.Easings[e[0]]=c.apply(null,e[1])});var T=E.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"],units:["%","em","ex","ch","rem","vw","vh","vmin","vmax","cm","mm","Q","in","pc","pt","px","deg","grad","rad","turn","s","ms"],colorNames:{aliceblue:"240,248,255",antiquewhite:"250,235,215",aquamarine:"127,255,212",aqua:"0,255,255",azure:"240,255,255",beige:"245,245,220",bisque:"255,228,196",black:"0,0,0",blanchedalmond:"255,235,205",blueviolet:"138,43,226",blue:"0,0,255",brown:"165,42,42",burlywood:"222,184,135",cadetblue:"95,158,160",chartreuse:"127,255,0",chocolate:"210,105,30",coral:"255,127,80",cornflowerblue:"100,149,237",cornsilk:"255,248,220",crimson:"220,20,60",cyan:"0,255,255",darkblue:"0,0,139",darkcyan:"0,139,139",darkgoldenrod:"184,134,11",darkgray:"169,169,169",darkgrey:"169,169,169",darkgreen:"0,100,0",darkkhaki:"189,183,107",darkmagenta:"139,0,139",darkolivegreen:"85,107,47",darkorange:"255,140,0",darkorchid:"153,50,204",darkred:"139,0,0",darksalmon:"233,150,122",darkseagreen:"143,188,143",darkslateblue:"72,61,139",darkslategray:"47,79,79",darkturquoise:"0,206,209",darkviolet:"148,0,211",deeppink:"255,20,147",deepskyblue:"0,191,255",dimgray:"105,105,105",dimgrey:"105,105,105",dodgerblue:"30,144,255",firebrick:"178,34,34",floralwhite:"255,250,240",forestgreen:"34,139,34",fuchsia:"255,0,255",gainsboro:"220,220,220",ghostwhite:"248,248,255",gold:"255,215,0",goldenrod:"218,165,32",gray:"128,128,128",grey:"128,128,128",greenyellow:"173,255,47",green:"0,128,0",honeydew:"240,255,240",hotpink:"255,105,180",indianred:"205,92,92",indigo:"75,0,130",ivory:"255,255,240",khaki:"240,230,140",lavenderblush:"255,240,245",lavender:"230,230,250",lawngreen:"124,252,0",lemonchiffon:"255,250,205",lightblue:"173,216,230",lightcoral:"240,128,128",lightcyan:"224,255,255",lightgoldenrodyellow:"250,250,210",lightgray:"211,211,211",lightgrey:"211,211,211",lightgreen:"144,238,144",lightpink:"255,182,193",lightsalmon:"255,160,122",lightseagreen:"32,178,170",lightskyblue:"135,206,250",lightslategray:"119,136,153",lightsteelblue:"176,196,222",lightyellow:"255,255,224",limegreen:"50,205,50",lime:"0,255,0",linen:"250,240,230",magenta:"255,0,255",maroon:"128,0,0",mediumaquamarine:"102,205,170",mediumblue:"0,0,205",mediumorchid:"186,85,211",mediumpurple:"147,112,219",mediumseagreen:"60,179,113",mediumslateblue:"123,104,238",mediumspringgreen:"0,250,154",mediumturquoise:"72,209,204",mediumvioletred:"199,21,133",midnightblue:"25,25,112",mintcream:"245,255,250",mistyrose:"255,228,225",moccasin:"255,228,181",navajowhite:"255,222,173",navy:"0,0,128",oldlace:"253,245,230",olivedrab:"107,142,35",olive:"128,128,0",orangered:"255,69,0",orange:"255,165,0",orchid:"218,112,214",palegoldenrod:"238,232,170",palegreen:"152,251,152",paleturquoise:"175,238,238",palevioletred:"219,112,147",papayawhip:"255,239,213",peachpuff:"255,218,185",peru:"205,133,63",pink:"255,192,203",plum:"221,160,221",powderblue:"176,224,230",purple:"128,0,128",red:"255,0,0",rosybrown:"188,143,143",royalblue:"65,105,225",saddlebrown:"139,69,19",salmon:"250,128,114",sandybrown:"244,164,96",seagreen:"46,139,87",seashell:"255,245,238",sienna:"160,82,45",silver:"192,192,192",skyblue:"135,206,235",slateblue:"106,90,205",slategray:"112,128,144",snow:"255,250,250",springgreen:"0,255,127",steelblue:"70,130,180",tan:"210,180,140",teal:"0,128,128",thistle:"216,191,216",tomato:"255,99,71",turquoise:"64,224,208",violet:"238,130,238",wheat:"245,222,179",whitesmoke:"245,245,245",white:"255,255,255",yellowgreen:"154,205,50",yellow:"255,255,0"}},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var t=0;t=1?"":"alpha(opacity="+parseInt(100*parseFloat(n),10)+")"}else switch(t){case"name":return"opacity";case"extract":case"inject":return n}}},register:function(){function t(t,e,n){if("border-box"===T.getPropertyValue(e,"boxSizing").toString().toLowerCase()===(n||!1)){var i,r,o=0,a="width"===t?["Left","Right"]:["Top","Bottom"],s=["padding"+a[0],"padding"+a[1],"border"+a[0]+"Width","border"+a[1]+"Width"];for(i=0;i9)||E.State.isGingerbread||(T.Lists.transformsBase=T.Lists.transformsBase.concat(T.Lists.transforms3D));for(var n=0;n8)&&3===o.split(" ").length&&(o+=" 1"),o;case"inject":return/^rgb/.test(r)?r:(m<=8?4===r.split(" ").length&&(r=r.split(/\s+/).slice(0,3).join(" ")):3===r.split(" ").length&&(r+=" 1"),(m<=8?"rgb":"rgba")+"("+r.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")")}}}();T.Normalizations.registered.innerWidth=e("width",!0),T.Normalizations.registered.innerHeight=e("height",!0),T.Normalizations.registered.outerWidth=e("width"),T.Normalizations.registered.outerHeight=e("height")}},Names:{camelCase:function(t){return t.replace(/-(\w)/g,function(t,e){return e.toUpperCase()})},SVGAttribute:function(t){var e="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(m||E.State.isAndroid&&!E.State.isChrome)&&(e+="|transform"),new RegExp("^("+e+")$","i").test(t)},prefixCheck:function(t){if(E.State.prefixMatches[t])return[E.State.prefixMatches[t],!0];for(var e=["","Webkit","Moz","ms","O"],n=0,i=e.length;n=4&&"("===P?k++:(k&&k<5||k>=4&&")"===P&&--k<5)&&(k=0),0===D&&"r"===P||1===D&&"g"===P||2===D&&"b"===P||3===D&&"a"===P||D>=3&&"("===P?(3===D&&"a"===P&&(N=1),D++):N&&","===P?++N>3&&(D=N=0):(N&&D<(N?5:4)||D>=(N?4:3)&&")"===P&&--D<(N?5:4))&&(D=N=0)}}C===v.length&&A===m.length||(E.debug,a=i),a&&(I.length?(E.debug,v=I,m=O,b=x=""):a=i)}a||(y=S(r,v),v=y[0],x=y[1],y=S(r,m),m=y[0].replace(/^([+-\/*])=/,function(t,e){return w=e,""}),b=y[1],v=parseFloat(v)||0,m=parseFloat(m)||0,"%"===b&&(/^(fontSize|lineHeight)$/.test(r)?(m/=100,b="em"):/^scale/.test(r)?(m/=100,b=""):/(Red|Green|Blue)$/i.test(r)&&(m=m/100*255,b="")));if(/[\/*]/.test(w))b=x;else if(x!==b&&0!==v)if(0===m)b=x;else{s=s||function(){var i={myParent:t.parentNode||n.body,position:T.getPropertyValue(t,"position"),fontSize:T.getPropertyValue(t,"fontSize")},r=i.position===F.lastPosition&&i.myParent===F.lastParent,o=i.fontSize===F.lastFontSize;F.lastParent=i.myParent,F.lastPosition=i.position,F.lastFontSize=i.fontSize;var a={};if(o&&r)a.emToPx=F.lastEmToPx,a.percentToPxWidth=F.lastPercentToPxWidth,a.percentToPxHeight=F.lastPercentToPxHeight;else{var s=c&&c.isSVG?n.createElementNS("http://www.w3.org/2000/svg","rect"):n.createElement("div");E.init(s),i.myParent.appendChild(s),h.each(["overflow","overflowX","overflowY"],function(t,e){E.CSS.setPropertyValue(s,e,"hidden")}),E.CSS.setPropertyValue(s,"position",i.position),E.CSS.setPropertyValue(s,"fontSize",i.fontSize),E.CSS.setPropertyValue(s,"boxSizing","content-box"),h.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(t,e){E.CSS.setPropertyValue(s,e,"100%")}),E.CSS.setPropertyValue(s,"paddingLeft","100em"),a.percentToPxWidth=F.lastPercentToPxWidth=(parseFloat(T.getPropertyValue(s,"width",null,!0))||1)/100,a.percentToPxHeight=F.lastPercentToPxHeight=(parseFloat(T.getPropertyValue(s,"height",null,!0))||1)/100,a.emToPx=F.lastEmToPx=(parseFloat(T.getPropertyValue(s,"paddingLeft"))||1)/100,i.myParent.removeChild(s)}return null===F.remToPx&&(F.remToPx=parseFloat(T.getPropertyValue(n.body,"fontSize"))||16),null===F.vwToPx&&(F.vwToPx=parseFloat(e.innerWidth)/100,F.vhToPx=parseFloat(e.innerHeight)/100),a.remToPx=F.remToPx,a.vwToPx=F.vwToPx,a.vhToPx=F.vhToPx,E.debug,a}();var q=/margin|padding|left|right|width|text|word|letter/i.test(r)||/X$/.test(r)||"x"===r?"x":"y";switch(x){case"%":v*="x"===q?s.percentToPxWidth:s.percentToPxHeight;break;case"px":break;default:v*=s[x+"ToPx"]}switch(b){case"%":v*=1/("x"===q?s.percentToPxWidth:s.percentToPxHeight);break;case"px":break;default:v*=1/s[b+"ToPx"]}}switch(w){case"+":m=v+m;break;case"-":m=v-m;break;case"*":m*=v;break;case"/":m=v/m}u[r]={rootPropertyValue:d,startValue:v,currentValue:v,endValue:m,unitType:b,easing:g},a&&(u[r].pattern=a),E.debug};for(var L in x)if(x.hasOwnProperty(L)){var j=T.Names.camelCase(L),B=function(e,n){var i,o,a;return _.isFunction(e)&&(e=e.call(t,r,I)),_.isArray(e)?(i=e[0],!_.isArray(e[1])&&/^[\d-]/.test(e[1])||_.isFunction(e[1])||T.RegEx.isHex.test(e[1])?a=e[1]:_.isString(e[1])&&!T.RegEx.isHex.test(e[1])&&E.Easings[e[1]]||_.isArray(e[1])?(o=n?e[1]:f(e[1],l.duration),a=e[2]):a=e[1]||e[2]):i=e,n||(o=o||l.easing),_.isFunction(i)&&(i=i.call(t,r,I)),_.isFunction(a)&&(a=a.call(t,r,I)),[i||0,o,a]}(x[L]);if(b(T.Lists.colors,j)){var V=B[0],M=B[1],H=B[2];if(T.RegEx.isHex.test(V)){for(var W=["Red","Green","Blue"],U=T.Values.hexToRgb(V),q=H?T.Values.hexToRgb(H):i,z=0;z0?"up":"down"}function d(t){var e=(0,a.default)(t.currentTarget),n=e.data("update-url"),i=e.attr("value"),r=e.val();if(r!=parseInt(r)||r<0||isNaN(r))return void e.val(i);var o=r-i;0!==o&&(e.attr("value",r),s(n,c(o),e))}var h=".js-cart-line-product-quantity",m=[];l.default.on("updateCart",function(){(0,a.default)(".quickview").modal("hide")}),l.default.on("updatedCart",function(){r()}),r();var g=(0,a.default)("body"),v=function(){for(var t;m.length>0;)t=m.pop(),t.abort()},y=function(t){return(0,a.default)(t.parents(".bootstrap-touchspin").find("input"))},b=function(t){t.preventDefault();var e=(0,a.default)(t.currentTarget),n=t.currentTarget.dataset,i=o(e,t.namespace),r={ajax:"1",action:"update"};void 0!==i&&(v(),a.default.ajax({url:i.url,method:"POST",data:r,dataType:"json",beforeSend:function(t){m.push(t)}}).then(function(t){p.checkUpdateOpertation(t),y(e).val(t.quantity),l.default.emit("updateCart",{reason:n})}).fail(function(t){l.default.emit("handleError",{eventType:"updateProductInCart",resp:t,cartAction:i.type})}))};g.on("click",'[data-link-action="delete-from-cart"], [data-link-action="remove-voucher"]',b),g.on("touchspin.on.startdownspin",u,b),g.on("touchspin.on.startupspin",u,b),g.on("focusout keyup",h,function(t){if("keyup"===t.type)return 13===t.keyCode&&d(t),!1;d(t)});g.on("hidden.bs.collapse","#promo-code",function(){(0,a.default)(".display-promo").show(400)}),g.on("click",".promo-code-button",function(t){t.preventDefault(),(0,a.default)("#promo-code").collapse("toggle")}),g.on("click",".display-promo",function(t){(0,a.default)(t.currentTarget).hide(400)}),g.on("click",".js-discount .code",function(t){t.stopPropagation();var e=(0,a.default)(t.currentTarget);return(0,a.default)("[name=discount_name]").val(e.text()),(0,a.default)("#promo-code").collapse("show"),(0,a.default)(".display-promo").hide(400),!1})});var p={switchErrorStat:function(){var t=(0,a.default)(".checkout a");if(((0,a.default)("#notifications article.alert-danger").length||""!==d&&!c)&&t.addClass("disabled"),""!==d){var e=' ";(0,a.default)("#notifications .container").html(e),d="",f=!1,c&&t.removeClass("disabled")}else!c&&f&&(c=!1,f=!1,(0,a.default)("#notifications .container").html(""),t.removeClass("disabled"))},checkUpdateOpertation:function(t){c=t.hasOwnProperty("hasError");var e=t.errors||"";d=e instanceof Array?e.join(" "):e,f=!0}}},function(t,e,n){"use strict";function i(t){return t&&t.__esModule?t:{default:t}}function r(){(0,s.default)(".js-terms a").on("click",function(t){t.preventDefault();var e=(0,s.default)(t.target).attr("href");e&&(e+="?content_only=1",s.default.get(e,function(t){(0,s.default)("#modal").find(".js-modal-content").html((0,s.default)(t).find(".page-cms").contents())}).fail(function(t){u.default.emit("handleError",{eventType:"clickTerms",resp:t})})),(0,s.default)("#modal").modal("show")}),(0,s.default)(".js-gift-checkbox").on("click",function(t){(0,s.default)("#gift").collapse("toggle")})}function o(){(0,s.default)(".card-block .cart-summary-products p a").on("click",function(t){t=(0,s.default)(this).find("i.material-icons"),"expand_more"==t.text()?t.text("expand_less"):t.text("expand_more")})}var a=n(0),s=i(a),l=n(1),u=i(l);(0,s.default)(document).ready(function(){1===(0,s.default)("body#checkout").length&&(r(),o()),u.default.on("updatedDeliveryForm",function(t){void 0!==t.deliveryOption&&0!==t.deliveryOption.length&&((0,s.default)(".carrier-extra-content").hide(),t.deliveryOption.next(".carrier-extra-content").slideDown())})})},function(t,e,n){"use strict";function i(t){return t&&t.__esModule?t:{default:t}}var r=n(1),o=i(r),a=n(0),s=i(a);o.default.blockcart=o.default.blockcart||{},o.default.blockcart.showModal=function(t){function e(){return(0,s.default)("#blockcart-modal")}var n=e();n.length&&n.remove(),(0,s.default)("body").append(t),n=e(),n.modal("show").on("hidden.bs.modal",function(t){o.default.emit("updateProduct",{reason:t.currentTarget.dataset,event:t})})}},function(t,e,n){"use strict";function i(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}Object.defineProperty(e,"__esModule",{value:!0});var r=function(){function t(t,e){for(var n=0;n(0,a.default)(".js-modal-mask").height()&&(t.move("down"),(0,a.default)(".js-modal-arrow-up").css("opacity","1"))})}},{key:"move",value:function(t){var e=(0,a.default)(".js-modal-product-images"),n=(0,a.default)(".js-modal-product-images li img").height()+10,i=e.position().top;e.velocity({translateY:"up"===t?i+n:i-n},function(){e.position().top>=0?(0,a.default)(".js-modal-arrow-up").css("opacity",".2"):e.position().top+e.height()<=(0,a.default)(".js-modal-mask").height()&&(0,a.default)(".js-modal-arrow-down").css("opacity",".2")})}}]),t}();e.default=s,t.exports=e.default},function(t,e,n){"use strict";function i(t){return t&&t.__esModule?t:{default:t}}function r(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}function o(t,e){if("function"!=typeof e&&null!==e)throw new TypeError("Super expression must either be null or a function, not "+typeof e);t.prototype=Object.create(e&&e.prototype,{constructor:{value:t,enumerable:!1,writable:!0,configurable:!0}}),e&&(Object.setPrototypeOf?Object.setPrototypeOf(t,e):t.__proto__=e)}Object.defineProperty(e,"__esModule",{value:!0});var a=function(){function t(t,e){for(var n=0;n0&&this.options.badge&&this.$elementFilestyle.find("label").append(' '+e.length+""),this.$elementFilestyle.find(".group-span-filestyle").removeClass("input-group-btn")}}},size:function(t){if(void 0===t)return this.options.size;var e=this.$elementFilestyle.find("label"),n=this.$elementFilestyle.find("input");e.removeClass("btn-lg btn-sm"),n.removeClass("input-lg input-sm"),"nr"!=t&&(e.addClass("btn-"+t),n.addClass("input-"+t))},placeholder:function(t){if(void 0===t)return this.options.placeholder;this.options.placeholder=t,this.$elementFilestyle.find("input").attr("placeholder",t)},buttonText:function(t){if(void 0===t)return this.options.buttonText;this.options.buttonText=t,this.$elementFilestyle.find("label .buttonText").html(this.options.buttonText)},buttonName:function(t){if(void 0===t)return this.options.buttonName;this.options.buttonName=t,this.$elementFilestyle.find("label").attr({class:"btn "+this.options.buttonName})},iconName:function(t){if(void 0===t)return this.options.iconName;this.$elementFilestyle.find(".icon-span-filestyle").attr({class:"icon-span-filestyle "+this.options.iconName})},htmlIcon:function(){return this.options.icon?' ':""},htmlInput:function(){return this.options.input?' ':""},pushNameFiles:function(){var t="",e=[];void 0===this.$element[0].files?e[0]={name:this.$element[0]&&this.$element[0].value}:e=this.$element[0].files;for(var n=0;n",i=n.options.buttonBefore?o+n.htmlInput():n.htmlInput()+o,n.$elementFilestyle=t('
'+i+"
"),n.$elementFilestyle.find(".group-span-filestyle").attr("tabindex","0").keypress(function(t){if(13===t.keyCode||32===t.charCode)return n.$elementFilestyle.find("label").click(),!1}),n.$element.css({position:"absolute",clip:"rect(0px 0px 0px 0px)"}).attr("tabindex","-1").after(n.$elementFilestyle),n.options.disabled&&n.$element.attr("disabled","true"),n.$element.change(function(){var t=n.pushNameFiles();0==n.options.input&&n.options.badge?0==n.$elementFilestyle.find(".badge").length?n.$elementFilestyle.find("label").append(' '+t.length+""):0==t.length?n.$elementFilestyle.find(".badge").remove():n.$elementFilestyle.find(".badge").html(t.length):n.$elementFilestyle.find(".badge").remove()}),window.navigator.userAgent.search(/firefox/i)>-1&&n.$elementFilestyle.find("label").click(function(){return n.$element.click(),!1})}};var i=t.fn.filestyle;t.fn.filestyle=function(e,i){var r="",o=this.each(function(){if("file"===t(this).attr("type")){var o=t(this),a=o.data("filestyle"),s=t.extend({},t.fn.filestyle.defaults,e,"object"==typeof e&&e);a||(o.data("filestyle",a=new n(this,s)),a.constructor()),"string"==typeof e&&(r=a[e](i))}});return void 0!==typeof r?r:o},t.fn.filestyle.defaults={buttonText:"Choose file",iconName:"glyphicon glyphicon-folder-open",buttonName:"btn-default",size:"nr",input:!0,badge:!0,icon:!0,buttonBefore:!1,disabled:!1,placeholder:""},t.fn.filestyle.noConflict=function(){return t.fn.filestyle=i,this},t(function(){t(".filestyle").each(function(){var e=t(this),n={input:"false"!==e.attr("data-input"),icon:"false"!==e.attr("data-icon"),buttonBefore:"true"===e.attr("data-buttonBefore"),disabled:"true"===e.attr("data-disabled"),size:e.attr("data-size"),buttonText:e.attr("data-buttonText"),buttonName:e.attr("data-buttonName"),iconName:e.attr("data-iconName"),badge:"false"!==e.attr("data-badge"),placeholder:e.attr("data-placeholder")};e.filestyle(n)})})}(window.jQuery)},function(t,e,n){"use strict";!function(t){t.fn.scrollbox=function(e){var n={linear:!1,startDelay:2,delay:3,step:5,speed:32,switchItems:1,direction:"vertical",distance:"auto",autoPlay:!0,onMouseOverPause:!0,paused:!1,queue:null,listElement:"ul",listItemElement:"li",infiniteLoop:!0,switchAmount:0,afterForward:null,afterBackward:null,triggerStackable:!1};return e=t.extend(n,e),e.scrollOffset="vertical"===e.direction?"scrollTop":"scrollLeft",e.queue&&(e.queue=t("#"+e.queue)),this.each(function(){var n,i,r,o,a,s,l,u,c,f=t(this),d=null,p=null,h=!1,m=0,g=0;e.onMouseOverPause&&(f.bind("mouseover",function(){h=!0}),f.bind("mouseout",function(){h=!1})),n=f.children(e.listElement+":first-child"),!1===e.infiniteLoop&&0===e.switchAmount&&(e.switchAmount=n.children().length),s=function(){if(!h){var r,a,s,l,u;if(r=n.children(e.listItemElement+":first-child"),l="auto"!==e.distance?e.distance:"vertical"===e.direction?r.outerHeight(!0):r.outerWidth(!0),e.linear?s=Math.min(f[0][e.scrollOffset]+e.step,l):(u=Math.max(3,parseInt(.3*(l-f[0][e.scrollOffset]),10)),s=Math.min(f[0][e.scrollOffset]+u,l)),f[0][e.scrollOffset]=s,s>=l){for(a=0;a0?(n.append(e.queue.find(e.listItemElement)[0]),n.children(e.listItemElement+":first-child").remove()):n.append(n.children(e.listItemElement+":first-child")),++m;if(f[0][e.scrollOffset]=0,clearInterval(d),d=null,t.isFunction(e.afterForward)&&e.afterForward.call(f,{switchCount:m,currentFirstChild:n.children(e.listItemElement+":first-child")}),e.triggerStackable&&0!==g)return void i();if(!1===e.infiniteLoop&&m>=e.switchAmount)return;e.autoPlay&&(p=setTimeout(o,1e3*e.delay))}}},l=function(){if(!h){var r,a,s,l,u;if(0===f[0][e.scrollOffset]){for(a=0;a0?(g--,p=setTimeout(o,0)):(g++,p=setTimeout(r,0)))},o=function(){clearInterval(d),d=setInterval(s,e.speed)},r=function(){clearInterval(d),d=setInterval(l,e.speed)},u=function(){e.autoPlay=!0,h=!1,clearInterval(d),d=setInterval(s,e.speed)},c=function(){h=!0},a=function(t){e.delay=t||e.delay,clearTimeout(p),e.autoPlay&&(p=setTimeout(o,1e3*e.delay))},e.autoPlay&&(p=setTimeout(o,1e3*e.startDelay)),f.bind("resetClock",function(t){a(t)}),f.bind("forward",function(){e.triggerStackable?null!==d?g++:o():(clearTimeout(p),o())}),f.bind("backward",function(){e.triggerStackable?null!==d?g--:r():(clearTimeout(p),r())}),f.bind("pauseHover",function(){c()}),f.bind("forwardHover",function(){u()}),f.bind("speedUp",function(t,n){"undefined"===n&&(n=Math.max(1,parseInt(e.speed/2,10))),e.speed=n}),f.bind("speedDown",function(t,n){"undefined"===n&&(n=2*e.speed),e.speed=n}),f.bind("updateConfig",function(n,i){e=t.extend(e,i)})})}}(jQuery)},function(t,e,n){"use strict";function i(t){return t&&t.__esModule?t:{default:t}}function r(t){(0,a.default)("#search_filters").replaceWith(t.rendered_facets),(0,a.default)("#js-active-search-filters").replaceWith(t.rendered_active_filters),(0,a.default)("#js-product-list-top").replaceWith(t.rendered_products_top),(0,a.default)("#js-product-list").replaceWith(t.rendered_products),(0,a.default)("#js-product-list-bottom").replaceWith(t.rendered_products_bottom),t.rendered_products_header&&(0,a.default)("#js-product-list-header").replaceWith(t.rendered_products_header),(new c.default).init()}var o=n(0),a=i(o),s=n(1),l=i(s);n(4);var u=n(3),c=i(u);(0,a.default)(document).ready(function(){l.default.on("clickQuickView",function(e){var n={action:"quickview",id_product:e.dataset.idProduct,id_product_attribute:e.dataset.idProductAttribute};a.default.post(l.default.urls.pages.product,n,null,"json").then(function(e){(0,a.default)("body").append(e.quickview_html);var n=(0,a.default)("#quickview-modal-"+e.product.id+"-"+e.product.id_product_attribute);n.modal("show"),t(n),n.on("hidden.bs.modal",function(){n.remove()})}).fail(function(t){l.default.emit("handleError",{eventType:"clickQuickView",resp:t})})});var t=function(t){var n=(0,a.default)(".js-arrows"),i=t.find(".js-qv-product-images");(0,a.default)(".js-thumb").on("click",function(t){(0,a.default)(".js-thumb").hasClass("selected")&&(0,a.default)(".js-thumb").removeClass("selected"),(0,a.default)(t.currentTarget).addClass("selected"),(0,a.default)(".js-qv-product-cover").attr("src",(0,a.default)(t.target).data("image-large-src"))}),i.find("li").length<=4?n.hide():n.on("click",function(t){(0,a.default)(t.target).hasClass("arrow-up")&&(0,a.default)(".js-qv-product-images").position().top<0?(e("up"),(0,a.default)(".arrow-down").css("opacity","1")):(0,a.default)(t.target).hasClass("arrow-down")&&i.position().top+i.height()>(0,a.default)(".js-qv-mask").height()&&(e("down"),(0,a.default)(".arrow-up").css("opacity","1"))}),t.find("#quantity_wanted").TouchSpin({verticalbuttons:!0,verticalupclass:"material-icons touchspin-up",verticaldownclass:"material-icons touchspin-down",buttondown_class:"btn btn-touchspin js-touchspin",buttonup_class:"btn btn-touchspin js-touchspin",min:1,max:1e6})},e=function(t){var e=(0,a.default)(".js-qv-product-images"),n=(0,a.default)(".js-qv-product-images li img").height()+20,i=e.position().top;e.velocity({translateY:"up"===t?i+n:i-n},function(){e.position().top>=0?(0,a.default)(".arrow-up").css("opacity",".2"):e.position().top+e.height()<=(0,a.default)(".js-qv-mask").height()&&(0,a.default)(".arrow-down").css("opacity",".2")})};(0,a.default)("body").on("click","#search_filter_toggler",function(){(0,a.default)("#search_filters_wrapper").removeClass("hidden-sm-down"),(0,a.default)("#content-wrapper").addClass("hidden-sm-down"),(0,a.default)("#footer").addClass("hidden-sm-down")}),(0,a.default)("#search_filter_controls .clear").on("click",function(){(0,a.default)("#search_filters_wrapper").addClass("hidden-sm-down"),(0,a.default)("#content-wrapper").removeClass("hidden-sm-down"),(0,a.default)("#footer").removeClass("hidden-sm-down")}),(0,a.default)("#search_filter_controls .ok").on("click",function(){(0,a.default)("#search_filters_wrapper").addClass("hidden-sm-down"),(0,a.default)("#content-wrapper").removeClass("hidden-sm-down"),(0,a.default)("#footer").removeClass("hidden-sm-down")});var n=function(t){if(void 0!==t.target.dataset.searchUrl)return t.target.dataset.searchUrl;if(void 0===(0,a.default)(t.target).parent()[0].dataset.searchUrl)throw new Error("Can not parse search URL");return(0,a.default)(t.target).parent()[0].dataset.searchUrl};(0,a.default)("body").on("change","#search_filters input[data-search-url]",function(t){l.default.emit("updateFacets",n(t))}),(0,a.default)("body").on("click",".js-search-filters-clear-all",function(t){l.default.emit("updateFacets",n(t))}),(0,a.default)("body").on("click",".js-search-link",function(t){t.preventDefault(),l.default.emit("updateFacets",(0,a.default)(t.target).closest("a").get(0).href)}),(0,a.default)("body").on("change","#search_filters select",function(t){var e=(0,a.default)(t.target).closest("form");l.default.emit("updateFacets","?"+e.serialize())}),l.default.on("updateProductList",function(t){r(t),window.scrollTo(0,0)})})},function(t,e,n){"use strict";function i(t){return t&&t.__esModule?t:{default:t}}var r=n(0),o=i(r),a=n(1),s=i(a);(0,o.default)(document).ready(function(){function t(){(0,o.default)(".js-thumb").on("click",function(t){(0,o.default)(".js-modal-product-cover").attr("src",(0,o.default)(t.target).data("image-large-src")),(0,o.default)(".selected").removeClass("selected"),(0,o.default)(t.target).addClass("selected"),(0,o.default)(".js-qv-product-cover").prop("src",(0,o.default)(t.currentTarget).data("image-large-src"))})}function e(){(0,o.default)("#main .js-qv-product-images li").length>2?((0,o.default)("#main .js-qv-mask").addClass("scroll"),(0,o.default)(".scroll-box-arrows").addClass("scroll"),(0,o.default)("#main .js-qv-mask").scrollbox({direction:"h",distance:113,autoPlay:!1}),(0,o.default)(".scroll-box-arrows .left").click(function(){(0,o.default)("#main .js-qv-mask").trigger("backward")}),(0,o.default)(".scroll-box-arrows .right").click(function(){(0,o.default)("#main .js-qv-mask").trigger("forward")})):((0,o.default)("#main .js-qv-mask").removeClass("scroll"),(0,o.default)(".scroll-box-arrows").removeClass("scroll"))}function n(){(0,o.default)(".js-file-input").on("change",function(t){var e=void 0,n=void 0;(e=(0,o.default)(t.currentTarget)[0])&&(n=e.files[0])&&(0,o.default)(e).prev().text(n.name)})}!function(){var t=(0,o.default)("#quantity_wanted");t.TouchSpin({verticalbuttons:!0,verticalupclass:"material-icons touchspin-up",verticaldownclass:"material-icons touchspin-down",buttondown_class:"btn btn-touchspin js-touchspin",buttonup_class:"btn btn-touchspin js-touchspin",min:parseInt(t.attr("min"),10),max:1e6}),(0,o.default)("body").on("change keyup","#quantity_wanted",function(t){(0,o.default)(t.currentTarget).trigger("touchspin.stopspin"),s.default.emit("updateProduct",{eventType:"updatedProductQuantity",event:t})})}(),n(),t(),e(),s.default.on("updatedProduct",function(i){if(n(),t(),i&&i.product_minimal_quantity){var r=parseInt(i.product_minimal_quantity,10);(0,o.default)("#quantity_wanted").trigger("touchspin.updatesettings",{min:r})}e(),(0,o.default)((0,o.default)(".tabs .nav-link.active").attr("href")).addClass("active").removeClass("fade"),(0,o.default)(".js-product-images-modal").replaceWith(i.product_images_modal)})})},function(t,e,n){"use strict";function i(t){return t&&t.__esModule?t:{default:t}}function r(t,e){var n=e.children().detach();e.empty().append(t.children().detach()),t.append(n)}function o(){u.default.responsive.mobile?(0,s.default)("*[id^='_desktop_']").each(function(t,e){var n=(0,s.default)("#"+e.id.replace("_desktop_","_mobile_"));n.length&&r((0,s.default)(e),n)}):(0,s.default)("*[id^='_mobile_']").each(function(t,e){var n=(0,s.default)("#"+e.id.replace("_mobile_","_desktop_"));n.length&&r((0,s.default)(e),n)}),u.default.emit("responsive update",{mobile:u.default.responsive.mobile})}var a=n(0),s=i(a),l=n(1),u=i(l);u.default.responsive=u.default.responsive||{},u.default.responsive.current_width=window.innerWidth,u.default.responsive.min_width=768,u.default.responsive.mobile=u.default.responsive.current_width=e&&n=e;u.default.responsive.current_width=n,u.default.responsive.mobile=u.default.responsive.current_width'+T.prefix+"",s=''+T.postfix+"";r.hasClass("input-group-btn")?(n='",r.append(n)):(n='",t(n).insertBefore(L)),o.hasClass("input-group-btn")?(i='",o.prepend(i)):(i='",t(i).insertAfter(L)),t(a).insertBefore(L),t(s).insertAfter(L),A=e}function p(){var e;e=T.verticalbuttons?'
'+T.prefix+''+T.postfix+'
':'
'+T.prefix+''+T.postfix+'
",A=t(e).insertBefore(L),t(".bootstrap-touchspin-prefix",A).after(L),L.hasClass("input-sm")?A.addClass("input-group-sm"):L.hasClass("input-lg")&&A.addClass("input-group-lg")}function h(){I={down:t(".bootstrap-touchspin-down",A),up:t(".bootstrap-touchspin-up",A),input:t("input",A),prefix:t(".bootstrap-touchspin-prefix",A).addClass(T.prefix_extraclass),postfix:t(".bootstrap-touchspin-postfix",A).addClass(T.postfix_extraclass)}}function m(){""===T.prefix&&I.prefix.hide(),""===T.postfix&&I.postfix.hide()}function g(){L.on("keydown",function(t){var e=t.keyCode||t.which;38===e?("up"!==V&&(x(),E()),t.preventDefault()):40===e&&("down"!==V&&(w(),S()),t.preventDefault())}),L.on("keyup",function(t){var e=t.keyCode||t.which;38===e?C():40===e&&C()}),L.on("blur",function(){b()}),I.down.on("keydown",function(t){var e=t.keyCode||t.which;32!==e&&13!==e||("down"!==V&&(w(),S()),t.preventDefault())}),I.down.on("keyup",function(t){var e=t.keyCode||t.which;32!==e&&13!==e||C()}),I.up.on("keydown",function(t){var e=t.keyCode||t.which;32!==e&&13!==e||("up"!==V&&(x(),E()),t.preventDefault())}),I.up.on("keyup",function(t){var e=t.keyCode||t.which;32!==e&&13!==e||C()}),I.down.on("mousedown.touchspin",function(t){I.down.off("touchstart.touchspin"),L.is(":disabled")||(w(),S(),t.preventDefault(),t.stopPropagation())}),I.down.on("touchstart.touchspin",function(t){I.down.off("mousedown.touchspin"),L.is(":disabled")||(w(),S(),t.preventDefault(),t.stopPropagation())}),I.up.on("mousedown.touchspin",function(t){I.up.off("touchstart.touchspin"),L.is(":disabled")||(x(),E(),t.preventDefault(),t.stopPropagation())}),I.up.on("touchstart.touchspin",function(t){I.up.off("mousedown.touchspin"),L.is(":disabled")||(x(),E(),t.preventDefault(),t.stopPropagation())}),I.up.on("mouseout touchleave touchend touchcancel",function(t){V&&(t.stopPropagation(),C())}),I.down.on("mouseout touchleave touchend touchcancel",function(t){V&&(t.stopPropagation(),C())}),I.down.on("mousemove touchmove",function(t){V&&(t.stopPropagation(),t.preventDefault())}),I.up.on("mousemove touchmove",function(t){V&&(t.stopPropagation(),t.preventDefault())}),t(document).on(n(["mouseup","touchend","touchcancel"],i).join(" "),function(t){V&&(t.preventDefault(),C())}),t(document).on(n(["mousemove","touchmove","scroll","scrollstart"],i).join(" "),function(t){V&&(t.preventDefault(),C())}),L.on("mousewheel DOMMouseScroll",function(t){if(T.mousewheel&&L.is(":focus")){var e=t.originalEvent.wheelDelta||-t.originalEvent.deltaY||-t.originalEvent.detail;t.stopPropagation(),t.preventDefault(),e<0?w():x()}})}function v(){L.on("touchspin.uponce",function(){C(),x()}),L.on("touchspin.downonce",function(){C(),w()}),L.on("touchspin.startupspin",function(){E()}),L.on("touchspin.startdownspin",function(){S()}),L.on("touchspin.stopspin",function(){C()}),L.on("touchspin.updatesettings",function(t,e){s(e)})}function y(t){switch(T.forcestepdivisibility){case"round":return(Math.round(t/T.step)*T.step).toFixed(T.decimals);case"floor":return(Math.floor(t/T.step)*T.step).toFixed(T.decimals);case"ceil":return(Math.ceil(t/T.step)*T.step).toFixed(T.decimals);default:return t}}function b(){var t,e,n;if(""===(t=L.val()))return void(""!==T.replacementval&&(L.val(T.replacementval),L.trigger("change")));T.decimals>0&&"."===t||(e=parseFloat(t),isNaN(e)&&(e=""!==T.replacementval?T.replacementval:0),n=e,e.toString()!==t&&(n=e),eT.max&&(n=T.max),n=y(n),Number(t).toString()!==n.toString()&&(L.val(n),L.trigger("change")))}function _(){if(T.booster){var t=Math.pow(2,Math.floor(B/T.boostat))*T.step;return T.maxboostedstep&&t>T.maxboostedstep&&(t=T.maxboostedstep,O=Math.round(O/t)*t),Math.max(T.step,t)}return T.step}function x(){b(),O=parseFloat(I.input.val()),isNaN(O)&&(O=0);var t=O,e=_();O+=e,O>T.max&&(O=T.max,L.trigger("touchspin.on.max"),C()),I.input.val(Number(O).toFixed(T.decimals)),t!==O&&L.trigger("change")}function w(){b(),O=parseFloat(I.input.val()),isNaN(O)&&(O=0);var t=O,e=_();O-=e,O=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(jQuery),function(){function t(t,e){if(!t)throw new ReferenceError("this hasn't been initialised - super() hasn't been called");return!e||"object"!=typeof e&&"function"!=typeof e?t:e}function e(t,e){if("function"!=typeof e&&null!==e)throw new TypeError("Super expression must either be null or a function, not "+typeof e);t.prototype=Object.create(e&&e.prototype,{constructor:{value:t,enumerable:!1,writable:!0,configurable:!0}}),e&&(Object.setPrototypeOf?Object.setPrototypeOf(t,e):t.__proto__=e)}function n(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}var i="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t},r=function(){function t(t,e){for(var n=0;nthis._items.length-1||e<0)){if(this._isSliding)return void t(this._element).one(p.SLID,function(){return n.to(e)});if(i===e)return this.pause(),void this.cycle();var r=e>i?d.NEXT:d.PREVIOUS;this._slide(r,this._items[e])}},l.prototype.dispose=function(){t(this._element).off(s),t.removeData(this._element,a),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},l.prototype._getConfig=function(n){return n=t.extend({},c,n),o.typeCheckConfig(e,n,f),n},l.prototype._addEventListeners=function(){this._config.keyboard&&t(this._element).on(p.KEYDOWN,t.proxy(this._keydown,this)),"hover"!==this._config.pause||"ontouchstart"in document.documentElement||t(this._element).on(p.MOUSEENTER,t.proxy(this.pause,this)).on(p.MOUSELEAVE,t.proxy(this.cycle,this))},l.prototype._keydown=function(t){if(t.preventDefault(),!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:this.prev();break;case 39:this.next();break;default:return}},l.prototype._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(m.ITEM)),this._items.indexOf(e)},l.prototype._getItemByDirection=function(t,e){var n=t===d.NEXT,i=t===d.PREVIOUS,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var a=t===d.PREVIOUS?-1:1,s=(r+a)%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},l.prototype._triggerSlideEvent=function(e,n){var i=t.Event(p.SLIDE,{relatedTarget:e,direction:n});return t(this._element).trigger(i),i},l.prototype._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(m.ACTIVE).removeClass(h.ACTIVE);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(h.ACTIVE)}},l.prototype._slide=function(e,n){var i=this,r=t(this._element).find(m.ACTIVE_ITEM)[0],a=n||r&&this._getItemByDirection(e,r),s=Boolean(this._interval),l=e===d.NEXT?h.LEFT:h.RIGHT;if(a&&t(a).hasClass(h.ACTIVE))return void(this._isSliding=!1);if(!this._triggerSlideEvent(a,l).isDefaultPrevented()&&r&&a){this._isSliding=!0,s&&this.pause(),this._setActiveIndicatorElement(a);var u=t.Event(p.SLID,{relatedTarget:a,direction:l});o.supportsTransitionEnd()&&t(this._element).hasClass(h.SLIDE)?(t(a).addClass(e),o.reflow(a),t(r).addClass(l),t(a).addClass(l),t(r).one(o.TRANSITION_END,function(){t(a).removeClass(l).removeClass(e),t(a).addClass(h.ACTIVE),t(r).removeClass(h.ACTIVE).removeClass(e).removeClass(l),i._isSliding=!1,setTimeout(function(){return t(i._element).trigger(u)},0)}).emulateTransitionEnd(600)):(t(r).removeClass(h.ACTIVE),t(a).addClass(h.ACTIVE),this._isSliding=!1,t(this._element).trigger(u)),s&&this.cycle()}},l._jQueryInterface=function(e){return this.each(function(){var n=t(this).data(a),r=t.extend({},c,t(this).data());"object"===(void 0===e?"undefined":i(e))&&t.extend(r,e);var o="string"==typeof e?e:r.slide;if(n||(n=new l(this,r),t(this).data(a,n)),"number"==typeof e)n.to(e);else if("string"==typeof o){if(void 0===n[o])throw new Error('No method named "'+o+'"');n[o]()}else r.interval&&(n.pause(),n.cycle())})},l._dataApiClickHandler=function(e){var n=o.getSelectorFromElement(this);if(n){var i=t(n)[0];if(i&&t(i).hasClass(h.CAROUSEL)){var r=t.extend({},t(i).data(),t(this).data()),s=this.getAttribute("data-slide-to");s&&(r.interval=!1),l._jQueryInterface.call(t(i),r),s&&t(i).data(a).to(s),e.preventDefault()}}},r(l,null,[{key:"VERSION",get:function(){return"4.0.0-alpha.5"}},{key:"Default",get:function(){return c}}]),l}();t(document).on(p.CLICK_DATA_API,m.DATA_SLIDE,g._dataApiClickHandler),t(window).on(p.LOAD_DATA_API,function(){t(m.DATA_RIDE).each(function(){var e=t(this);g._jQueryInterface.call(e,e.data())})}),t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=u,g._jQueryInterface}}(jQuery),function(t){var e="collapse",a="bs.collapse",s="."+a,l=t.fn[e],u={toggle:!0,parent:""},c={toggle:"boolean",parent:"string"},f={SHOW:"show"+s,SHOWN:"shown"+s,HIDE:"hide"+s,HIDDEN:"hidden"+s,CLICK_DATA_API:"click"+s+".data-api"},d={IN:"in",COLLAPSE:"collapse",COLLAPSING:"collapsing",COLLAPSED:"collapsed"},p={WIDTH:"width",HEIGHT:"height"},h={ACTIVES:".card > .in, .card > .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},m=function(){function s(e,i){n(this,s),this._isTransitioning=!1,this._element=e,this._config=this._getConfig(i),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]')),this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}return s.prototype.toggle=function(){t(this._element).hasClass(d.IN)?this.hide():this.show()},s.prototype.show=function(){var e=this;if(!this._isTransitioning&&!t(this._element).hasClass(d.IN)){var n=void 0,i=void 0;if(this._parent&&(n=t.makeArray(t(h.ACTIVES)),n.length||(n=null)),!(n&&(i=t(n).data(a))&&i._isTransitioning)){var r=t.Event(f.SHOW);if(t(this._element).trigger(r),!r.isDefaultPrevented()){n&&(s._jQueryInterface.call(t(n),"hide"),i||t(n).data(a,null));var l=this._getDimension();t(this._element).removeClass(d.COLLAPSE).addClass(d.COLLAPSING),this._element.style[l]=0,this._element.setAttribute("aria-expanded",!0),this._triggerArray.length&&t(this._triggerArray).removeClass(d.COLLAPSED).attr("aria-expanded",!0),this.setTransitioning(!0);var u=function(){t(e._element).removeClass(d.COLLAPSING).addClass(d.COLLAPSE).addClass(d.IN),e._element.style[l]="",e.setTransitioning(!1),t(e._element).trigger(f.SHOWN)};if(!o.supportsTransitionEnd())return void u();var c=l[0].toUpperCase()+l.slice(1),p="scroll"+c;t(this._element).one(o.TRANSITION_END,u).emulateTransitionEnd(600),this._element.style[l]=this._element[p]+"px"}}}},s.prototype.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(d.IN)){var n=t.Event(f.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension(),r=i===p.WIDTH?"offsetWidth":"offsetHeight";this._element.style[i]=this._element[r]+"px",o.reflow(this._element),t(this._element).addClass(d.COLLAPSING).removeClass(d.COLLAPSE).removeClass(d.IN),this._element.setAttribute("aria-expanded",!1),this._triggerArray.length&&t(this._triggerArray).addClass(d.COLLAPSED).attr("aria-expanded",!1),this.setTransitioning(!0);var a=function(){e.setTransitioning(!1),t(e._element).removeClass(d.COLLAPSING).addClass(d.COLLAPSE).trigger(f.HIDDEN)};return this._element.style[i]="",o.supportsTransitionEnd()?void t(this._element).one(o.TRANSITION_END,a).emulateTransitionEnd(600):void a()}}},s.prototype.setTransitioning=function(t){this._isTransitioning=t},s.prototype.dispose=function(){t.removeData(this._element,a),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},s.prototype._getConfig=function(n){return n=t.extend({},u,n),n.toggle=Boolean(n.toggle),o.typeCheckConfig(e,n,c),n},s.prototype._getDimension=function(){return t(this._element).hasClass(p.WIDTH)?p.WIDTH:p.HEIGHT},s.prototype._getParent=function(){var e=this,n=t(this._config.parent)[0],i='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return t(n).find(i).each(function(t,n){e._addAriaAndCollapsedClass(s._getTargetFromElement(n),[n])}),n},s.prototype._addAriaAndCollapsedClass=function(e,n){if(e){var i=t(e).hasClass(d.IN);e.setAttribute("aria-expanded",i),n.length&&t(n).toggleClass(d.COLLAPSED,!i).attr("aria-expanded",i)}},s._getTargetFromElement=function(e){var n=o.getSelectorFromElement(e);return n?t(n)[0]:null},s._jQueryInterface=function(e){return this.each(function(){var n=t(this),r=n.data(a),o=t.extend({},u,n.data(),"object"===(void 0===e?"undefined":i(e))&&e);if(!r&&o.toggle&&/show|hide/.test(e)&&(o.toggle=!1),r||(r=new s(this,o),n.data(a,r)),"string"==typeof e){if(void 0===r[e])throw new Error('No method named "'+e+'"');r[e]()}})},r(s,null,[{key:"VERSION",get:function(){return"4.0.0-alpha.5"}},{key:"Default",get:function(){return u}}]),s}();t(document).on(f.CLICK_DATA_API,h.DATA_TOGGLE,function(e){e.preventDefault();var n=m._getTargetFromElement(this),i=t(n).data(a),r=i?"toggle":t(this).data();m._jQueryInterface.call(t(n),r)}),t.fn[e]=m._jQueryInterface,t.fn[e].Constructor=m,t.fn[e].noConflict=function(){return t.fn[e]=l,m._jQueryInterface}}(jQuery),function(t){var e="dropdown",i="bs.dropdown",a="."+i,s=".data-api",l=t.fn[e],u={HIDE:"hide"+a,HIDDEN:"hidden"+a,SHOW:"show"+a,SHOWN:"shown"+a,CLICK:"click"+a,CLICK_DATA_API:"click"+a+s,KEYDOWN_DATA_API:"keydown"+a+s},c={BACKDROP:"dropdown-backdrop",DISABLED:"disabled",OPEN:"open"},f={BACKDROP:".dropdown-backdrop",DATA_TOGGLE:'[data-toggle="dropdown"]',FORM_CHILD:".dropdown form",ROLE_MENU:'[role="menu"]',ROLE_LISTBOX:'[role="listbox"]',NAVBAR_NAV:".navbar-nav",VISIBLE_ITEMS:'[role="menu"] li:not(.disabled) a, [role="listbox"] li:not(.disabled) a'},d=function(){function e(t){n(this,e),this._element=t,this._addEventListeners()}return e.prototype.toggle=function(){if(this.disabled||t(this).hasClass(c.DISABLED))return!1;var n=e._getParentFromElement(this),i=t(n).hasClass(c.OPEN);if(e._clearMenus(),i)return!1;if("ontouchstart"in document.documentElement&&!t(n).closest(f.NAVBAR_NAV).length){var r=document.createElement("div");r.className=c.BACKDROP,t(r).insertBefore(this),t(r).on("click",e._clearMenus)}var o={relatedTarget:this},a=t.Event(u.SHOW,o);return t(n).trigger(a),!a.isDefaultPrevented()&&(this.focus(),this.setAttribute("aria-expanded","true"),t(n).toggleClass(c.OPEN),t(n).trigger(t.Event(u.SHOWN,o)),!1)},e.prototype.dispose=function(){t.removeData(this._element,i),t(this._element).off(a),this._element=null},e.prototype._addEventListeners=function(){t(this._element).on(u.CLICK,this.toggle)},e._jQueryInterface=function(n){return this.each(function(){var r=t(this).data(i);if(r||t(this).data(i,r=new e(this)),"string"==typeof n){if(void 0===r[n])throw new Error('No method named "'+n+'"');r[n].call(this)}})},e._clearMenus=function(n){if(!n||3!==n.which){var i=t(f.BACKDROP)[0];i&&i.parentNode.removeChild(i);for(var r=t.makeArray(t(f.DATA_TOGGLE)),o=0;o0&&s--,40===n.which&&sdocument.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},l.prototype._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},l.prototype._checkScrollbar=function(){this._isBodyOverflowing=document.body.clientWidth=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}if(this._activeTarget&&t=this._offsets[r]&&(void 0===this._offsets[r+1]||t .nav-item .fade, > .fade",ACTIVE:".active",ACTIVE_CHILD:"> .nav-item > .active, > .active",DATA_TOGGLE:'[data-toggle="tab"], [data-toggle="pill"]',DROPDOWN_TOGGLE:".dropdown-toggle",DROPDOWN_ACTIVE_CHILD:"> .dropdown-menu .active"},f=function(){function e(t){n(this,e),this._element=t}return e.prototype.show=function(){var e=this;if(!this._element.parentNode||this._element.parentNode.nodeType!==Node.ELEMENT_NODE||!t(this._element).hasClass(u.ACTIVE)){var n=void 0,i=void 0,r=t(this._element).closest(c.UL)[0],a=o.getSelectorFromElement(this._element);r&&(i=t.makeArray(t(r).find(c.ACTIVE)),i=i[i.length-1]);var s=t.Event(l.HIDE,{relatedTarget:this._element}),f=t.Event(l.SHOW,{relatedTarget:i});if(i&&t(i).trigger(s),t(this._element).trigger(f),!f.isDefaultPrevented()&&!s.isDefaultPrevented()){a&&(n=t(a)[0]),this._activate(this._element,r);var d=function(){var n=t.Event(l.HIDDEN,{relatedTarget:e._element}),r=t.Event(l.SHOWN,{relatedTarget:i});t(i).trigger(n),t(e._element).trigger(r)};n?this._activate(n,n.parentNode,d):d()}}},e.prototype.dispose=function(){t.removeClass(this._element,i),this._element=null},e.prototype._activate=function(e,n,i){var r=t(n).find(c.ACTIVE_CHILD)[0],a=i&&o.supportsTransitionEnd()&&(r&&t(r).hasClass(u.FADE)||Boolean(t(n).find(c.FADE_CHILD)[0])),s=t.proxy(this._transitionComplete,this,e,r,a,i);r&&a?t(r).one(o.TRANSITION_END,s).emulateTransitionEnd(150):s(),r&&t(r).removeClass(u.IN)},e.prototype._transitionComplete=function(e,n,i,r){if(n){t(n).removeClass(u.ACTIVE);var a=t(n).find(c.DROPDOWN_ACTIVE_CHILD)[0];a&&t(a).removeClass(u.ACTIVE),n.setAttribute("aria-expanded",!1)}if(t(e).addClass(u.ACTIVE),e.setAttribute("aria-expanded",!0),i?(o.reflow(e),t(e).addClass(u.IN)):t(e).removeClass(u.FADE),e.parentNode&&t(e.parentNode).hasClass(u.DROPDOWN_MENU)){var s=t(e).closest(c.DROPDOWN)[0];s&&t(s).find(c.DROPDOWN_TOGGLE).addClass(u.ACTIVE),e.setAttribute("aria-expanded",!0)}r&&r()},e._jQueryInterface=function(n){return this.each(function(){var r=t(this),o=r.data(i);if(o||(o=o=new e(this),r.data(i,o)),"string"==typeof n){if(void 0===o[n])throw new Error('No method named "'+n+'"');o[n]()}})},r(e,null,[{key:"VERSION",get:function(){return"4.0.0-alpha.5"}}]),e}();t(document).on(l.CLICK_DATA_API,c.DATA_TOGGLE,function(e){e.preventDefault(),f._jQueryInterface.call(t(this),"show")}),t.fn[e]=f._jQueryInterface,t.fn[e].Constructor=f,t.fn[e].noConflict=function(){return t.fn[e]=s,f._jQueryInterface}}(jQuery),function(t){if(void 0===window.Tether)throw new Error("Bootstrap tooltips require Tether (http://tether.io/)");var e="tooltip",a="bs.tooltip",s="."+a,l=t.fn[e],u={animation:!0,template:'',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:"0 0",constraints:[]},c={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"string",constraints:"array"},f={TOP:"bottom center",RIGHT:"middle left",BOTTOM:"top center",LEFT:"middle right"},d={IN:"in",OUT:"out"},p={HIDE:"hide"+s,HIDDEN:"hidden"+s,SHOW:"show"+s,SHOWN:"shown"+s,INSERTED:"inserted"+s,CLICK:"click"+s,FOCUSIN:"focusin"+s,FOCUSOUT:"focusout"+s,MOUSEENTER:"mouseenter"+s,MOUSELEAVE:"mouseleave"+s},h={FADE:"fade",IN:"in"},m={TOOLTIP:".tooltip",TOOLTIP_INNER:".tooltip-inner"},g={element:!1,enabled:!1},v={HOVER:"hover",FOCUS:"focus",CLICK:"click",MANUAL:"manual"},y=function(){function l(t,e){n(this,l),this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._tether=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}return l.prototype.enable=function(){this._isEnabled=!0},l.prototype.disable=function(){this._isEnabled=!1},l.prototype.toggleEnabled=function(){this._isEnabled=!this._isEnabled},l.prototype.toggle=function(e){if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i||(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(h.IN))return void this._leave(null,this);this._enter(null,this)}},l.prototype.dispose=function(){clearTimeout(this._timeout),this.cleanupTether(),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,this._tether=null,this.element=null,this.config=null,this.tip=null},l.prototype.show=function(){var e=this,n=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(n);var i=t.contains(this.element.ownerDocument.documentElement,this.element);if(n.isDefaultPrevented()||!i)return;var r=this.getTipElement(),a=o.getUID(this.constructor.NAME);r.setAttribute("id",a),this.element.setAttribute("aria-describedby",a),this.setContent(),this.config.animation&&t(r).addClass(h.FADE);var s="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,u=this._getAttachment(s);t(r).data(this.constructor.DATA_KEY,this).appendTo(document.body),t(this.element).trigger(this.constructor.Event.INSERTED),this._tether=new Tether({attachment:u,element:r,target:this.element,classes:g,classPrefix:"bs-tether",offset:this.config.offset,constraints:this.config.constraints,addTargetClasses:!1}),o.reflow(r),this._tether.position(),t(r).addClass(h.IN);var c=function(){var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===d.OUT&&e._leave(null,e)};if(o.supportsTransitionEnd()&&t(this.tip).hasClass(h.FADE))return void t(this.tip).one(o.TRANSITION_END,c).emulateTransitionEnd(l._TRANSITION_DURATION);c()}},l.prototype.hide=function(e){var n=this,i=this.getTipElement(),r=t.Event(this.constructor.Event.HIDE),a=function(){n._hoverState!==d.IN&&i.parentNode&&i.parentNode.removeChild(i),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),n.cleanupTether(),e&&e()};t(this.element).trigger(r),r.isDefaultPrevented()||(t(i).removeClass(h.IN),o.supportsTransitionEnd()&&t(this.tip).hasClass(h.FADE)?t(i).one(o.TRANSITION_END,a).emulateTransitionEnd(150):a(),this._hoverState="")},l.prototype.isWithContent=function(){return Boolean(this.getTitle())},l.prototype.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0]},l.prototype.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m.TOOLTIP_INNER),this.getTitle()),e.removeClass(h.FADE).removeClass(h.IN),this.cleanupTether()},l.prototype.setElementContent=function(e,n){var r=this.config.html;"object"===(void 0===n?"undefined":i(n))&&(n.nodeType||n.jquery)?r?t(n).parent().is(e)||e.empty().append(n):e.text(t(n).text()):e[r?"html":"text"](n)},l.prototype.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},l.prototype.cleanupTether=function(){this._tether&&this._tether.destroy()},l.prototype._getAttachment=function(t){return f[t.toUpperCase()]},l.prototype._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,t.proxy(e.toggle,e));else if(n!==v.MANUAL){var i=n===v.HOVER?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,r=n===v.HOVER?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,t.proxy(e._enter,e)).on(r,e.config.selector,t.proxy(e._leave,e))}}),this.config.selector?this.config=t.extend({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},l.prototype._fixTitle=function(){var t=i(this.element.getAttribute("data-original-title"));(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},l.prototype._enter=function(e,n){var i=this.constructor.DATA_KEY;return n=n||t(e.currentTarget).data(i),n||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?v.FOCUS:v.HOVER]=!0),t(n.getTipElement()).hasClass(h.IN)||n._hoverState===d.IN?void(n._hoverState=d.IN):(clearTimeout(n._timeout),n._hoverState=d.IN,n.config.delay&&n.config.delay.show?void(n._timeout=setTimeout(function(){n._hoverState===d.IN&&n.show()},n.config.delay.show)):void n.show())},l.prototype._leave=function(e,n){var i=this.constructor.DATA_KEY;if(n=n||t(e.currentTarget).data(i),n||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?v.FOCUS:v.HOVER]=!1),!n._isWithActiveTrigger())return clearTimeout(n._timeout),n._hoverState=d.OUT,n.config.delay&&n.config.delay.hide?void(n._timeout=setTimeout(function(){n._hoverState===d.OUT&&n.hide()},n.config.delay.hide)):void n.hide()},l.prototype._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},l.prototype._getConfig=function(n){return n=t.extend({},this.constructor.Default,t(this.element).data(),n),n.delay&&"number"==typeof n.delay&&(n.delay={show:n.delay,hide:n.delay}),o.typeCheckConfig(e,n,this.constructor.DefaultType),n},l.prototype._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},l._jQueryInterface=function(e){return this.each(function(){var n=t(this).data(a),r="object"===(void 0===e?"undefined":i(e))?e:null;if((n||!/dispose|hide/.test(e))&&(n||(n=new l(this,r),t(this).data(a,n)),"string"==typeof e)){if(void 0===n[e])throw new Error('No method named "'+e+'"');n[e]()}})},r(l,null,[{key:"VERSION",get:function(){return"4.0.0-alpha.5"}},{key:"Default",get:function(){return u}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return a}},{key:"Event",get:function(){return p}},{key:"EVENT_KEY",get:function(){return s}},{key:"DefaultType",get:function(){return c}}]),l}();return t.fn[e]=y._jQueryInterface,t.fn[e].Constructor=y,t.fn[e].noConflict=function(){return t.fn[e]=l,y._jQueryInterface},y}(jQuery));!function(o){var s="popover",l="bs.popover",u="."+l,c=o.fn[s],f=o.extend({},a.Default,{placement:"right",trigger:"click",content:"",template:''}),d=o.extend({},a.DefaultType,{content:"(string|element|function)"}),p={FADE:"fade",IN:"in"},h={TITLE:".popover-title",CONTENT:".popover-content"},m={HIDE:"hide"+u,HIDDEN:"hidden"+u,SHOW:"show"+u,SHOWN:"shown"+u,INSERTED:"inserted"+u,CLICK:"click"+u,FOCUSIN:"focusin"+u,FOCUSOUT:"focusout"+u,MOUSEENTER:"mouseenter"+u,MOUSELEAVE:"mouseleave"+u},g=function(a){function c(){return n(this,c),t(this,a.apply(this,arguments))}return e(c,a),c.prototype.isWithContent=function(){return this.getTitle()||this._getContent()},c.prototype.getTipElement=function(){return this.tip=this.tip||o(this.config.template)[0]},c.prototype.setContent=function(){var t=o(this.getTipElement());this.setElementContent(t.find(h.TITLE),this.getTitle()),this.setElementContent(t.find(h.CONTENT),this._getContent()),t.removeClass(p.FADE).removeClass(p.IN),this.cleanupTether()},c.prototype._getContent=function(){return this.element.getAttribute("data-content")||("function"==typeof this.config.content?this.config.content.call(this.element):this.config.content)},c._jQueryInterface=function(t){return this.each(function(){var e=o(this).data(l),n="object"===(void 0===t?"undefined":i(t))?t:null;if((e||!/destroy|hide/.test(t))&&(e||(e=new c(this,n),o(this).data(l,e)),"string"==typeof t)){if(void 0===e[t])throw new Error('No method named "'+t+'"');e[t]()}})},r(c,null,[{key:"VERSION",get:function(){return"4.0.0-alpha.5"}},{key:"Default",get:function(){return f}},{key:"NAME",get:function(){return s}},{key:"DATA_KEY",get:function(){return l}},{key:"Event",get:function(){return m}},{key:"EVENT_KEY",get:function(){return u}},{key:"DefaultType",get:function(){return d}}]),c}(a);o.fn[s]=g._jQueryInterface,o.fn[s].Constructor=g,o.fn[s].noConflict=function(){return o.fn[s]=c,g._jQueryInterface}}(jQuery)}()},function(t,e,n){"use strict";function i(){this._events=this._events||{},this._maxListeners=this._maxListeners||void 0}function r(t){return"function"==typeof t}function o(t){return"number"==typeof t}function a(t){return"object"==typeof t&&null!==t}function s(t){return void 0===t}t.exports=i,i.EventEmitter=i,i.prototype._events=void 0,i.prototype._maxListeners=void 0,i.defaultMaxListeners=10,i.prototype.setMaxListeners=function(t){if(!o(t)||t<0||isNaN(t))throw TypeError("n must be a positive number");return this._maxListeners=t,this},i.prototype.emit=function(t){var e,n,i,o,l,u;if(this._events||(this._events={}),"error"===t&&(!this._events.error||a(this._events.error)&&!this._events.error.length)){if((e=arguments[1])instanceof Error)throw e;var c=new Error('Uncaught, unspecified "error" event. ('+e+")");throw c.context=e,c}if(n=this._events[t],s(n))return!1;if(r(n))switch(arguments.length){case 1:n.call(this);break;case 2:n.call(this,arguments[1]);break;case 3:n.call(this,arguments[1],arguments[2]);break;default:o=Array.prototype.slice.call(arguments,1),n.apply(this,o)}else if(a(n))for(o=Array.prototype.slice.call(arguments,1),u=n.slice(),i=u.length,l=0;l0&&this._events[t].length>n&&(this._events[t].warned=!0,console.trace),this},i.prototype.on=i.prototype.addListener,i.prototype.once=function(t,e){function n(){this.removeListener(t,n),i||(i=!0,e.apply(this,arguments))}if(!r(e))throw TypeError("listener must be a function");var i=!1;return n.listener=e,this.on(t,n),this},i.prototype.removeListener=function(t,e){var n,i,o,s;if(!r(e))throw TypeError("listener must be a function");if(!this._events||!this._events[t])return this;if(n=this._events[t],o=n.length,i=-1,n===e||r(n.listener)&&n.listener===e)delete this._events[t],this._events.removeListener&&this.emit("removeListener",t,e);else if(a(n)){for(s=o;s-- >0;)if(n[s]===e||n[s].listener&&n[s].listener===e){i=s;break}if(i<0)return this;1===n.length?(n.length=0,delete this._events[t]):n.splice(i,1),this._events.removeListener&&this.emit("removeListener",t,e)}return this},i.prototype.removeAllListeners=function(t){var e,n;if(!this._events)return this;if(!this._events.removeListener)return 0===arguments.length?this._events={}:this._events[t]&&delete this._events[t],this;if(0===arguments.length){for(e in this._events)"removeListener"!==e&&this.removeAllListeners(e);return this.removeAllListeners("removeListener"),this._events={},this}if(n=this._events[t],r(n))this.removeListener(t,n);else if(n)for(;n.length;)this.removeListener(t,n[n.length-1]);return delete this._events[t],this},i.prototype.listeners=function(t){return this._events&&this._events[t]?r(this._events[t])?[this._events[t]]:this._events[t].slice():[]},i.prototype.listenerCount=function(t){if(this._events){var e=this._events[t];if(r(e))return 1;if(e)return e.length}return 0},i.listenerCount=function(t,e){return t.listenerCount(e)}},function(t,e,n){"use strict";var i,i;!function(e){t.exports=e()}(function(){return function t(e,n,r){function o(s,l){if(!n[s]){if(!e[s]){var u="function"==typeof i&&i;if(!l&&u)return i(s,!0);if(a)return a(s,!0);var c=new Error("Cannot find module '"+s+"'");throw c.code="MODULE_NOT_FOUND",c}var f=n[s]={exports:{}};e[s][0].call(f.exports,function(t){var n=e[s][1][t];return o(n||t)},f,f.exports,t,e,n,r)}return n[s].exports}for(var a="function"==typeof i&&i,s=0;s1&&"flex-start"===t.style.alignContent)for(e=0;i=t.lines[++r];)i.crossStart=e,e+=i.cross;else if(t.lines.length>1&&"flex-end"===t.style.alignContent)for(e=t.flexStyle.crossSpace;i=t.lines[++r];)i.crossStart=e,e+=i.cross;else if(t.lines.length>1&&"center"===t.style.alignContent)for(e=t.flexStyle.crossSpace/2;i=t.lines[++r];)i.crossStart=e,e+=i.cross;else if(t.lines.length>1&&"space-between"===t.style.alignContent)for(n=t.flexStyle.crossSpace/(t.lines.length-1),e=0;i=t.lines[++r];)i.crossStart=e,e+=i.cross+n;else if(t.lines.length>1&&"space-around"===t.style.alignContent)for(n=2*t.flexStyle.crossSpace/(2*t.lines.length),e=n/2;i=t.lines[++r];)i.crossStart=e,e+=i.cross+n;else for(n=t.flexStyle.crossSpace/t.lines.length,e=t.flexStyle.crossInnerBefore;i=t.lines[++r];)i.crossStart=e,i.cross+=n,e+=i.cross}},{}],2:[function(t,e,n){e.exports=function(t){for(var e,n=-1;line=t.lines[++n];)for(e=-1;child=line.children[++e];){var i=child.style.alignSelf;"auto"===i&&(i=t.style.alignItems),"flex-start"===i?child.flexStyle.crossStart=line.crossStart:"flex-end"===i?child.flexStyle.crossStart=line.crossStart+line.cross-child.flexStyle.crossOuter:"center"===i?child.flexStyle.crossStart=line.crossStart+(line.cross-child.flexStyle.crossOuter)/2:(child.flexStyle.crossStart=line.crossStart,child.flexStyle.crossOuter=line.cross,child.flexStyle.cross=child.flexStyle.crossOuter-child.flexStyle.crossBefore-child.flexStyle.crossAfter)}}},{}],3:[function(t,e,n){e.exports=function(t,e){var n="row"===e||"row-reverse"===e,i=t.mainAxis;if(i){n&&"inline"===i||!n&&"block"===i||(t.flexStyle={main:t.flexStyle.cross,cross:t.flexStyle.main,mainOffset:t.flexStyle.crossOffset,crossOffset:t.flexStyle.mainOffset,mainBefore:t.flexStyle.crossBefore,mainAfter:t.flexStyle.crossAfter,crossBefore:t.flexStyle.mainBefore,crossAfter:t.flexStyle.mainAfter,mainInnerBefore:t.flexStyle.crossInnerBefore,mainInnerAfter:t.flexStyle.crossInnerAfter,crossInnerBefore:t.flexStyle.mainInnerBefore,crossInnerAfter:t.flexStyle.mainInnerAfter,mainBorderBefore:t.flexStyle.crossBorderBefore,mainBorderAfter:t.flexStyle.crossBorderAfter,crossBorderBefore:t.flexStyle.mainBorderBefore,crossBorderAfter:t.flexStyle.mainBorderAfter})}else t.flexStyle=n?{main:t.style.width,cross:t.style.height,mainOffset:t.style.offsetWidth,crossOffset:t.style.offsetHeight,mainBefore:t.style.marginLeft,mainAfter:t.style.marginRight,crossBefore:t.style.marginTop,crossAfter:t.style.marginBottom,mainInnerBefore:t.style.paddingLeft,mainInnerAfter:t.style.paddingRight,crossInnerBefore:t.style.paddingTop,crossInnerAfter:t.style.paddingBottom,mainBorderBefore:t.style.borderLeftWidth,mainBorderAfter:t.style.borderRightWidth,crossBorderBefore:t.style.borderTopWidth,crossBorderAfter:t.style.borderBottomWidth}:{main:t.style.height,cross:t.style.width,mainOffset:t.style.offsetHeight,crossOffset:t.style.offsetWidth,mainBefore:t.style.marginTop,mainAfter:t.style.marginBottom,crossBefore:t.style.marginLeft,crossAfter:t.style.marginRight,mainInnerBefore:t.style.paddingTop,mainInnerAfter:t.style.paddingBottom,crossInnerBefore:t.style.paddingLeft,crossInnerAfter:t.style.paddingRight,mainBorderBefore:t.style.borderTopWidth,mainBorderAfter:t.style.borderBottomWidth,crossBorderBefore:t.style.borderLeftWidth,crossBorderAfter:t.style.borderRightWidth},"content-box"===t.style.boxSizing&&("number"==typeof t.flexStyle.main&&(t.flexStyle.main+=t.flexStyle.mainInnerBefore+t.flexStyle.mainInnerAfter+t.flexStyle.mainBorderBefore+t.flexStyle.mainBorderAfter),"number"==typeof t.flexStyle.cross&&(t.flexStyle.cross+=t.flexStyle.crossInnerBefore+t.flexStyle.crossInnerAfter+t.flexStyle.crossBorderBefore+t.flexStyle.crossBorderAfter));t.mainAxis=n?"inline":"block",t.crossAxis=n?"block":"inline","number"==typeof t.style.flexBasis&&(t.flexStyle.main=t.style.flexBasis+t.flexStyle.mainInnerBefore+t.flexStyle.mainInnerAfter+t.flexStyle.mainBorderBefore+t.flexStyle.mainBorderAfter),t.flexStyle.mainOuter=t.flexStyle.main,t.flexStyle.crossOuter=t.flexStyle.cross,"auto"===t.flexStyle.mainOuter&&(t.flexStyle.mainOuter=t.flexStyle.mainOffset),"auto"===t.flexStyle.crossOuter&&(t.flexStyle.crossOuter=t.flexStyle.crossOffset),"number"==typeof t.flexStyle.mainBefore&&(t.flexStyle.mainOuter+=t.flexStyle.mainBefore),"number"==typeof t.flexStyle.mainAfter&&(t.flexStyle.mainOuter+=t.flexStyle.mainAfter),"number"==typeof t.flexStyle.crossBefore&&(t.flexStyle.crossOuter+=t.flexStyle.crossBefore),"number"==typeof t.flexStyle.crossAfter&&(t.flexStyle.crossOuter+=t.flexStyle.crossAfter)}},{}],4:[function(t,e,n){var i=t("../reduce");e.exports=function(t){if(t.mainSpace>0){var e=i(t.children,function(t,e){return t+parseFloat(e.style.flexGrow)},0);e>0&&(t.main=i(t.children,function(n,i){return"auto"===i.flexStyle.main?i.flexStyle.main=i.flexStyle.mainOffset+parseFloat(i.style.flexGrow)/e*t.mainSpace:i.flexStyle.main+=parseFloat(i.style.flexGrow)/e*t.mainSpace,i.flexStyle.mainOuter=i.flexStyle.main+i.flexStyle.mainBefore+i.flexStyle.mainAfter,n+i.flexStyle.mainOuter},0),t.mainSpace=0)}}},{"../reduce":12}],5:[function(t,e,n){var i=t("../reduce");e.exports=function(t){if(t.mainSpace<0){var e=i(t.children,function(t,e){return t+parseFloat(e.style.flexShrink)},0);e>0&&(t.main=i(t.children,function(n,i){return i.flexStyle.main+=parseFloat(i.style.flexShrink)/e*t.mainSpace,i.flexStyle.mainOuter=i.flexStyle.main+i.flexStyle.mainBefore+i.flexStyle.mainAfter,n+i.flexStyle.mainOuter},0),t.mainSpace=0)}}},{"../reduce":12}],6:[function(t,e,n){var i=t("../reduce");e.exports=function(t){var e;t.lines=[e={main:0,cross:0,children:[]}];for(var n,r=-1;n=t.children[++r];)"nowrap"===t.style.flexWrap||0===e.children.length||"auto"===t.flexStyle.main||t.flexStyle.main-t.flexStyle.mainInnerBefore-t.flexStyle.mainInnerAfter-t.flexStyle.mainBorderBefore-t.flexStyle.mainBorderAfter>=e.main+n.flexStyle.mainOuter?(e.main+=n.flexStyle.mainOuter,e.cross=Math.max(e.cross,n.flexStyle.crossOuter)):t.lines.push(e={main:n.flexStyle.mainOuter,cross:n.flexStyle.crossOuter,children:[]}),e.children.push(n);t.flexStyle.mainLines=i(t.lines,function(t,e){return Math.max(t,e.main)},0),t.flexStyle.crossLines=i(t.lines,function(t,e){return t+e.cross},0),"auto"===t.flexStyle.main&&(t.flexStyle.main=Math.max(t.flexStyle.mainOffset,t.flexStyle.mainLines+t.flexStyle.mainInnerBefore+t.flexStyle.mainInnerAfter+t.flexStyle.mainBorderBefore+t.flexStyle.mainBorderAfter)),"auto"===t.flexStyle.cross&&(t.flexStyle.cross=Math.max(t.flexStyle.crossOffset,t.flexStyle.crossLines+t.flexStyle.crossInnerBefore+t.flexStyle.crossInnerAfter+t.flexStyle.crossBorderBefore+t.flexStyle.crossBorderAfter)),t.flexStyle.crossSpace=t.flexStyle.cross-t.flexStyle.crossInnerBefore-t.flexStyle.crossInnerAfter-t.flexStyle.crossBorderBefore-t.flexStyle.crossBorderAfter-t.flexStyle.crossLines,t.flexStyle.mainOuter=t.flexStyle.main+t.flexStyle.mainBefore+t.flexStyle.mainAfter,t.flexStyle.crossOuter=t.flexStyle.cross+t.flexStyle.crossBefore+t.flexStyle.crossAfter}},{"../reduce":12}],7:[function(t,e,n){function i(e){for(var n,i=-1;n=e.children[++i];)t("./flex-direction")(n,e.style.flexDirection);t("./flex-direction")(e,e.style.flexDirection),t("./order")(e),t("./flexbox-lines")(e),t("./align-content")(e),i=-1;for(var r;r=e.lines[++i];)r.mainSpace=e.flexStyle.main-e.flexStyle.mainInnerBefore-e.flexStyle.mainInnerAfter-e.flexStyle.mainBorderBefore-e.flexStyle.mainBorderAfter-r.main,t("./flex-grow")(r),t("./flex-shrink")(r),t("./margin-main")(r),t("./margin-cross")(r),t("./justify-content")(r,e.style.justifyContent,e);t("./align-items")(e)}e.exports=i},{"./align-content":1,"./align-items":2,"./flex-direction":3,"./flex-grow":4,"./flex-shrink":5,"./flexbox-lines":6,"./justify-content":8,"./margin-cross":9,"./margin-main":10,"./order":11}],8:[function(t,e,n){e.exports=function(t,e,n){var i,r,o,a=n.flexStyle.mainInnerBefore,s=-1;if("flex-end"===e)for(i=t.mainSpace,i+=a;o=t.children[++s];)o.flexStyle.mainStart=i,i+=o.flexStyle.mainOuter;else if("center"===e)for(i=t.mainSpace/2,i+=a;o=t.children[++s];)o.flexStyle.mainStart=i,i+=o.flexStyle.mainOuter;else if("space-between"===e)for(r=t.mainSpace/(t.children.length-1),i=0,i+=a;o=t.children[++s];)o.flexStyle.mainStart=i,i+=o.flexStyle.mainOuter+r;else if("space-around"===e)for(r=2*t.mainSpace/(2*t.children.length),i=r/2,i+=a;o=t.children[++s];)o.flexStyle.mainStart=i,i+=o.flexStyle.mainOuter+r;else for(i=0,i+=a;o=t.children[++s];)o.flexStyle.mainStart=i,i+=o.flexStyle.mainOuter}},{}],9:[function(t,e,n){e.exports=function(t){for(var e,n=-1;e=t.children[++n];){var i=0;"auto"===e.flexStyle.crossBefore&&++i,"auto"===e.flexStyle.crossAfter&&++i;var r=t.cross-e.flexStyle.crossOuter;"auto"===e.flexStyle.crossBefore&&(e.flexStyle.crossBefore=r/i),"auto"===e.flexStyle.crossAfter&&(e.flexStyle.crossAfter=r/i),"auto"===e.flexStyle.cross?e.flexStyle.crossOuter=e.flexStyle.crossOffset+e.flexStyle.crossBefore+e.flexStyle.crossAfter:e.flexStyle.crossOuter=e.flexStyle.cross+e.flexStyle.crossBefore+e.flexStyle.crossAfter}}},{}],10:[function(t,e,n){e.exports=function(t){for(var e,n=0,i=-1;e=t.children[++i];)"auto"===e.flexStyle.mainBefore&&++n,"auto"===e.flexStyle.mainAfter&&++n;if(n>0){for(i=-1;e=t.children[++i];)"auto"===e.flexStyle.mainBefore&&(e.flexStyle.mainBefore=t.mainSpace/n),"auto"===e.flexStyle.mainAfter&&(e.flexStyle.mainAfter=t.mainSpace/n),"auto"===e.flexStyle.main?e.flexStyle.mainOuter=e.flexStyle.mainOffset+e.flexStyle.mainBefore+e.flexStyle.mainAfter:e.flexStyle.mainOuter=e.flexStyle.main+e.flexStyle.mainBefore+e.flexStyle.mainAfter;t.mainSpace=0}}},{}],11:[function(t,e,n){var i=/^(column|row)-reverse$/;e.exports=function(t){t.children.sort(function(t,e){return t.style.order-e.style.order||t.index-e.index}),i.test(t.style.flexDirection)&&t.children.reverse()}},{}],12:[function(t,e,n){function i(t,e,n){for(var i=t.length,r=-1;++r=0)&&i.push(r)}return i.push(t.ownerDocument.body),t.ownerDocument!==document&&i.push(t.ownerDocument.defaultView),i}function a(){C&&document.body.removeChild(C),C=null}function s(t){var e=void 0;t===document?(e=document,t=document.documentElement):e=t.ownerDocument;var n=e.documentElement,i=r(t),o=I();return i.top-=o.top,i.left-=o.left,void 0===i.width&&(i.width=document.body.scrollWidth-i.left-i.right),void 0===i.height&&(i.height=document.body.scrollHeight-i.top-i.bottom),i.top=i.top-n.clientTop,i.left=i.left-n.clientLeft,i.right=e.body.clientWidth-i.width-i.left,i.bottom=e.body.clientHeight-i.height-i.top,i}function l(t){return t.offsetParent||document.documentElement}function u(){if(O)return O;var t=document.createElement("div");t.style.width="100%",t.style.height="200px";var e=document.createElement("div");c(e.style,{position:"absolute",top:0,left:0,pointerEvents:"none",visibility:"hidden",width:"200px",height:"150px",overflow:"hidden"}),e.appendChild(t),document.body.appendChild(e);var n=t.offsetWidth;e.style.overflow="scroll";var i=t.offsetWidth;n===i&&(i=e.clientWidth),document.body.removeChild(e);var r=n-i;return O={width:r,height:r}}function c(){var t=arguments.length<=0||void 0===arguments[0]?{}:arguments[0],e=[];return Array.prototype.push.apply(e,arguments),e.slice(1).forEach(function(e){if(e)for(var n in e)({}).hasOwnProperty.call(e,n)&&(t[n]=e[n])}),t}function f(t,e){if(void 0!==t.classList)e.split(" ").forEach(function(e){e.trim()&&t.classList.remove(e)});else{var n=new RegExp("(^| )"+e.split(" ").join("|")+"( |$)","gi"),i=h(t).replace(n," ");m(t,i)}}function d(t,e){if(void 0!==t.classList)e.split(" ").forEach(function(e){e.trim()&&t.classList.add(e)});else{f(t,e);var n=h(t)+" "+e;m(t,n)}}function p(t,e){if(void 0!==t.classList)return t.classList.contains(e);var n=h(t);return new RegExp("(^| )"+e+"( |$)","gi").test(n)}function h(t){return t.className instanceof t.ownerDocument.defaultView.SVGAnimatedString?t.className.baseVal:t.className}function m(t,e){t.setAttribute("class",e)}function g(t,e,n){n.forEach(function(n){-1===e.indexOf(n)&&p(t,n)&&f(t,n)}),e.forEach(function(e){p(t,e)||d(t,e)})}function i(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}function v(t,e){if("function"!=typeof e&&null!==e)throw new TypeError("Super expression must either be null or a function, not "+typeof e);t.prototype=Object.create(e&&e.prototype,{constructor:{value:t,enumerable:!1,writable:!0,configurable:!0}}),e&&(Object.setPrototypeOf?Object.setPrototypeOf(t,e):t.__proto__=e)}function y(t,e){var n=arguments.length<=2||void 0===arguments[2]?1:arguments[2];return t+n>=e&&e>=t-n}function b(){return"undefined"!=typeof performance&&void 0!==performance.now?performance.now():+new Date}function _(){for(var t={top:0,left:0},e=arguments.length,n=Array(e),i=0;i1?n-1:0),r=1;r16)return e=Math.min(e-16,250),void(n=setTimeout(i,250));void 0!==t&&b()-t<10||(null!=n&&(clearTimeout(n),n=null),t=b(),R(),e=b()-t)};"undefined"!=typeof window&&void 0!==window.addEventListener&&["resize","scroll","touchmove"].forEach(function(t){window.addEventListener(t,i)})}();var M={center:"center",left:"right",right:"left"},H={middle:"middle",top:"bottom",bottom:"top"},W={top:0,left:0,middle:"50%",center:"50%",bottom:"100%",right:"100%"},U=function(t,e){var n=t.left,i=t.top;return"auto"===n&&(n=M[e.left]),"auto"===i&&(i=H[e.top]),{left:n,top:i}},q=function(t){var e=t.left,n=t.top;return void 0!==W[t.left]&&(e=W[t.left]),void 0!==W[t.top]&&(n=W[t.top]),{left:e,top:n}},z=function(t){var e=t.split(" "),n=L(e,2);return{top:n[0],left:n[1]}},$=z,Q=function(t){function e(t){var n=this;i(this,e),j(Object.getPrototypeOf(e.prototype),"constructor",this).call(this),this.position=this.position.bind(this),F.push(this),this.history=[],this.setOptions(t,!1),E.modules.forEach(function(t){void 0!==t.initialize&&t.initialize.call(n)}),this.position()}return v(e,t),S(e,[{key:"getClass",value:function(){var t=arguments.length<=0||void 0===arguments[0]?"":arguments[0],e=this.options.classes;return void 0!==e&&e[t]?this.options.classes[t]:this.options.classPrefix?this.options.classPrefix+"-"+t:t}},{key:"setOptions",value:function(t){var e=this,n=arguments.length<=1||void 0===arguments[1]||arguments[1],i={offset:"0 0",targetOffset:"0 0",targetAttachment:"auto auto",classPrefix:"tether"};this.options=c(i,t);var r=this.options,a=r.element,s=r.target,l=r.targetModifier;if(this.element=a,this.target=s,this.targetModifier=l,"viewport"===this.target?(this.target=document.body,this.targetModifier="visible"):"scroll-handle"===this.target&&(this.target=document.body,this.targetModifier="scroll-handle"),["element","target"].forEach(function(t){if(void 0===e[t])throw new Error("Tether Error: Both element and target must be defined");void 0!==e[t].jquery?e[t]=e[t][0]:"string"==typeof e[t]&&(e[t]=document.querySelector(e[t]))}),d(this.element,this.getClass("element")),!1!==this.options.addTargetClasses&&d(this.target,this.getClass("target")),!this.options.attachment)throw new Error("Tether Error: You must provide an attachment");this.targetAttachment=$(this.options.targetAttachment),this.attachment=$(this.options.attachment),this.offset=z(this.options.offset),this.targetOffset=z(this.options.targetOffset),void 0!==this.scrollParents&&this.disable(),"scroll-handle"===this.targetModifier?this.scrollParents=[this.target]:this.scrollParents=o(this.target),!1!==this.options.enabled&&this.enable(n)}},{key:"getTargetBounds",value:function(){if(void 0===this.targetModifier)return s(this.target);if("visible"===this.targetModifier){if(this.target===document.body)return{top:pageYOffset,left:pageXOffset,height:innerHeight,width:innerWidth};var t=s(this.target),e={height:t.height,width:t.width,top:t.top,left:t.left};return e.height=Math.min(e.height,t.height-(pageYOffset-t.top)),e.height=Math.min(e.height,t.height-(t.top+t.height-(pageYOffset+innerHeight))),e.height=Math.min(innerHeight,e.height),e.height-=2,e.width=Math.min(e.width,t.width-(pageXOffset-t.left)),e.width=Math.min(e.width,t.width-(t.left+t.width-(pageXOffset+innerWidth))),e.width=Math.min(innerWidth,e.width),e.width-=2,e.topn.clientWidth||[i.overflow,i.overflowX].indexOf("scroll")>=0||this.target!==document.body,o=0;r&&(o=15);var a=t.height-parseFloat(i.borderTopWidth)-parseFloat(i.borderBottomWidth)-o,e={width:15,height:.975*a*(a/n.scrollHeight),left:t.left+t.width-parseFloat(i.borderLeftWidth)-15},l=0;a<408&&this.target===document.body&&(l=-11e-5*Math.pow(a,2)-.00727*a+22.58),this.target!==document.body&&(e.height=Math.max(e.height,24));var u=this.target.scrollTop/(n.scrollHeight-a);return e.top=u*(a-e.height-l)+t.top+parseFloat(i.borderTopWidth),this.target===document.body&&(e.height=Math.max(e.height,24)),e}}},{key:"clearCache",value:function(){this._cache={}}},{key:"cache",value:function(t,e){return void 0===this._cache&&(this._cache={}),void 0===this._cache[t]&&(this._cache[t]=e.call(this)),this._cache[t]}},{key:"enable",value:function(){var t=this,e=arguments.length<=0||void 0===arguments[0]||arguments[0];!1!==this.options.addTargetClasses&&d(this.target,this.getClass("enabled")),d(this.element,this.getClass("enabled")),this.enabled=!0,this.scrollParents.forEach(function(e){e!==t.target.ownerDocument&&e.addEventListener("scroll",t.position)}),e&&this.position()}},{key:"disable",value:function(){var t=this;f(this.target,this.getClass("enabled")),f(this.element,this.getClass("enabled")),this.enabled=!1,void 0!==this.scrollParents&&this.scrollParents.forEach(function(e){e.removeEventListener("scroll",t.position)})}},{key:"destroy",value:function(){var t=this;this.disable(),F.forEach(function(e,n){e===t&&F.splice(n,1)}),0===F.length&&a()}},{key:"updateAttachClasses",value:function(t,e){var n=this;t=t||this.attachment,e=e||this.targetAttachment;var i=["left","top","bottom","right","middle","center"];void 0!==this._addAttachClasses&&this._addAttachClasses.length&&this._addAttachClasses.splice(0,this._addAttachClasses.length),void 0===this._addAttachClasses&&(this._addAttachClasses=[]);var r=this._addAttachClasses;t.top&&r.push(this.getClass("element-attached")+"-"+t.top),t.left&&r.push(this.getClass("element-attached")+"-"+t.left),e.top&&r.push(this.getClass("target-attached")+"-"+e.top),e.left&&r.push(this.getClass("target-attached")+"-"+e.left);var o=[];i.forEach(function(t){o.push(n.getClass("element-attached")+"-"+t),o.push(n.getClass("target-attached")+"-"+t)}),D(function(){void 0!==n._addAttachClasses&&(g(n.element,n._addAttachClasses,o),!1!==n.options.addTargetClasses&&g(n.target,n._addAttachClasses,o),delete n._addAttachClasses)})}},{key:"position",value:function(){var t=this,e=arguments.length<=0||void 0===arguments[0]||arguments[0];if(this.enabled){this.clearCache();var n=U(this.targetAttachment,this.attachment);this.updateAttachClasses(this.attachment,n);var i=this.cache("element-bounds",function(){return s(t.element)}),r=i.width,o=i.height;if(0===r&&0===o&&void 0!==this.lastSize){var a=this.lastSize;r=a.width,o=a.height}else this.lastSize={width:r,height:o};var c=this.cache("target-bounds",function(){return t.getTargetBounds()}),f=c,d=x(q(this.attachment),{width:r,height:o}),p=x(q(n),f),h=x(this.offset,{width:r,height:o}),m=x(this.targetOffset,f);d=_(d,h),p=_(p,m);for(var g=c.left+p.left-d.left,v=c.top+p.top-d.top,y=0;yC.documentElement.clientHeight&&(A=this.cache("scrollbar-size",u),S.viewport.bottom-=A.height),T.innerWidth>C.documentElement.clientWidth&&(A=this.cache("scrollbar-size",u),S.viewport.right-=A.width),-1!==["","static"].indexOf(C.body.style.position)&&-1!==["","static"].indexOf(C.body.parentElement.style.position)||(S.page.bottom=C.body.scrollHeight-v-o,S.page.right=C.body.scrollWidth-g-r),void 0!==this.options.optimizations&&!1!==this.options.optimizations.moveElement&&void 0===this.targetModifier&&function(){var e=t.cache("target-offsetparent",function(){return l(t.target)}),n=t.cache("target-offsetparent-bounds",function(){return s(e)}),i=getComputedStyle(e),r=n,o={};if(["Top","Left","Bottom","Right"].forEach(function(t){o[t.toLowerCase()]=parseFloat(i["border"+t+"Width"])}),n.right=C.body.scrollWidth-n.left-r.width+o.right,n.bottom=C.body.scrollHeight-n.top-r.height+o.bottom,S.page.top>=n.top+o.top&&S.page.bottom>=n.bottom&&S.page.left>=n.left+o.left&&S.page.right>=n.right){var a=e.scrollTop,u=e.scrollLeft;S.offset={top:S.page.top-n.top+a-o.top,left:S.page.left-n.left+u-o.left}}}(),this.move(S),this.history.unshift(S),this.history.length>3&&this.history.pop(),e&&N(),!0}}},{key:"move",value:function(t){var e=this;if(void 0!==this.element.parentNode){var n={};for(var i in t){n[i]={};for(var r in t[i]){for(var o=!1,a=0;a=0){var h=s.split(" "),g=L(h,2);f=g[0],c=g[1]}else c=f=s;var b=w(e,o);"target"!==f&&"both"!==f||(nb[3]&&"bottom"===v.top&&(n-=d,v.top="top")),"together"===f&&("top"===v.top&&("bottom"===y.top&&nb[3]&&n-(a-d)>=b[1]&&(n-=a-d,v.top="bottom",y.top="bottom")),"bottom"===v.top&&("top"===y.top&&n+a>b[3]?(n-=d,v.top="top",n-=a,y.top="bottom"):"bottom"===y.top&&nb[3]&&"top"===y.top?(n-=a,y.top="bottom"):nb[2]&&"right"===v.left&&(i-=p,v.left="left")),"together"===c&&(ib[2]&&"right"===v.left?"left"===y.left?(i-=p,v.left="left",i-=l,y.left="right"):"right"===y.left&&(i-=p,v.left="left",i+=l,y.left="left"):"center"===v.left&&(i+l>b[2]&&"left"===y.left?(i-=l,y.left="right"):ib[3]&&"top"===y.top&&(n-=a,y.top="bottom")),"element"!==c&&"both"!==c||(ib[2]&&("left"===y.left?(i-=l,y.left="right"):"center"===y.left&&(i-=l/2,y.left="right"))),"string"==typeof u?u=u.split(",").map(function(t){return t.trim()}):!0===u&&(u=["top","left","right","bottom"]),u=u||[];var _=[],x=[];n=0?(n=b[1],_.push("top")):x.push("top")),n+a>b[3]&&(u.indexOf("bottom")>=0?(n=b[3]-a,_.push("bottom")):x.push("bottom")),i=0?(i=b[0],_.push("left")):x.push("left")),i+l>b[2]&&(u.indexOf("right")>=0?(i=b[2]-l,_.push("right")):x.push("right")),_.length&&function(){var t=void 0;t=void 0!==e.options.pinnedClass?e.options.pinnedClass:e.getClass("pinned"),m.push(t),_.forEach(function(e){m.push(t+"-"+e)})}(),x.length&&function(){var t=void 0;t=void 0!==e.options.outOfBoundsClass?e.options.outOfBoundsClass:e.getClass("out-of-bounds"),m.push(t),x.forEach(function(e){m.push(t+"-"+e)})}(),(_.indexOf("left")>=0||_.indexOf("right")>=0)&&(y.left=v.left=!1),(_.indexOf("top")>=0||_.indexOf("bottom")>=0)&&(y.top=v.top=!1),v.top===r.top&&v.left===r.left&&y.top===e.attachment.top&&y.left===e.attachment.left||(e.updateAttachClasses(y,v),e.trigger("update",{attachment:y,targetAttachment:v}))}),D(function(){!1!==e.options.addTargetClasses&&g(e.target,m,h),g(e.element,m,h)}),{top:n,left:i}}});var B=E.Utils,s=B.getBounds,g=B.updateClasses,D=B.defer;E.modules.push({position:function(t){var e=this,n=t.top,i=t.left,r=this.cache("element-bounds",function(){return s(e.element)}),o=r.height,a=r.width,l=this.getTargetBounds(),u=n+o,c=i+a,f=[];n<=l.bottom&&u>=l.top&&["left","right"].forEach(function(t){var e=l[t];e!==i&&e!==c||f.push(t)}),i<=l.right&&c>=l.left&&["top","bottom"].forEach(function(t){var e=l[t];e!==n&&e!==u||f.push(t)});var d=[],p=[],h=["left","top","right","bottom"];return d.push(this.getClass("abutted")),h.forEach(function(t){d.push(e.getClass("abutted")+"-"+t)}),f.length&&p.push(this.getClass("abutted")),f.forEach(function(t){p.push(e.getClass("abutted")+"-"+t)}),D(function(){!1!==e.options.addTargetClasses&&g(e.target,p,d),g(e.element,p,d)}),!0}});var L=function(){function t(t,e){var n=[],i=!0,r=!1,o=void 0;try{for(var a,s=t[Symbol.iterator]();!(i=(a=s.next()).done)&&(n.push(a.value),!e||n.length!==e);i=!0);}catch(t){r=!0,o=t}finally{try{!i&&s.return&&s.return()}finally{if(r)throw o}}return n}return function(e,n){if(Array.isArray(e))return e;if(Symbol.iterator in Object(e))return t(e,n);throw new TypeError("Invalid attempt to destructure non-iterable instance")}}();return E.modules.push({position:function(t){var e=t.top,n=t.left;if(this.options.shift){var i=this.options.shift;"function"==typeof this.options.shift&&(i=this.options.shift.call(this,{top:e,left:n}));var r=void 0,o=void 0;if("string"==typeof i){i=i.split(" "),i[1]=i[1]||i[0];var a=i,s=L(a,2);r=s[0],o=s[1],r=parseFloat(r,10),o=parseFloat(o,10)}else r=i.top,o=i.left;return e+=r,n+=o,{top:e,left:n}}}}),G})},function(t,e,n){"use strict";var i;i=function(){return this}();try{i=i||Function("return this")()||(0,eval)("this")}catch(t){"object"==typeof window&&(i=window)}t.exports=i},function(t,e,n){(function(e){t.exports=e.Tether=n(23)}).call(e,n(24))},function(t,e,n){n(5),t.exports=n(6)}]); \ No newline at end of file diff --git a/config/.htaccess b/config/.htaccess new file mode 100644 index 0000000..3de9e40 --- /dev/null +++ b/config/.htaccess @@ -0,0 +1,10 @@ +# Apache 2.2 + + Order deny,allow + Deny from all + + +# Apache 2.4 + + Require all denied + diff --git a/config/theme.yml b/config/theme.yml new file mode 100644 index 0000000..89b27d4 --- /dev/null +++ b/config/theme.yml @@ -0,0 +1,120 @@ +name: elegance +display_name: Elegance +version: 1.0.0 +author: + name: "Thob team" + email: "tech@thob.studio" + url: "http://thob.studio" + +meta: + compatibility: + from: 1.7.0.0 + to: ~ + + available_layouts: + layout-full-width: + name: Full Width + description: No side columns, ideal for distraction-free pages such as product pages. + +assets: +# If you're using this theme as child and you want to load +# the parent theme assets, uncomment this line. +# use_parent_assets: true + +# The following lines are showing how to load assets in your page +# Uncomment and change value to start loading css or js files +# css: +# all: +# - id: custom-lib-style +# path: assets/css/custom-lib.css +# product: +# - id: product-style +# path: assets/css/product.css +# media: all +# priority: 200 +# js: +# cart: +# - id: cat-extra-lib +# path: assets/js/cart-lib.js + + +global_settings: + configuration: + PS_IMAGE_QUALITY: png + modules: + to_enable: + - ps_linklist + hooks: + custom_hooks: + - name: displayMainMenu + title: Display main menu + description: Display main menu + modules_to_hook: + displayNav1: + - ps_contactinfo + displayNav2: + - ps_languageselector + - ps_currencyselector + - ps_customersignin + - ps_shoppingcart + displayTop: + - ps_mainmenu + - ps_searchbar + displayHome: + - ps_imageslider + - ps_featuredproducts + - ps_banner + - ps_customtext + displayFooterBefore: + - ps_emailsubscription + - ps_socialfollow + displayFooter: + - ps_linklist + - ps_customeraccountlinks + - ps_contactinfo + displayLeftColumn: + - ps_categorytree + - ps_facetedsearch + displaySearch: + - ps_searchbar + displayProductAdditionalInfo: + - ps_sharebuttons + displayReassurance: + - blockreassurance + displayOrderConfirmation2: + - ps_featuredproducts + displayCrossSellingShoppingCart: + - ps_featuredproducts + + image_types: + cart_default: + width: 125 + height: 125 + scope: [products] + small_default: + width: 98 + height: 98 + scope: [products, categories, manufacturers, suppliers] + medium_default: + width: 452 + height: 452 + scope: [products, manufacturers, suppliers] + home_default: + width: 250 + height: 250 + scope: [products] + large_default: + width: 800 + height: 800 + scope: [products, manufacturers, suppliers] + category_default: + width: 141 + height: 180 + scope: [categories] + stores_default: + width: 170 + height: 115 + scope: [stores] + +theme_settings: + default_layout: layout-full-width diff --git a/modules/blockreassurance/views/templates/hook/blockreassurance.tpl b/modules/blockreassurance/views/templates/hook/blockreassurance.tpl new file mode 100644 index 0000000..196ea01 --- /dev/null +++ b/modules/blockreassurance/views/templates/hook/blockreassurance.tpl @@ -0,0 +1,38 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{if $elements} +
+
    + {foreach from=$elements item=element} +
  • +
    + {$element.text} + {$element.text} +
    +
    • + {/foreach} +
+
+{/if} diff --git a/modules/contactform/views/templates/widget/contactform.tpl b/modules/contactform/views/templates/widget/contactform.tpl new file mode 100644 index 0000000..18849f0 --- /dev/null +++ b/modules/contactform/views/templates/widget/contactform.tpl @@ -0,0 +1,135 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
+
+ + {if $notifications} +
+
    + {foreach $notifications.messages as $notif} +
  • {$notif}
    • + {/foreach} +
+
+ {/if} + + {if !$notifications || $notifications.nw_error} +
+ +
+
+

{l s='Contact us' d='Shop.Theme.Global'}

+
+
+ +
+ +
+ +
+
+ +
+ +
+ +
+
+ + {if $contact.orders} +
+ +
+ +
+ + {l s='optional' d='Shop.Forms.Help'} + +
+ {/if} + + {if $contact.allow_file_upload} +
+ +
+ +
+ + {l s='optional' d='Shop.Forms.Help'} + +
+ {/if} + +
+ +
+ +
+
+ + {if isset($id_module)} +
+
+ {hook h='displayGDPRConsent' id_module=$id_module} +
+
+ {/if} + +
+ +
+ + + + +
+ {/if} + +
+
diff --git a/modules/ps_advertising/index.php b/modules/ps_advertising/index.php new file mode 100644 index 0000000..99e1f25 --- /dev/null +++ b/modules/ps_advertising/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header("Expires: Mon, 26 Jul 1997 05:00:00 GMT"); +header("Last-Modified: ".gmdate("D, d M Y H:i:s")." GMT"); + +header("Cache-Control: no-store, no-cache, must-revalidate"); +header("Cache-Control: post-check=0, pre-check=0", false); +header("Pragma: no-cache"); + +header("Location: ../"); +exit; diff --git a/modules/ps_advertising/ps_advertising.tpl b/modules/ps_advertising/ps_advertising.tpl new file mode 100644 index 0000000..8853778 --- /dev/null +++ b/modules/ps_advertising/ps_advertising.tpl @@ -0,0 +1,28 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
+ {$adv_title} +
diff --git a/modules/ps_banner/ps_banner.tpl b/modules/ps_banner/ps_banner.tpl new file mode 100644 index 0000000..5a289ad --- /dev/null +++ b/modules/ps_banner/ps_banner.tpl @@ -0,0 +1,31 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + diff --git a/modules/ps_bestsellers/views/index.php b/modules/ps_bestsellers/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_bestsellers/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_bestsellers/views/templates/hook/index.php b/modules/ps_bestsellers/views/templates/hook/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_bestsellers/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_bestsellers/views/templates/hook/ps_bestsellers.tpl b/modules/ps_bestsellers/views/templates/hook/ps_bestsellers.tpl new file mode 100644 index 0000000..66f1286 --- /dev/null +++ b/modules/ps_bestsellers/views/templates/hook/ps_bestsellers.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
+

+ {l s='Best Sellers' d='Shop.Theme.Catalog'} +

+
+ {foreach from=$products item="product"} + {include file="catalog/_partials/miniatures/product.tpl" product=$product} + {/foreach} +
+ + {l s='All best sellers' d='Shop.Theme.Catalog'} + +
diff --git a/modules/ps_bestsellers/views/templates/index.php b/modules/ps_bestsellers/views/templates/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_bestsellers/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_brandlist/views/index.php b/modules/ps_brandlist/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_brandlist/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_brandlist/views/templates/_partials/brand_form.tpl b/modules/ps_brandlist/views/templates/_partials/brand_form.tpl new file mode 100644 index 0000000..cbd1fb5 --- /dev/null +++ b/modules/ps_brandlist/views/templates/_partials/brand_form.tpl @@ -0,0 +1,33 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
+ +
diff --git a/modules/ps_brandlist/views/templates/_partials/brand_text.tpl b/modules/ps_brandlist/views/templates/_partials/brand_text.tpl new file mode 100644 index 0000000..2399630 --- /dev/null +++ b/modules/ps_brandlist/views/templates/_partials/brand_text.tpl @@ -0,0 +1,36 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    + {foreach from=$brands item=brand name=brand_list} + {if $smarty.foreach.brand_list.iteration <= $text_list_nb} +
  • + + {$brand['name']} + +
    • + {/if} + {/foreach} +
diff --git a/modules/ps_brandlist/views/templates/_partials/index.php b/modules/ps_brandlist/views/templates/_partials/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_brandlist/views/templates/_partials/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_brandlist/views/templates/hook/index.php b/modules/ps_brandlist/views/templates/hook/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_brandlist/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_brandlist/views/templates/hook/ps_brandlist.tpl b/modules/ps_brandlist/views/templates/hook/ps_brandlist.tpl new file mode 100644 index 0000000..624a174 --- /dev/null +++ b/modules/ps_brandlist/views/templates/hook/ps_brandlist.tpl @@ -0,0 +1,41 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
+
+

+ {if $display_link_brand}{/if} + {l s='Brands' d='Shop.Theme.Catalog'} + {if $display_link_brand}{/if} +

+
+ {if $brands} + {include file="module:ps_brandlist/views/templates/_partials/$brand_display_type.tpl" brands=$brands} + {else} +

{l s='No brand' d='Shop.Theme.Catalog'}

+ {/if} +
+
+
diff --git a/modules/ps_brandlist/views/templates/index.php b/modules/ps_brandlist/views/templates/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_brandlist/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_categoryproducts/views/index.php b/modules/ps_categoryproducts/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_categoryproducts/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_categoryproducts/views/templates/hook/index.php b/modules/ps_categoryproducts/views/templates/hook/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_categoryproducts/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_categoryproducts/views/templates/hook/ps_categoryproducts.tpl b/modules/ps_categoryproducts/views/templates/hook/ps_categoryproducts.tpl new file mode 100644 index 0000000..3139444 --- /dev/null +++ b/modules/ps_categoryproducts/views/templates/hook/ps_categoryproducts.tpl @@ -0,0 +1,38 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
+

+ {if $products|@count == 1} + {l s='%s other product in the same category:' sprintf=[$products|@count] d='Shop.Theme.Catalog'} + {else} + {l s='%s other products in the same category:' sprintf=[$products|@count] d='Shop.Theme.Catalog'} + {/if} +

+
+ {foreach from=$products item="product"} + {include file="catalog/_partials/miniatures/product.tpl" product=$product} + {/foreach} +
+
diff --git a/modules/ps_categoryproducts/views/templates/index.php b/modules/ps_categoryproducts/views/templates/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_categoryproducts/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_categorytree/views/templates/hook/ps_categorytree.tpl b/modules/ps_categorytree/views/templates/hook/ps_categorytree.tpl new file mode 100644 index 0000000..90e78c7 --- /dev/null +++ b/modules/ps_categorytree/views/templates/hook/ps_categorytree.tpl @@ -0,0 +1,67 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +{function name="categories" nodes=[] depth=0} + {strip} + {if $nodes|count} +
    + {foreach from=$nodes item=node} +
  • + {if $depth===0} + {$node.name} + {if $node.children} +
    + + +
    +
    + {categories nodes=$node.children depth=$depth+1} +
    + {/if} + {else} + {$node.name} + {if $node.children} + + + + +
    + {categories nodes=$node.children depth=$depth+1} +
    + {/if} + {/if} +
    • + {/foreach} +
+ {/if} + {/strip} +{/function} + +
+ +
diff --git a/modules/ps_contactinfo/nav.tpl b/modules/ps_contactinfo/nav.tpl new file mode 100644 index 0000000..c325517 --- /dev/null +++ b/modules/ps_contactinfo/nav.tpl @@ -0,0 +1,42 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
+ +
diff --git a/modules/ps_contactinfo/ps_contactinfo-rich.tpl b/modules/ps_contactinfo/ps_contactinfo-rich.tpl new file mode 100644 index 0000000..ae79bc0 --- /dev/null +++ b/modules/ps_contactinfo/ps_contactinfo-rich.tpl @@ -0,0 +1,62 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
+

{l s='Store information' d='Shop.Theme.Global'}

+
+
+
{$contact_infos.address.formatted nofilter}
+
+ {if $contact_infos.phone} +
+
+
+
+ {l s='Call us:' d='Shop.Theme.Global'}
+ {$contact_infos.phone} +
+
+ {/if} + {if $contact_infos.fax} +
+
+
+
+ {l s='Fax:' d='Shop.Theme.Global'}
+ {$contact_infos.fax} +
+
+ {/if} + {if $contact_infos.email} +
+
+
+ + {$contact_infos.email} +
+ {/if} +
diff --git a/modules/ps_contactinfo/ps_contactinfo.tpl b/modules/ps_contactinfo/ps_contactinfo.tpl new file mode 100644 index 0000000..e7bda1b --- /dev/null +++ b/modules/ps_contactinfo/ps_contactinfo.tpl @@ -0,0 +1,74 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
+
+

{l s='Store information' d='Shop.Theme.Global'}

+ {$contact_infos.address.formatted nofilter} + {if $contact_infos.phone} +
+ {* [1][/1] is for a HTML tag. *} + {l s='Call us: [1]%phone%[/1]' + sprintf=[ + '[1]' => '', + '[/1]' => '', + '%phone%' => $contact_infos.phone + ] + d='Shop.Theme.Global' + } + {/if} + {if $contact_infos.fax} +
+ {* [1][/1] is for a HTML tag. *} + {l + s='Fax: [1]%fax%[/1]' + sprintf=[ + '[1]' => '', + '[/1]' => '', + '%fax%' => $contact_infos.fax + ] + d='Shop.Theme.Global' + } + {/if} + {if $contact_infos.email} +
+ {* [1][/1] is for a HTML tag. *} + {l + s='Email us: [1]%email%[/1]' + sprintf=[ + '[1]' => '', + '[/1]' => '', + '%email%' => $contact_infos.email + ] + d='Shop.Theme.Global' + } + {/if} +
+
+
+ {l s='Store information' d='Shop.Theme.Global'} +
+
+
diff --git a/modules/ps_crossselling/views/index.php b/modules/ps_crossselling/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_crossselling/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_crossselling/views/templates/hook/index.php b/modules/ps_crossselling/views/templates/hook/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_crossselling/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_crossselling/views/templates/hook/ps_crossselling.tpl b/modules/ps_crossselling/views/templates/hook/ps_crossselling.tpl new file mode 100644 index 0000000..020b16d --- /dev/null +++ b/modules/ps_crossselling/views/templates/hook/ps_crossselling.tpl @@ -0,0 +1,33 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
+

{l s='Customers who bought this product also bought:' d='Shop.Theme.Catalog'}

+
+ {foreach from=$products item="product"} + {include file="catalog/_partials/miniatures/product.tpl" product=$product} + {/foreach} +
+
diff --git a/modules/ps_crossselling/views/templates/index.php b/modules/ps_crossselling/views/templates/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_crossselling/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_currencyselector/ps_currencyselector.tpl b/modules/ps_currencyselector/ps_currencyselector.tpl new file mode 100644 index 0000000..aaf9c7b --- /dev/null +++ b/modules/ps_currencyselector/ps_currencyselector.tpl @@ -0,0 +1,46 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
+
+ {l s='Currency:' d='Shop.Theme.Global'} + + + +
+
diff --git a/modules/ps_customeraccountlinks/ps_customeraccountlinks.tpl b/modules/ps_customeraccountlinks/ps_customeraccountlinks.tpl new file mode 100644 index 0000000..ee8832e --- /dev/null +++ b/modules/ps_customeraccountlinks/ps_customeraccountlinks.tpl @@ -0,0 +1,51 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + + diff --git a/modules/ps_customersignin/ps_customersignin.tpl b/modules/ps_customersignin/ps_customersignin.tpl new file mode 100644 index 0000000..db1cacc --- /dev/null +++ b/modules/ps_customersignin/ps_customersignin.tpl @@ -0,0 +1,58 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
+ {if $logged} + + + {l s='Sign out' d='Shop.Theme.Actions'} + + + {else} + + + + {/if} +
diff --git a/modules/ps_emailalerts/views/index.php b/modules/ps_emailalerts/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_emailalerts/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_emailalerts/views/templates/hook/index.php b/modules/ps_emailalerts/views/templates/hook/index.php new file mode 100644 index 0000000..96ed9b8 --- /dev/null +++ b/modules/ps_emailalerts/views/templates/hook/index.php @@ -0,0 +1,34 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_emailalerts/views/templates/hook/my-account-footer.tpl b/modules/ps_emailalerts/views/templates/hook/my-account-footer.tpl new file mode 100644 index 0000000..1296834 --- /dev/null +++ b/modules/ps_emailalerts/views/templates/hook/my-account-footer.tpl @@ -0,0 +1,30 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
  • + + {l s='My alerts' d='Shop.Theme.Catalog'} + +
    • diff --git a/modules/ps_emailalerts/views/templates/hook/my-account.tpl b/modules/ps_emailalerts/views/templates/hook/my-account.tpl new file mode 100644 index 0000000..d0dd4e7 --- /dev/null +++ b/modules/ps_emailalerts/views/templates/hook/my-account.tpl @@ -0,0 +1,32 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + + + + + {l s='My alerts' d='Shop.Theme.Catalog'} + + diff --git a/modules/ps_emailalerts/views/templates/index.php b/modules/ps_emailalerts/views/templates/index.php new file mode 100644 index 0000000..96ed9b8 --- /dev/null +++ b/modules/ps_emailalerts/views/templates/index.php @@ -0,0 +1,34 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_emailsubscription/views/templates/hook/ps_emailsubscription.tpl b/modules/ps_emailsubscription/views/templates/hook/ps_emailsubscription.tpl new file mode 100644 index 0000000..f304091 --- /dev/null +++ b/modules/ps_emailsubscription/views/templates/hook/ps_emailsubscription.tpl @@ -0,0 +1,74 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    +
    +

    {l s='Get our latest news and special sales' d='Shop.Theme.Global'}

    +
    +
    +
    +
    + + +
    + +
    + +
    +
    +
    + {if $conditions} +

    {$conditions}

    + {/if} + {if $msg} +

    + {$msg} +

    + {/if} + {if isset($id_module)} + {hook h='displayGDPRConsent' id_module=$id_module} + {/if} +
    +
    +
    +
    +
    +
    diff --git a/modules/ps_facetedsearch/ps_facetedsearch.tpl b/modules/ps_facetedsearch/ps_facetedsearch.tpl new file mode 100644 index 0000000..f429528 --- /dev/null +++ b/modules/ps_facetedsearch/ps_facetedsearch.tpl @@ -0,0 +1,36 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{if isset($listing.rendered_facets)} +
    +
    + + +
    + {$listing.rendered_facets nofilter} +
    +{/if} diff --git a/modules/ps_featuredproducts/views/templates/hook/ps_featuredproducts.tpl b/modules/ps_featuredproducts/views/templates/hook/ps_featuredproducts.tpl new file mode 100644 index 0000000..544d208 --- /dev/null +++ b/modules/ps_featuredproducts/views/templates/hook/ps_featuredproducts.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +

    + {l s='Popular Products' d='Shop.Theme.Catalog'} +

    +
    + {foreach from=$products item="product"} + {include file="catalog/_partials/miniatures/product.tpl" product=$product} + {/foreach} +
    + + {l s='All products' d='Shop.Theme.Catalog'} + +
    diff --git a/modules/ps_imageslider/views/templates/hook/slider.tpl b/modules/ps_imageslider/views/templates/hook/slider.tpl new file mode 100644 index 0000000..c670467 --- /dev/null +++ b/modules/ps_imageslider/views/templates/hook/slider.tpl @@ -0,0 +1,60 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +{if $homeslider.slides} + +{/if} diff --git a/modules/ps_languageselector/ps_languageselector.tpl b/modules/ps_languageselector/ps_languageselector.tpl new file mode 100644 index 0000000..d016e39 --- /dev/null +++ b/modules/ps_languageselector/ps_languageselector.tpl @@ -0,0 +1,49 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +
    + {l s='Language:' d='Shop.Theme.Global'} +
    + + + +
    +
    +
    diff --git a/modules/ps_legalcompliance/views/templates/hook/hookDisplayFooter.tpl b/modules/ps_legalcompliance/views/templates/hook/hookDisplayFooter.tpl new file mode 100644 index 0000000..6f4ca3a --- /dev/null +++ b/modules/ps_legalcompliance/views/templates/hook/hookDisplayFooter.tpl @@ -0,0 +1,44 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    +

    {l s='Information' d='Modules.Legalcompliance.Shop'}

    +
    + {l s='Information' d='Modules.Legalcompliance.Shop'} + + + + + + +
    + +
    diff --git a/modules/ps_linklist/views/templates/hook/linkblock.tpl b/modules/ps_linklist/views/templates/hook/linkblock.tpl new file mode 100644 index 0000000..61a1bbb --- /dev/null +++ b/modules/ps_linklist/views/templates/hook/linkblock.tpl @@ -0,0 +1,42 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +{foreach $linkBlocks as $linkBlock} +
    +
    + {$linkBlock.title} +
    + +
    +{/foreach} +
    diff --git a/modules/ps_mainmenu/ps_mainmenu.tpl b/modules/ps_mainmenu/ps_mainmenu.tpl new file mode 100644 index 0000000..3e3d300 --- /dev/null +++ b/modules/ps_mainmenu/ps_mainmenu.tpl @@ -0,0 +1,23 @@ +{assign var=_counter value=0} +{function name="menu" nodes=[] depth=0 parent=null} + {if $nodes|count} +
      + {foreach from=$nodes item=node} +
    • + {assign var=_counter value=$_counter+1} + + {$node.label} + +
      • + {/foreach} +
    + {/if} +{/function} + + diff --git a/modules/ps_newproducts/views/index.php b/modules/ps_newproducts/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_newproducts/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_newproducts/views/templates/hook/index.php b/modules/ps_newproducts/views/templates/hook/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_newproducts/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_newproducts/views/templates/hook/ps_newproducts.tpl b/modules/ps_newproducts/views/templates/hook/ps_newproducts.tpl new file mode 100644 index 0000000..0bb9779 --- /dev/null +++ b/modules/ps_newproducts/views/templates/hook/ps_newproducts.tpl @@ -0,0 +1,39 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    +

    + {l s='New products' d='Shop.Theme.Catalog'} +

    +
    + {foreach from=$products item="product"} + {include file="catalog/_partials/miniatures/product.tpl" product=$product} + {/foreach} +
    + + {l s='All new products' d='Shop.Theme.Catalog'} + +
    + diff --git a/modules/ps_newproducts/views/templates/index.php b/modules/ps_newproducts/views/templates/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_newproducts/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_productinfo/views/index.php b/modules/ps_productinfo/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_productinfo/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_productinfo/views/templates/hook/index.php b/modules/ps_productinfo/views/templates/hook/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_productinfo/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_productinfo/views/templates/hook/ps_productinfo.tpl b/modules/ps_productinfo/views/templates/hook/ps_productinfo.tpl new file mode 100644 index 0000000..471f3bb --- /dev/null +++ b/modules/ps_productinfo/views/templates/hook/ps_productinfo.tpl @@ -0,0 +1,43 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {if isset($vars_nb_people)} +

    + {if $vars_nb_people['%nb_people%'] == 1} + {l s='1 person is currently watching this product.' d='Shop.Theme.Catalog'} + {else} + {l s='%nb_people% people are currently watching this product.' sprintf=$vars_nb_people d='Shop.Theme.Catalog'} + {/if} +

    + {/if} + + {if isset($vars_date_last_order)} +

    {l s='Last time this product was bought: %date_last_order%' sprintf=$vars_date_last_order d='Shop.Theme.Catalog'}

    + {/if} + + {if isset($vars_date_last_cart)} +

    {l s='Last time this product was added to a cart: %date_last_cart%' sprintf=$vars_date_last_cart d='Shop.Theme.Catalog'}

    + {/if} +
    diff --git a/modules/ps_productinfo/views/templates/index.php b/modules/ps_productinfo/views/templates/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_productinfo/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_rssfeed/views/index.php b/modules/ps_rssfeed/views/index.php new file mode 100644 index 0000000..99e1f25 --- /dev/null +++ b/modules/ps_rssfeed/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header("Expires: Mon, 26 Jul 1997 05:00:00 GMT"); +header("Last-Modified: ".gmdate("D, d M Y H:i:s")." GMT"); + +header("Cache-Control: no-store, no-cache, must-revalidate"); +header("Cache-Control: post-check=0, pre-check=0", false); +header("Pragma: no-cache"); + +header("Location: ../"); +exit; diff --git a/modules/ps_rssfeed/views/templates/hook/index.php b/modules/ps_rssfeed/views/templates/hook/index.php new file mode 100644 index 0000000..99e1f25 --- /dev/null +++ b/modules/ps_rssfeed/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header("Expires: Mon, 26 Jul 1997 05:00:00 GMT"); +header("Last-Modified: ".gmdate("D, d M Y H:i:s")." GMT"); + +header("Cache-Control: no-store, no-cache, must-revalidate"); +header("Cache-Control: post-check=0, pre-check=0", false); +header("Pragma: no-cache"); + +header("Location: ../"); +exit; diff --git a/modules/ps_rssfeed/views/templates/hook/ps_rssfeed.tpl b/modules/ps_rssfeed/views/templates/hook/ps_rssfeed.tpl new file mode 100644 index 0000000..54dfe8e --- /dev/null +++ b/modules/ps_rssfeed/views/templates/hook/ps_rssfeed.tpl @@ -0,0 +1,39 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    +

    {$title}

    +
    + {if $rss_links} + + {else} +

    {l s='No RSS feed added' d='Shop.Theme.Catalog'}

    + {/if} +
    +
    diff --git a/modules/ps_rssfeed/views/templates/index.php b/modules/ps_rssfeed/views/templates/index.php new file mode 100644 index 0000000..99e1f25 --- /dev/null +++ b/modules/ps_rssfeed/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header("Expires: Mon, 26 Jul 1997 05:00:00 GMT"); +header("Last-Modified: ".gmdate("D, d M Y H:i:s")." GMT"); + +header("Cache-Control: no-store, no-cache, must-revalidate"); +header("Cache-Control: post-check=0, pre-check=0", false); +header("Pragma: no-cache"); + +header("Location: ../"); +exit; diff --git a/modules/ps_searchbar/ps_searchbar.tpl b/modules/ps_searchbar/ps_searchbar.tpl new file mode 100644 index 0000000..a713cbf --- /dev/null +++ b/modules/ps_searchbar/ps_searchbar.tpl @@ -0,0 +1,35 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    +
    + + + +
    +
    + diff --git a/modules/ps_sharebuttons/views/templates/hook/ps_sharebuttons.tpl b/modules/ps_sharebuttons/views/templates/hook/ps_sharebuttons.tpl new file mode 100644 index 0000000..7d2127a --- /dev/null +++ b/modules/ps_sharebuttons/views/templates/hook/ps_sharebuttons.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +{block name='social_sharing'} + {if $social_share_links} + + {/if} +{/block} diff --git a/modules/ps_shoppingcart/modal.tpl b/modules/ps_shoppingcart/modal.tpl new file mode 100644 index 0000000..8145ec1 --- /dev/null +++ b/modules/ps_shoppingcart/modal.tpl @@ -0,0 +1,83 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + diff --git a/modules/ps_shoppingcart/ps_shoppingcart-product-line.tpl b/modules/ps_shoppingcart/ps_shoppingcart-product-line.tpl new file mode 100644 index 0000000..49db671 --- /dev/null +++ b/modules/ps_shoppingcart/ps_shoppingcart-product-line.tpl @@ -0,0 +1,59 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{$product.quantity} +{$product.name} +{$product.price} + + {l s='Remove' d='Shop.Theme.Actions'} + +{if $product.customizations|count} +
    +
      + {foreach from=$product.customizations item='customization'} +
    • + {$customization.quantity} + {l s='Remove' d='Shop.Theme.Actions'} +
        + {foreach from=$customization.fields item='field'} +
      • + {$field.label} + {if $field.type == 'text'} + {$field.text nofilter} + {elseif $field.type == 'image'} + + {/if} +
        • + {/foreach} +
      +
      • + {/foreach} +
    +
    +{/if} diff --git a/modules/ps_shoppingcart/ps_shoppingcart.tpl b/modules/ps_shoppingcart/ps_shoppingcart.tpl new file mode 100644 index 0000000..16186fa --- /dev/null +++ b/modules/ps_shoppingcart/ps_shoppingcart.tpl @@ -0,0 +1,44 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +
    +
    + {if $cart.products_count > 0} + + {/if} + + + + + + + + {$cart.products_count} + {if $cart.products_count > 0} + + {/if} +
    +
    +
    diff --git a/modules/ps_socialfollow/ps_socialfollow.tpl b/modules/ps_socialfollow/ps_socialfollow.tpl new file mode 100644 index 0000000..5379ffd --- /dev/null +++ b/modules/ps_socialfollow/ps_socialfollow.tpl @@ -0,0 +1,34 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +{block name='block_social'} +
    + +
    +{/block} diff --git a/modules/ps_specials/views/index.php b/modules/ps_specials/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_specials/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_specials/views/templates/hook/index.php b/modules/ps_specials/views/templates/hook/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_specials/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_specials/views/templates/hook/ps_specials.tpl b/modules/ps_specials/views/templates/hook/ps_specials.tpl new file mode 100644 index 0000000..0671ada --- /dev/null +++ b/modules/ps_specials/views/templates/hook/ps_specials.tpl @@ -0,0 +1,38 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    +

    + {l s='On sale' d='Shop.Theme.Catalog'} +

    +
    + {foreach from=$products item="product"} + {include file="catalog/_partials/miniatures/product.tpl" product=$product} + {/foreach} +
    + + {l s='All sale products' d='Shop.Theme.Catalog'} + +
    diff --git a/modules/ps_specials/views/templates/index.php b/modules/ps_specials/views/templates/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_specials/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_supplierlist/views/index.php b/modules/ps_supplierlist/views/index.php new file mode 100644 index 0000000..99e1f25 --- /dev/null +++ b/modules/ps_supplierlist/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header("Expires: Mon, 26 Jul 1997 05:00:00 GMT"); +header("Last-Modified: ".gmdate("D, d M Y H:i:s")." GMT"); + +header("Cache-Control: no-store, no-cache, must-revalidate"); +header("Cache-Control: post-check=0, pre-check=0", false); +header("Pragma: no-cache"); + +header("Location: ../"); +exit; diff --git a/modules/ps_supplierlist/views/templates/_partials/index.php b/modules/ps_supplierlist/views/templates/_partials/index.php new file mode 100644 index 0000000..99e1f25 --- /dev/null +++ b/modules/ps_supplierlist/views/templates/_partials/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header("Expires: Mon, 26 Jul 1997 05:00:00 GMT"); +header("Last-Modified: ".gmdate("D, d M Y H:i:s")." GMT"); + +header("Cache-Control: no-store, no-cache, must-revalidate"); +header("Cache-Control: post-check=0, pre-check=0", false); +header("Pragma: no-cache"); + +header("Location: ../"); +exit; diff --git a/modules/ps_supplierlist/views/templates/_partials/supplier_form.tpl b/modules/ps_supplierlist/views/templates/_partials/supplier_form.tpl new file mode 100644 index 0000000..a1e3da5 --- /dev/null +++ b/modules/ps_supplierlist/views/templates/_partials/supplier_form.tpl @@ -0,0 +1,33 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    + +
    diff --git a/modules/ps_supplierlist/views/templates/_partials/supplier_text.tpl b/modules/ps_supplierlist/views/templates/_partials/supplier_text.tpl new file mode 100644 index 0000000..9df7c8b --- /dev/null +++ b/modules/ps_supplierlist/views/templates/_partials/supplier_text.tpl @@ -0,0 +1,36 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
      + {foreach from=$suppliers item=supplier name=supplier_list} + {if $smarty.foreach.supplier_list.iteration <= $text_list_nb} +
    • + + {$supplier['name']} + +
      • + {/if} + {/foreach} +
    diff --git a/modules/ps_supplierlist/views/templates/hook/index.php b/modules/ps_supplierlist/views/templates/hook/index.php new file mode 100644 index 0000000..99e1f25 --- /dev/null +++ b/modules/ps_supplierlist/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header("Expires: Mon, 26 Jul 1997 05:00:00 GMT"); +header("Last-Modified: ".gmdate("D, d M Y H:i:s")." GMT"); + +header("Cache-Control: no-store, no-cache, must-revalidate"); +header("Cache-Control: post-check=0, pre-check=0", false); +header("Pragma: no-cache"); + +header("Location: ../"); +exit; diff --git a/modules/ps_supplierlist/views/templates/hook/ps_supplierlist.tpl b/modules/ps_supplierlist/views/templates/hook/ps_supplierlist.tpl new file mode 100644 index 0000000..26aabff --- /dev/null +++ b/modules/ps_supplierlist/views/templates/hook/ps_supplierlist.tpl @@ -0,0 +1,41 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    +
    +

    + {if $display_link_supplier}{/if} + {l s='Suppliers' d='Shop.Theme.Catalog'} + {if $display_link_supplier}{/if} +

    +
    + {if $suppliers} + {include file="module:ps_supplierlist/views/templates/_partials/$supplier_display_type.tpl" suppliers=$suppliers} + {else} +

    {l s='No supplier' d='Shop.Theme.Catalog'}

    + {/if} +
    +
    +
    diff --git a/modules/ps_supplierlist/views/templates/index.php b/modules/ps_supplierlist/views/templates/index.php new file mode 100644 index 0000000..99e1f25 --- /dev/null +++ b/modules/ps_supplierlist/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header("Expires: Mon, 26 Jul 1997 05:00:00 GMT"); +header("Last-Modified: ".gmdate("D, d M Y H:i:s")." GMT"); + +header("Cache-Control: no-store, no-cache, must-revalidate"); +header("Cache-Control: post-check=0, pre-check=0", false); +header("Pragma: no-cache"); + +header("Location: ../"); +exit; diff --git a/modules/ps_viewedproduct/views/index.php b/modules/ps_viewedproduct/views/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_viewedproduct/views/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_viewedproduct/views/templates/hook/index.php b/modules/ps_viewedproduct/views/templates/hook/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_viewedproduct/views/templates/hook/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/modules/ps_viewedproduct/views/templates/hook/ps_viewedproduct.tpl b/modules/ps_viewedproduct/views/templates/hook/ps_viewedproduct.tpl new file mode 100644 index 0000000..a8be2f3 --- /dev/null +++ b/modules/ps_viewedproduct/views/templates/hook/ps_viewedproduct.tpl @@ -0,0 +1,32 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +

    {l s='Viewed products' d='Shop.Theme.Catalog'}

    +
    + {foreach from=$products item="product"} + {include file="catalog/_partials/miniatures/product.tpl" product=$product} + {/foreach} +
    +
    diff --git a/modules/ps_viewedproduct/views/templates/index.php b/modules/ps_viewedproduct/views/templates/index.php new file mode 100644 index 0000000..e261c47 --- /dev/null +++ b/modules/ps_viewedproduct/views/templates/index.php @@ -0,0 +1,35 @@ + + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + */ + +header('Expires: Mon, 26 Jul 1997 05:00:00 GMT'); +header('Last-Modified: '.gmdate('D, d M Y H:i:s').' GMT'); + +header('Cache-Control: no-store, no-cache, must-revalidate'); +header('Cache-Control: post-check=0, pre-check=0', false); +header('Pragma: no-cache'); + +header('Location: ../'); +exit; diff --git a/preview.png b/preview.png new file mode 100644 index 0000000..b439058 Binary files /dev/null and b/preview.png differ diff --git a/templates/_partials/breadcrumb.tpl b/templates/_partials/breadcrumb.tpl new file mode 100644 index 0000000..d66e36b --- /dev/null +++ b/templates/_partials/breadcrumb.tpl @@ -0,0 +1,40 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + diff --git a/templates/_partials/footer.tpl b/templates/_partials/footer.tpl new file mode 100644 index 0000000..e8f1b01 --- /dev/null +++ b/templates/_partials/footer.tpl @@ -0,0 +1,54 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {block name='hook_footer_before'} + {hook h='displayFooterBefore'} + {/block} +
    +
    +
    +
    + + + +
    +
    +
    +
    +
    + {block name='hook_footer_after'} + {hook h='displayFooterAfter'} + {/block} +
    +
    +
    + {block name='copyright_link'} + + {l s='%copyright% %year% - Ecommerce software by %prestashop%' sprintf=['%prestashop%' => 'PrestaShop™', '%year%' => 'Y'|date, '%copyright%' => '©'] d='Shop.Theme.Global'} + + {/block} +
    +
    +
    diff --git a/templates/_partials/form-errors.tpl b/templates/_partials/form-errors.tpl new file mode 100644 index 0000000..73e3948 --- /dev/null +++ b/templates/_partials/form-errors.tpl @@ -0,0 +1,35 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{if $errors|count} +
    + {block name='form_errors'} +
      + {foreach $errors as $error} +
    • {$error|nl2br nofilter}
      • + {/foreach} +
    + {/block} +
    +{/if} diff --git a/templates/_partials/form-fields.tpl b/templates/_partials/form-fields.tpl new file mode 100644 index 0000000..32ffe5a --- /dev/null +++ b/templates/_partials/form-fields.tpl @@ -0,0 +1,195 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{if $field.type == 'hidden'} + + {block name='form_field_item_hidden'} + + {/block} + +{else} + +
    + +
    + + {if $field.type === 'select'} + + {block name='form_field_item_select'} + + {/block} + + {elseif $field.type === 'countrySelect'} + + {block name='form_field_item_country'} + + {/block} + + {elseif $field.type === 'radio-buttons'} + + {block name='form_field_item_radio'} + {foreach from=$field.availableValues item="label" key="value"} + + {/foreach} + {/block} + + {elseif $field.type === 'checkbox'} + + {block name='form_field_item_checkbox'} + + + + {/block} + + {elseif $field.type === 'date'} + + {block name='form_field_item_date'} + + {if isset($field.availableValues.comment)} + + {$field.availableValues.comment} + + {/if} + {/block} + + {elseif $field.type === 'birthday'} + + {block name='form_field_item_birthday'} +
    + {html_select_date + field_order=DMY + time={$field.value} + field_array={$field.name} + prefix=false + reverse_years=true + field_separator='
    ' + day_extra='class="form-control form-control-select"' + month_extra='class="form-control form-control-select"' + year_extra='class="form-control form-control-select"' + day_empty={l s='-- day --' d='Shop.Forms.Labels'} + month_empty={l s='-- month --' d='Shop.Forms.Labels'} + year_empty={l s='-- year --' d='Shop.Forms.Labels'} + start_year={'Y'|date}-100 end_year={'Y'|date} + } +
    + {/block} + + {elseif $field.type === 'password'} + + {block name='form_field_item_password'} +
    + + + + +
    + {/block} + + {else} + + {block name='form_field_item_other'} + + {if isset($field.availableValues.comment)} + + {$field.availableValues.comment} + + {/if} + {/block} + + {/if} + + {block name='form_field_errors'} + {include file='_partials/form-errors.tpl' errors=$field.errors} + {/block} + +
    + +
    + {block name='form_field_comment'} + {if (!$field.required && !in_array($field.type, ['radio-buttons', 'checkbox']))} + {l s='Optional' d='Shop.Forms.Labels'} + {/if} + {/block} +
    +
    + +{/if} diff --git a/templates/_partials/head.tpl b/templates/_partials/head.tpl new file mode 100644 index 0000000..ceb262a --- /dev/null +++ b/templates/_partials/head.tpl @@ -0,0 +1,70 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='head_charset'} + +{/block} +{block name='head_ie_compatibility'} + +{/block} + +{block name='head_seo'} + {block name='head_seo_title'}{$page.meta.title}{/block} + + + {if $page.meta.robots !== 'index'} + + {/if} + {if $page.canonical} + + {/if} + {block name='head_hreflang'} + {foreach from=$urls.alternative_langs item=pageUrl key=code} + + {/foreach} + {/block} +{/block} + +{block name='head_viewport'} + +{/block} + +{block name='head_icons'} + + +{/block} + +{block name='stylesheets'} + {include file="_partials/stylesheets.tpl" stylesheets=$stylesheets} +{/block} + +{block name='javascript_head'} + {include file="_partials/javascript.tpl" javascript=$javascript.head vars=$js_custom_vars} +{/block} + +{block name='hook_header'} + {$HOOK_HEADER nofilter} +{/block} + +{block name='hook_extra'}{/block} diff --git a/templates/_partials/header.tpl b/templates/_partials/header.tpl new file mode 100644 index 0000000..0b78a79 --- /dev/null +++ b/templates/_partials/header.tpl @@ -0,0 +1,41 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +{block name='header_top'} +
    +
    + + + +
    + {hook h='displayMainMenu'} +
    +
    + {hook h='displayTop'} +
    +
    +
    + {hook h='displayNavFullWidth'} +{/block} diff --git a/templates/_partials/javascript.tpl b/templates/_partials/javascript.tpl new file mode 100644 index 0000000..ce08144 --- /dev/null +++ b/templates/_partials/javascript.tpl @@ -0,0 +1,52 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + + +{foreach $javascript.external as $js} + +{/foreach} + +{foreach $javascript.inline as $js} + +{/foreach} + +{if isset($vars) && $vars|@count} + +{/if} diff --git a/templates/_partials/notifications.tpl b/templates/_partials/notifications.tpl new file mode 100644 index 0000000..10392bf --- /dev/null +++ b/templates/_partials/notifications.tpl @@ -0,0 +1,78 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +{if isset($notifications)} + +{/if} diff --git a/templates/_partials/pagination.tpl b/templates/_partials/pagination.tpl new file mode 100644 index 0000000..717115e --- /dev/null +++ b/templates/_partials/pagination.tpl @@ -0,0 +1,64 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + diff --git a/templates/_partials/stylesheets.tpl b/templates/_partials/stylesheets.tpl new file mode 100644 index 0000000..d8b838f --- /dev/null +++ b/templates/_partials/stylesheets.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + + + + +{foreach $stylesheets.external as $stylesheet} + +{/foreach} + +{foreach $stylesheets.inline as $stylesheet} + +{/foreach} diff --git a/templates/catalog/_partials/active_filters.tpl b/templates/catalog/_partials/active_filters.tpl new file mode 100644 index 0000000..40dd553 --- /dev/null +++ b/templates/catalog/_partials/active_filters.tpl @@ -0,0 +1,43 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {block name='active_filters_title'} +

    {l s='Active filters' d='Shop.Theme.Global'}

    + {/block} + + {if $activeFilters|count} +
      + {foreach from=$activeFilters item="filter"} + {block name='active_filters_item'} +
    • + {l s='%1$s: ' d='Shop.Theme.Catalog' sprintf=[$filter.facetLabel]} + {$filter.label} + +
      • + {/block} + {/foreach} +
    + {/if} +
    diff --git a/templates/catalog/_partials/category-header.tpl b/templates/catalog/_partials/category-header.tpl new file mode 100644 index 0000000..554b82c --- /dev/null +++ b/templates/catalog/_partials/category-header.tpl @@ -0,0 +1,41 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {if $listing.pagination.items_shown_from == 1} +
    +

    {$category.name}

    +
    + {if $category.description} +
    {$category.description nofilter}
    + {/if} + {if $category.image.large.url} +
    + {if !empty($category.image.legend)}{$category.image.legend}{else}{$category.name}{/if} +
    + {/if} +
    +
    + {/if} +
    diff --git a/templates/catalog/_partials/facets.tpl b/templates/catalog/_partials/facets.tpl new file mode 100644 index 0000000..eec820b --- /dev/null +++ b/templates/catalog/_partials/facets.tpl @@ -0,0 +1,168 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{if $facets|count} +
    + {block name='facets_title'} +

    {l s='Filter By' d='Shop.Theme.Actions'}

    + {/block} + + {block name='facets_clearall_button'} + {if $activeFilters|count} +
    + +
    + {/if} + {/block} + + {foreach from=$facets item="facet"} + {if !$facet.displayed} + {continue} + {/if} + +
    +

    {$facet.label}

    + {assign var=_expand_id value=10|mt_rand:100000} + {assign var=_collapse value=true} + {foreach from=$facet.filters item="filter"} + {if $filter.active}{assign var=_collapse value=false}{/if} + {/foreach} + +
    +

    {$facet.label}

    + + + + + + +
    + + {if $facet.widgetType !== 'dropdown'} + {block name='facet_item_other'} +
      + {foreach from=$facet.filters key=filter_key item="filter"} + {if !$filter.displayed} + {continue} + {/if} + +
    • + +
      • + {/foreach} +
    + {/block} + + {else} + + {block name='facet_item_dropdown'} + + {/block} + {/if} +
    + {/foreach} +
    +{/if} diff --git a/templates/catalog/_partials/miniatures/brand.tpl b/templates/catalog/_partials/miniatures/brand.tpl new file mode 100644 index 0000000..ff272fd --- /dev/null +++ b/templates/catalog/_partials/miniatures/brand.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='brand_miniature_item'} +
  • +
    {$brand.name}
    +
    +

    {$brand.name}

    + {$brand.text nofilter} +
    +
    + {$brand.nb_products} + {l s='View products' d='Shop.Theme.Actions'} +
    +
    • +{/block} diff --git a/templates/catalog/_partials/miniatures/category.tpl b/templates/catalog/_partials/miniatures/category.tpl new file mode 100644 index 0000000..e925ad0 --- /dev/null +++ b/templates/catalog/_partials/miniatures/category.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='category_miniature_item'} +
    + + {$category.image.legend} + + +

    + {$category.name} +

    + +
    {$category.description nofilter}
    +
    +{/block} diff --git a/templates/catalog/_partials/miniatures/pack-product.tpl b/templates/catalog/_partials/miniatures/pack-product.tpl new file mode 100644 index 0000000..854c47e --- /dev/null +++ b/templates/catalog/_partials/miniatures/pack-product.tpl @@ -0,0 +1,54 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='pack_miniature_item'} + +{/block} diff --git a/templates/catalog/_partials/miniatures/product.tpl b/templates/catalog/_partials/miniatures/product.tpl new file mode 100644 index 0000000..99b82ad --- /dev/null +++ b/templates/catalog/_partials/miniatures/product.tpl @@ -0,0 +1,92 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='product_miniature_item'} +
    +
    + {block name='product_thumbnail'} + {if $product.cover} + + {if !empty($product.cover.legend)}{$product.cover.legend}{else}{$product.name|truncate:30:'...'}{/if} + + {else} + + + + {/if} + {/block} + +
    + {block name='product_name'} +

    {$product.name|truncate:30:'...'}

    + {/block} + + {block name='product_price_and_shipping'} + {if $product.show_price} +
    + {if $product.has_discount} + {hook h='displayProductPriceBlock' product=$product type="old_price"} + + {$product.regular_price} + {if $product.discount_type === 'percentage'} + {$product.discount_percentage} + {elseif $product.discount_type === 'amount'} + {$product.discount_amount_to_display} + {/if} + {/if} + + {hook h='displayProductPriceBlock' product=$product type="before_price"} + + {$product.price} + + {hook h='displayProductPriceBlock' product=$product type='unit_price'} + + {hook h='displayProductPriceBlock' product=$product type='weight'} +
    + {/if} + {/block} + + {block name='product_reviews'} + {hook h='displayProductListReviews' product=$product} + {/block} +
    + + + +
    + + {block name='product_variants'} + {if $product.main_variants} + {include file='catalog/_partials/variant-links.tpl' variants=$product.main_variants} + {/if} + {/block} +
    +
    +
    +{/block} diff --git a/templates/catalog/_partials/product-activation.tpl b/templates/catalog/_partials/product-activation.tpl new file mode 100644 index 0000000..0732958 --- /dev/null +++ b/templates/catalog/_partials/product-activation.tpl @@ -0,0 +1,38 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{if $page.admin_notifications} + +{/if} diff --git a/templates/catalog/_partials/product-add-to-cart.tpl b/templates/catalog/_partials/product-add-to-cart.tpl new file mode 100644 index 0000000..279e700 --- /dev/null +++ b/templates/catalog/_partials/product-add-to-cart.tpl @@ -0,0 +1,88 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {if !$configuration.is_catalog} + {l s='Quantity' d='Shop.Theme.Catalog'} + + {block name='product_quantity'} +
    +
    + +
    + +
    + +
    + + {hook h='displayProductActions' product=$product} +
    + {/block} + + {block name='product_availability'} + + {if $product.show_availability && $product.availability_message} + {if $product.availability == 'available'} + + {elseif $product.availability == 'last_remaining_items'} + + {else} + + {/if} + {$product.availability_message} + {/if} + + {/block} + + {block name='product_minimal_quantity'} +

    + {if $product.minimal_quantity > 1} + {l + s='The minimum purchase order quantity for the product is %quantity%.' + d='Shop.Theme.Checkout' + sprintf=['%quantity%' => $product.minimal_quantity] + } + {/if} +

    + {/block} + {/if} +
    diff --git a/templates/catalog/_partials/product-additional-info.tpl b/templates/catalog/_partials/product-additional-info.tpl new file mode 100644 index 0000000..f4fd6b5 --- /dev/null +++ b/templates/catalog/_partials/product-additional-info.tpl @@ -0,0 +1,27 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {hook h='displayProductAdditionalInfo' product=$product} +
    diff --git a/templates/catalog/_partials/product-cover-thumbnails.tpl b/templates/catalog/_partials/product-cover-thumbnails.tpl new file mode 100644 index 0000000..b6553cd --- /dev/null +++ b/templates/catalog/_partials/product-cover-thumbnails.tpl @@ -0,0 +1,60 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {block name='product_cover'} +
    + {if $product.cover} + {$product.cover.legend} +
    + +
    + {else} + + {/if} +
    + {/block} + + {block name='product_images'} +
    +
      + {foreach from=$product.images item=image} +
    • + {$image.legend} +
      • + {/foreach} +
    +
    + {/block} +
    +{hook h='displayAfterProductThumbs'} diff --git a/templates/catalog/_partials/product-customization.tpl b/templates/catalog/_partials/product-customization.tpl new file mode 100644 index 0000000..efda2b5 --- /dev/null +++ b/templates/catalog/_partials/product-customization.tpl @@ -0,0 +1,69 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {if !$configuration.is_catalog} +
    +

    {l s='Product customization' d='Shop.Theme.Catalog'}

    + {l s='Don\'t forget to save your customization to be able to add to cart' d='Shop.Forms.Help'} + + {block name='product_customization_form'} +
    +
      + {foreach from=$customizations.fields item="field"} +
    • + + {if $field.type == 'text'} + + {l s='250 char. max' d='Shop.Forms.Help'} + {if $field.text !== ''} +
      {l s='Your customization:' d='Shop.Theme.Catalog'} + +
      + {/if} + {elseif $field.type == 'image'} + {if $field.is_customized} +
      + + {l s='Remove Image' d='Shop.Theme.Actions'} + {/if} + + {l s='No selected file' d='Shop.Forms.Help'} + + + + {l s='.png .jpg .gif' d='Shop.Forms.Help'} + {/if} +
      • + {/foreach} +
    +
    + +
    +
    + {/block} + +
    + {/if} +
    diff --git a/templates/catalog/_partials/product-details.tpl b/templates/catalog/_partials/product-details.tpl new file mode 100644 index 0000000..0e5b62d --- /dev/null +++ b/templates/catalog/_partials/product-details.tpl @@ -0,0 +1,91 @@ +
    + {block name='product_reference'} + {if isset($product_manufacturer->id)} +
    + {if isset($manufacturer_image_url)} + + + + {else} + + + {$product_manufacturer->name} + + {/if} +
    + {/if} + {if isset($product.reference_to_display) && $product.reference_to_display neq ''} +
    + + {$product.reference_to_display} +
    + {/if} + {/block} + + {block name='product_quantities'} + {if $product.show_quantities} +
    + + {$product.quantity} {$product.quantity_label} +
    + {/if} + {/block} + + {block name='product_availability_date'} + {if $product.availability_date} +
    + + {$product.availability_date} +
    + {/if} + {/block} + + {block name='product_out_of_stock'} +
    + {hook h='actionProductOutOfStock' product=$product} +
    + {/block} + + {block name='product_features'} + {if $product.grouped_features} +
    +

    {l s='Data sheet' d='Shop.Theme.Catalog'}

    +
    + {foreach from=$product.grouped_features item=feature} +
    {$feature.name}
    +
    {$feature.value|escape:'htmlall'|nl2br nofilter}
    + {/foreach} +
    +
    + {/if} + {/block} + + {* if product have specific references, a table will be added to product details section *} + {block name='product_specific_references'} + {if !empty($product.specific_references)} +
    +

    {l s='Specific References' d='Shop.Theme.Catalog'}

    +
    + {foreach from=$product.specific_references item=reference key=key} +
    {$key}
    +
    {$reference}
    + {/foreach} +
    +
    + {/if} + {/block} + + {block name='product_condition'} + {if $product.condition} +
    + + + {$product.condition.label} +
    + {/if} + {/block} +
    diff --git a/templates/catalog/_partials/product-discounts.tpl b/templates/catalog/_partials/product-discounts.tpl new file mode 100644 index 0000000..4e5153e --- /dev/null +++ b/templates/catalog/_partials/product-discounts.tpl @@ -0,0 +1,49 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {if $product.quantity_discounts} +

    {l s='Volume discounts' d='Shop.Theme.Catalog'}

    + {block name='product_discount_table'} + + + + + + + + + + {foreach from=$product.quantity_discounts item='quantity_discount' name='quantity_discounts'} + + + + + + {/foreach} + +
    {l s='Quantity' d='Shop.Theme.Catalog'}{$configuration.quantity_discount.label}{l s='You Save' d='Shop.Theme.Catalog'}
    {$quantity_discount.quantity}{$quantity_discount.discount}{l s='Up to %discount%' d='Shop.Theme.Catalog' sprintf=['%discount%' => $quantity_discount.save]}
    + {/block} + {/if} +
    diff --git a/templates/catalog/_partials/product-flags.tpl b/templates/catalog/_partials/product-flags.tpl new file mode 100644 index 0000000..2f5b14c --- /dev/null +++ b/templates/catalog/_partials/product-flags.tpl @@ -0,0 +1,31 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='product_flags'} +
      + {foreach from=$product.flags item=flag} +
    • {$flag.label}
      • + {/foreach} +
    +{/block} diff --git a/templates/catalog/_partials/product-images-modal.tpl b/templates/catalog/_partials/product-images-modal.tpl new file mode 100644 index 0000000..2500cc7 --- /dev/null +++ b/templates/catalog/_partials/product-images-modal.tpl @@ -0,0 +1,60 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + diff --git a/templates/catalog/_partials/product-prices.tpl b/templates/catalog/_partials/product-prices.tpl new file mode 100644 index 0000000..7b6c0b5 --- /dev/null +++ b/templates/catalog/_partials/product-prices.tpl @@ -0,0 +1,114 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{if $product.show_price} +
    + {block name='product_discount'} + {if $product.has_discount} +
    + {hook h='displayProductPriceBlock' product=$product type="old_price"} + {$product.regular_price} +
    + {/if} + {/block} + + {block name='product_price'} +
    + + + +
    + {$product.price} + + {if $product.has_discount} + {if $product.discount_type === 'percentage'} + {l s='Save %percentage%' d='Shop.Theme.Catalog' sprintf=['%percentage%' => $product.discount_percentage_absolute]} + {else} + + {l s='Save %amount%' d='Shop.Theme.Catalog' sprintf=['%amount%' => $product.discount_to_display]} + + {/if} + {/if} +
    + + {block name='product_unit_price'} + {if $displayUnitPrice} +

    {l s='(%unit_price%)' d='Shop.Theme.Catalog' sprintf=['%unit_price%' => $product.unit_price_full]}

    + {/if} + {/block} +
    + {/block} + + {block name='product_without_taxes'} + {if $priceDisplay == 2} +

    {l s='%price% tax excl.' d='Shop.Theme.Catalog' sprintf=['%price%' => $product.price_tax_exc]}

    + {/if} + {/block} + + {block name='product_pack_price'} + {if $displayPackPrice} +

    {l s='Instead of %price%' d='Shop.Theme.Catalog' sprintf=['%price%' => $noPackPrice]}

    + {/if} + {/block} + + {block name='product_ecotax'} + {if $product.ecotax.amount > 0} +

    {l s='Including %amount% for ecotax' d='Shop.Theme.Catalog' sprintf=['%amount%' => $product.ecotax.value]} + {if $product.has_discount} + {l s='(not impacted by the discount)' d='Shop.Theme.Catalog'} + {/if} +

    + {/if} + {/block} + + {hook h='displayProductPriceBlock' product=$product type="weight" hook_origin='product_sheet'} + +
    + {if !$configuration.taxes_enabled} + {l s='No tax' d='Shop.Theme.Catalog'} + {elseif $configuration.display_taxes_label} + {$product.labels.tax_long} + {/if} + {hook h='displayProductPriceBlock' product=$product type="price"} + {hook h='displayProductPriceBlock' product=$product type="after_price"} + {if $product.additional_delivery_times == 1} + {if $product.delivery_information} + {$product.delivery_information} + {/if} + {elseif $product.additional_delivery_times == 2} + {if $product.quantity > 0} + {$product.delivery_in_stock} + {* Out of stock message should not be displayed if customer can't order the product. *} + {elseif $product.quantity <= 0 && $product.add_to_cart_url} + {$product.delivery_out_stock} + {/if} + {/if} +
    +
    +{/if} diff --git a/templates/catalog/_partials/product-variants.tpl b/templates/catalog/_partials/product-variants.tpl new file mode 100644 index 0000000..fd0bdad --- /dev/null +++ b/templates/catalog/_partials/product-variants.tpl @@ -0,0 +1,69 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {foreach from=$groups key=id_attribute_group item=group} + {if !empty($group.attributes)} +
    + {$group.name} + {if $group.group_type == 'select'} + + {elseif $group.group_type == 'color'} +
      + {foreach from=$group.attributes key=id_attribute item=group_attribute} +
    • + +
      • + {/foreach} +
    + {elseif $group.group_type == 'radio'} +
      + {foreach from=$group.attributes key=id_attribute item=group_attribute} +
    • + +
      • + {/foreach} +
    + {/if} +
    + {/if} + {/foreach} +
    diff --git a/templates/catalog/_partials/products-bottom.tpl b/templates/catalog/_partials/products-bottom.tpl new file mode 100644 index 0000000..9188f7f --- /dev/null +++ b/templates/catalog/_partials/products-bottom.tpl @@ -0,0 +1,6 @@ +{* + * Classic theme doesn't use this subtemplate, feel free to do whatever you need here. + * This template is generated at each ajax calls. + * See ProductListingFrontController::getAjaxProductSearchVariables() + *} +
    diff --git a/templates/catalog/_partials/products-top.tpl b/templates/catalog/_partials/products-top.tpl new file mode 100644 index 0000000..6ef7067 --- /dev/null +++ b/templates/catalog/_partials/products-top.tpl @@ -0,0 +1,56 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +
    + {if $listing.pagination.total_items > 1} +

    {l s='There are %product_count% products.' d='Shop.Theme.Catalog' sprintf=['%product_count%' => $listing.pagination.total_items]}

    + {elseif $listing.pagination.total_items > 0} +

    {l s='There is 1 product.' d='Shop.Theme.Catalog'}

    + {/if} +
    +
    +
    + + {block name='sort_by'} + {include file='catalog/_partials/sort-orders.tpl' sort_orders=$listing.sort_orders} + {/block} + + {if !empty($listing.rendered_facets)} +
    + +
    + {/if} +
    +
    +
    + {l s='Showing %from%-%to% of %total% item(s)' d='Shop.Theme.Catalog' sprintf=[ + '%from%' => $listing.pagination.items_shown_from , + '%to%' => $listing.pagination.items_shown_to, + '%total%' => $listing.pagination.total_items + ]} +
    +
    diff --git a/templates/catalog/_partials/products.tpl b/templates/catalog/_partials/products.tpl new file mode 100644 index 0000000..6089cf7 --- /dev/null +++ b/templates/catalog/_partials/products.tpl @@ -0,0 +1,44 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +
    + {foreach from=$listing.products item="product"} + {block name='product_miniature'} + {include file='catalog/_partials/miniatures/product.tpl' product=$product} + {/block} + {/foreach} +
    + + {block name='pagination'} + {include file='_partials/pagination.tpl' pagination=$listing.pagination} + {/block} + +
    + + {l s='Back to top' d='Shop.Theme.Actions'} + + +
    +
    diff --git a/templates/catalog/_partials/quickview.tpl b/templates/catalog/_partials/quickview.tpl new file mode 100644 index 0000000..43fbb8e --- /dev/null +++ b/templates/catalog/_partials/quickview.tpl @@ -0,0 +1,79 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + diff --git a/templates/catalog/_partials/sort-orders.tpl b/templates/catalog/_partials/sort-orders.tpl new file mode 100644 index 0000000..b9c40e8 --- /dev/null +++ b/templates/catalog/_partials/sort-orders.tpl @@ -0,0 +1,47 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{l s='Sort by:' d='Shop.Theme.Global'} +
    + +
    + {foreach from=$listing.sort_orders item=sort_order} + + {$sort_order.label} + + {/foreach} +
    +
    diff --git a/templates/catalog/_partials/variant-links.tpl b/templates/catalog/_partials/variant-links.tpl new file mode 100644 index 0000000..54f5263 --- /dev/null +++ b/templates/catalog/_partials/variant-links.tpl @@ -0,0 +1,16 @@ +
    + {foreach from=$variants item=variant} + {$variant.name} + {/foreach} + +
    diff --git a/templates/catalog/brands.tpl b/templates/catalog/brands.tpl new file mode 100644 index 0000000..6278334 --- /dev/null +++ b/templates/catalog/brands.tpl @@ -0,0 +1,44 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file=$layout} + +{block name='content'} +
    + + {block name='brand_header'} +

    {l s='Brands' d='Shop.Theme.Catalog'}

    + {/block} + + {block name='brand_miniature'} +
      + {foreach from=$brands item=brand} + {include file='catalog/_partials/miniatures/brand.tpl' brand=$brand} + {/foreach} +
    + {/block} + +
    + +{/block} diff --git a/templates/catalog/listing/best-sales.tpl b/templates/catalog/listing/best-sales.tpl new file mode 100644 index 0000000..3b34af8 --- /dev/null +++ b/templates/catalog/listing/best-sales.tpl @@ -0,0 +1,5 @@ +{* + * This file allows you to customize your best-sales page. + * You can safely remove it if you want it to appear exactly like all other product listing pages + *} +{extends file='catalog/listing/product-list.tpl'} diff --git a/templates/catalog/listing/category.tpl b/templates/catalog/listing/category.tpl new file mode 100644 index 0000000..37eb25b --- /dev/null +++ b/templates/catalog/listing/category.tpl @@ -0,0 +1,29 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='catalog/listing/product-list.tpl'} + +{block name='product_list_header'} + {include file='catalog/_partials/category-header.tpl' listing=$listing category=$category} +{/block} diff --git a/templates/catalog/listing/manufacturer.tpl b/templates/catalog/listing/manufacturer.tpl new file mode 100644 index 0000000..acfa00c --- /dev/null +++ b/templates/catalog/listing/manufacturer.tpl @@ -0,0 +1,31 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='catalog/listing/product-list.tpl'} + +{block name='product_list_header'} +

    {l s='List of products by brand %brand_name%' sprintf=['%brand_name%' => $manufacturer.name] d='Shop.Theme.Catalog'}

    +
    {$manufacturer.short_description nofilter}
    +
    {$manufacturer.description nofilter}
    +{/block} diff --git a/templates/catalog/listing/new-products.tpl b/templates/catalog/listing/new-products.tpl new file mode 100644 index 0000000..b42d05c --- /dev/null +++ b/templates/catalog/listing/new-products.tpl @@ -0,0 +1,5 @@ +{* + * This file allows you to customize your new-product page. + * You can safely remove it if you want it to appear exactly like all other product listing pages + *} +{extends file='catalog/listing/product-list.tpl'} diff --git a/templates/catalog/listing/prices-drop.tpl b/templates/catalog/listing/prices-drop.tpl new file mode 100644 index 0000000..2163940 --- /dev/null +++ b/templates/catalog/listing/prices-drop.tpl @@ -0,0 +1,5 @@ +{* + * This file allows you to customize your price-drop page. + * You can safely remove it if you want it to appear exactly like all other product listing pages + *} +{extends file='catalog/listing/product-list.tpl'} diff --git a/templates/catalog/listing/product-list.tpl b/templates/catalog/listing/product-list.tpl new file mode 100644 index 0000000..4ebfbf6 --- /dev/null +++ b/templates/catalog/listing/product-list.tpl @@ -0,0 +1,73 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file=$layout} + +{block name='content'} +
    + + {block name='product_list_header'} +

    {$listing.label}

    + {/block} + +
    + {if $listing.products|count} + +
    + {block name='product_list_top'} + {include file='catalog/_partials/products-top.tpl' listing=$listing} + {/block} +
    + + {block name='product_list_active_filters'} +
    + {$listing.rendered_active_filters nofilter} +
    + {/block} + +
    + {block name='product_list'} + {include file='catalog/_partials/products.tpl' listing=$listing} + {/block} +
    + +
    + {block name='product_list_bottom'} + {include file='catalog/_partials/products-bottom.tpl' listing=$listing} + {/block} +
    + + {else} +
    + +
    + {include file='errors/not-found.tpl'} +
    + +
    + {/if} +
    + +
    +{/block} diff --git a/templates/catalog/listing/search.tpl b/templates/catalog/listing/search.tpl new file mode 100644 index 0000000..d745e42 --- /dev/null +++ b/templates/catalog/listing/search.tpl @@ -0,0 +1,5 @@ +{* + * This file allows you to customize your search page. + * You can safely remove it if you want it to appear exactly like all other product listing pages + *} +{extends file='catalog/listing/product-list.tpl'} diff --git a/templates/catalog/listing/supplier.tpl b/templates/catalog/listing/supplier.tpl new file mode 100644 index 0000000..ec63ada --- /dev/null +++ b/templates/catalog/listing/supplier.tpl @@ -0,0 +1,30 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='catalog/listing/product-list.tpl'} + +{block name='product_list_header'} +

    {l s='List of products by supplier %s' sprintf=[$supplier.name] d='Shop.Theme.Catalog'}

    +
    {$supplier.description nofilter}
    +{/block} diff --git a/templates/catalog/manufacturers.tpl b/templates/catalog/manufacturers.tpl new file mode 100644 index 0000000..c85bab0 --- /dev/null +++ b/templates/catalog/manufacturers.tpl @@ -0,0 +1,25 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='catalog/brands.tpl'} diff --git a/templates/catalog/product.tpl b/templates/catalog/product.tpl new file mode 100644 index 0000000..7d374a4 --- /dev/null +++ b/templates/catalog/product.tpl @@ -0,0 +1,268 @@ +{** + * 2007-2020 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2020 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file=$layout} + +{block name='head_seo' prepend} + +{/block} + +{block name='head' append} + + + + + + + {if $product.show_price} + + + + + {/if} + {if isset($product.weight) && ($product.weight != 0)} + + + {/if} +{/block} + +{block name='content'} + +
    + + +
    +
    + {block name='page_content_container'} +
    + {block name='page_content'} + + {block name='product_flags'} +
      + {foreach from=$product.flags item=flag} +
    • {$flag.label}
      • + {/foreach} +
    + {/block} + + {block name='product_cover_thumbnails'} + {include file='catalog/_partials/product-cover-thumbnails.tpl'} + {/block} +
    + + +
    + + {/block} +
    + {/block} +
    +
    + {block name='page_header_container'} + {block name='page_header'} +

    {block name='page_title'}{$product.name}{/block}

    + {/block} + {/block} + {block name='product_prices'} + {include file='catalog/_partials/product-prices.tpl'} + {/block} + +
    + {block name='product_description_short'} +
    {$product.description_short nofilter}
    + {/block} + + {if $product.is_customizable && count($product.customizations.fields)} + {block name='product_customization'} + {include file="catalog/_partials/product-customization.tpl" customizations=$product.customizations} + {/block} + {/if} + +
    + {block name='product_buy'} +
    + + + + + {block name='product_variants'} + {include file='catalog/_partials/product-variants.tpl'} + {/block} + + {block name='product_pack'} + {if $packItems} +
    +

    {l s='This pack contains' d='Shop.Theme.Catalog'}

    + {foreach from=$packItems item="product_pack"} + {block name='product_miniature'} + {include file='catalog/_partials/miniatures/pack-product.tpl' product=$product_pack} + {/block} + {/foreach} +
    + {/if} + {/block} + + {block name='product_discounts'} + {include file='catalog/_partials/product-discounts.tpl'} + {/block} + + {block name='product_add_to_cart'} + {include file='catalog/_partials/product-add-to-cart.tpl'} + {/block} + + {block name='product_additional_info'} + {include file='catalog/_partials/product-additional-info.tpl'} + {/block} + + {* Input to refresh product HTML removed, block kept for compatibility with themes *} + {block name='product_refresh'}{/block} +
    + {/block} + +
    + + {block name='hook_display_reassurance'} + {hook h='displayReassurance'} + {/block} + + {block name='product_tabs'} +
    + + +
    +
    + {block name='product_description'} +
    {$product.description nofilter}
    + {/block} +
    + + {block name='product_details'} + {include file='catalog/_partials/product-details.tpl'} + {/block} + + {block name='product_attachments'} + {if $product.attachments} +
    +
    +

    {l s='Download' d='Shop.Theme.Actions'}

    + {foreach from=$product.attachments item=attachment} +
    +

    {$attachment.name}

    +

    {$attachment.description}

    + {l s='Download' d='Shop.Theme.Actions'} ({$attachment.file_size_formatted}) + +
    + {/foreach} +
    +
    + {/if} + {/block} + + {foreach from=$product.extraContent item=extra key=extraKey} +
    $val} {$key}="{$val}"{/foreach}> + {$extra.content nofilter} +
    + {/foreach} +
    +
    + {/block} +
    +
    +
    + + {block name='product_accessories'} + {if $accessories} +
    +

    {l s='You might also like' d='Shop.Theme.Catalog'}

    +
    + {foreach from=$accessories item="product_accessory"} + {block name='product_miniature'} + {include file='catalog/_partials/miniatures/product.tpl' product=$product_accessory} + {/block} + {/foreach} +
    +
    + {/if} + {/block} + + {block name='product_footer'} + {hook h='displayFooterProduct' product=$product category=$category} + {/block} + + {block name='product_images_modal'} + {include file='catalog/_partials/product-images-modal.tpl'} + {/block} + + {block name='page_footer_container'} +
    + {block name='page_footer'} + + {/block} +
    + {/block} +
    + +{/block} diff --git a/templates/catalog/suppliers.tpl b/templates/catalog/suppliers.tpl new file mode 100644 index 0000000..84992fc --- /dev/null +++ b/templates/catalog/suppliers.tpl @@ -0,0 +1,29 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='catalog/brands.tpl'} + +{block name='brand_header'} +

    {l s='Suppliers' d='Shop.Theme.Catalog'}

    +{/block} diff --git a/templates/checkout/_partials/address-form.tpl b/templates/checkout/_partials/address-form.tpl new file mode 100644 index 0000000..435d5f4 --- /dev/null +++ b/templates/checkout/_partials/address-form.tpl @@ -0,0 +1,46 @@ +{extends file='customer/_partials/address-form.tpl'} + +{block name='form_field'} + {if $field.name eq "alias"} + {* we don't ask for alias here *} + {else} + {$smarty.block.parent} + {/if} +{/block} + +{block name="address_form_url"} +
    +{/block} + +{block name='form_fields' append} + + {if $type === "delivery"} +
    +
    + + +
    +
    + {/if} +{/block} + +{block name='form_buttons'} + {if !$form_has_continue_button} + + {l s='Cancel' d='Shop.Theme.Actions'} + {else} + + + {if $customer.addresses|count > 0} + {l s='Cancel' d='Shop.Theme.Actions'} + {/if} +
    + {/if} +{/block} diff --git a/templates/checkout/_partials/address-selector-block.tpl b/templates/checkout/_partials/address-selector-block.tpl new file mode 100644 index 0000000..d46347e --- /dev/null +++ b/templates/checkout/_partials/address-selector-block.tpl @@ -0,0 +1,72 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='address_selector_blocks'} + {foreach $addresses as $address} + + {/foreach} + {if $interactive} +

    + +

    + {/if} +{/block} diff --git a/templates/checkout/_partials/cart-detailed-actions.tpl b/templates/checkout/_partials/cart-detailed-actions.tpl new file mode 100644 index 0000000..130410c --- /dev/null +++ b/templates/checkout/_partials/cart-detailed-actions.tpl @@ -0,0 +1,45 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='cart_detailed_actions'} +
    + {if $cart.minimalPurchaseRequired} + +
    + +
    + {elseif empty($cart.products) } +
    + +
    + {else} +
    + {l s='Proceed to checkout' d='Shop.Theme.Actions'} + {hook h='displayExpressCheckout'} +
    + {/if} +
    +{/block} diff --git a/templates/checkout/_partials/cart-detailed-product-line.tpl b/templates/checkout/_partials/cart-detailed-product-line.tpl new file mode 100644 index 0000000..2761364 --- /dev/null +++ b/templates/checkout/_partials/cart-detailed-product-line.tpl @@ -0,0 +1,175 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + +
    + + {$product.name|escape:'quotes'} + +
    + + +
    +
    + {$product.name} +
    + +
    + {if $product.has_discount} +
    + {$product.regular_price} + {if $product.discount_type === 'percentage'} + + -{$product.discount_percentage_absolute} + + {else} + + -{$product.discount_to_display} + + {/if} +
    + {/if} +
    + {$product.price} + {if $product.unit_price_full} +
    {$product.unit_price_full}
    + {/if} +
    +
    + +
    + + {foreach from=$product.attributes key="attribute" item="value"} +
    + {$attribute}: + {$value} +
    + {/foreach} + + {if is_array($product.customizations) && $product.customizations|count} +
    + {block name='cart_detailed_product_line_customization'} + {foreach from=$product.customizations item="customization"} + {l s='Product customization' d='Shop.Theme.Catalog'} + + {/foreach} + {/block} + {/if} +
    + + +
    +
    +
    +
    +
    +
    + {if isset($product.is_gift) && $product.is_gift} + {$product.quantity} + {else} + + {/if} +
    +
    + + + {if isset($product.is_gift) && $product.is_gift} + {l s='Gift' d='Shop.Theme.Checkout'} + {else} + {$product.total} + {/if} + + +
    +
    +
    +
    +
    + + {if !isset($product.is_gift) || !$product.is_gift} + delete + {/if} + + + {block name='hook_cart_extra_product_actions'} + {hook h='displayCartExtraProductActions' product=$product} + {/block} + +
    +
    +
    +
    + +
    +
    diff --git a/templates/checkout/_partials/cart-detailed-totals.tpl b/templates/checkout/_partials/cart-detailed-totals.tpl new file mode 100644 index 0000000..b15aaae --- /dev/null +++ b/templates/checkout/_partials/cart-detailed-totals.tpl @@ -0,0 +1,58 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='cart_detailed_totals'} +
    + +
    + {foreach from=$cart.subtotals item="subtotal"} + {if $subtotal.value && $subtotal.type !== 'tax'} +
    + + {if 'products' == $subtotal.type} + {$cart.summary_string} + {else} + {$subtotal.label} + {/if} + + + {if 'discount' == $subtotal.type}- {/if}{$subtotal.value} + + {if $subtotal.type === 'shipping'} +
    {hook h='displayCheckoutSubtotalDetails' subtotal=$subtotal}
    + {/if} +
    + {/if} + {/foreach} +
    + + {block name='cart_summary_totals'} + {include file='checkout/_partials/cart-summary-totals.tpl' cart=$cart} + {/block} + + {block name='cart_voucher'} + {include file='checkout/_partials/cart-voucher.tpl'} + {/block} +
    +{/block} diff --git a/templates/checkout/_partials/cart-detailed.tpl b/templates/checkout/_partials/cart-detailed.tpl new file mode 100644 index 0000000..f04ca4b --- /dev/null +++ b/templates/checkout/_partials/cart-detailed.tpl @@ -0,0 +1,42 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='cart_detailed_product'} +
    + {if $cart.products} +
      + {foreach from=$cart.products item=product} +
    • + {block name='cart_detailed_product_line'} + {include file='checkout/_partials/cart-detailed-product-line.tpl' product=$product} + {/block} +
      • + {if is_array($product.customizations) && $product.customizations|count >1}
      {/if} + {/foreach} +
    + {else} + {l s='There are no more items in your cart' d='Shop.Theme.Checkout'} + {/if} +
    +{/block} diff --git a/templates/checkout/_partials/cart-summary-items-subtotal.tpl b/templates/checkout/_partials/cart-summary-items-subtotal.tpl new file mode 100644 index 0000000..4f3d99d --- /dev/null +++ b/templates/checkout/_partials/cart-summary-items-subtotal.tpl @@ -0,0 +1,30 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='cart_summary_items_subtotal'} +
    + {$cart.summary_string} + {$cart.subtotals.products.amount} +
    +{/block} diff --git a/templates/checkout/_partials/cart-summary-product-line.tpl b/templates/checkout/_partials/cart-summary-product-line.tpl new file mode 100644 index 0000000..bea5fa0 --- /dev/null +++ b/templates/checkout/_partials/cart-summary-product-line.tpl @@ -0,0 +1,44 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='cart_summary_product_line'} +
    + + {$product.name} + +
    +
    + {$product.name} + x{$product.quantity} + {$product.price} + {hook h='displayProductPriceBlock' product=$product type="unit_price"} + {foreach from=$product.attributes key="attribute" item="value"} +
    + {$attribute}: + {$value} +
    + {/foreach} +
    +
    +{/block} diff --git a/templates/checkout/_partials/cart-summary-subtotals.tpl b/templates/checkout/_partials/cart-summary-subtotals.tpl new file mode 100644 index 0000000..f1fab19 --- /dev/null +++ b/templates/checkout/_partials/cart-summary-subtotals.tpl @@ -0,0 +1,44 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + +
    + + {foreach from=$cart.subtotals item="subtotal"} + {if $subtotal.value && $subtotal.type !== 'tax'} +
    + + + {$subtotal.label} + + + + {$subtotal.value} + +
    + {/if} + {/foreach} + +
    + diff --git a/templates/checkout/_partials/cart-summary-totals.tpl b/templates/checkout/_partials/cart-summary-totals.tpl new file mode 100644 index 0000000..903817c --- /dev/null +++ b/templates/checkout/_partials/cart-summary-totals.tpl @@ -0,0 +1,54 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + + {block name='cart_summary_total'} + {if !$configuration.display_prices_tax_incl && $configuration.taxes_enabled} +
    + {$cart.totals.total.label} {$cart.labels.tax_short} + {$cart.totals.total.value} +
    +
    + {$cart.totals.total_including_tax.label} + {$cart.totals.total_including_tax.value} +
    + {else} +
    + {$cart.totals.total.label} {if $configuration.taxes_enabled}{$cart.labels.tax_short}{/if} + {$cart.totals.total.value} +
    + {/if} + {/block} + + {block name='cart_summary_tax'} + {if $cart.subtotals.tax} +
    + {l s='%label%:' sprintf=['%label%' => $cart.subtotals.tax.label] d='Shop.Theme.Global'} + {$cart.subtotals.tax.value} +
    + {/if} + {/block} + +
    diff --git a/templates/checkout/_partials/cart-summary.tpl b/templates/checkout/_partials/cart-summary.tpl new file mode 100644 index 0000000..6c07ff6 --- /dev/null +++ b/templates/checkout/_partials/cart-summary.tpl @@ -0,0 +1,69 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +
    + {block name='hook_checkout_summary_top'} + {hook h='displayCheckoutSummaryTop'} + {/block} + + {block name='cart_summary_products'} +
    + +

    {$cart.summary_string}

    + +

    + + {l s='show details' d='Shop.Theme.Actions'} + expand_more + +

    + + {block name='cart_summary_product_list'} +
    +
      + {foreach from=$cart.products item=product} +
    • {include file='checkout/_partials/cart-summary-product-line.tpl' product=$product}
      • + {/foreach} +
    +
    + {/block} +
    + {/block} + + {block name='cart_summary_subtotals'} + {include file='checkout/_partials/cart-summary-subtotals.tpl' cart=$cart} + {/block} + +
    + + {block name='cart_summary_totals'} + {include file='checkout/_partials/cart-summary-totals.tpl' cart=$cart} + {/block} + + {block name='cart_summary_voucher'} + {include file='checkout/_partials/cart-voucher.tpl'} + {/block} + +
    diff --git a/templates/checkout/_partials/cart-voucher.tpl b/templates/checkout/_partials/cart-voucher.tpl new file mode 100644 index 0000000..f1f95ad --- /dev/null +++ b/templates/checkout/_partials/cart-voucher.tpl @@ -0,0 +1,91 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{if $cart.vouchers.allowed} + {block name='cart_voucher'} +
    +
    + {if $cart.vouchers.added} + {block name='cart_voucher_list'} +
      + {foreach from=$cart.vouchers.added item=voucher} +
    • + {$voucher.name} +
      + {$voucher.reduction_formatted} + +
      +
      • + {/foreach} +
    + {/block} + {/if} + +

    + + {l s='Have a promo code?' d='Shop.Theme.Checkout'} + +

    + +
    +
    + {block name='cart_voucher_form'} +
    + + + + +
    + {/block} + + {block name='cart_voucher_notifications'} + + {/block} + + + {l s='Close' d='Shop.Theme.Checkout'} + +
    +
    + + {if $cart.discounts|count > 0} +

    + {l s='Take advantage of our exclusive offers:' d='Shop.Theme.Actions'} +

    +
      + {foreach from=$cart.discounts item=discount} +
    • + + {$discount.code} - {$discount.name} + +
      • + {/foreach} +
    + {/if} +
    +
    + {/block} +{/if} diff --git a/templates/checkout/_partials/customer-form.tpl b/templates/checkout/_partials/customer-form.tpl new file mode 100644 index 0000000..cbd7b4f --- /dev/null +++ b/templates/checkout/_partials/customer-form.tpl @@ -0,0 +1,50 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends "customer/_partials/customer-form.tpl"} + +{block "form_field"} + {if $field.name === 'password' and $guest_allowed} +

    + {l s='Create an account' d='Shop.Theme.Checkout'} {l s='(optional)' d='Shop.Theme.Checkout'} +
    + {l s='And save time on your next order!' d='Shop.Theme.Checkout'} +

    + {$smarty.block.parent} + {else} + {$smarty.block.parent} + {/if} +{/block} + +{block "form_buttons"} + +{/block} diff --git a/templates/checkout/_partials/footer.tpl b/templates/checkout/_partials/footer.tpl new file mode 100644 index 0000000..853c4d1 --- /dev/null +++ b/templates/checkout/_partials/footer.tpl @@ -0,0 +1,29 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='footer'} +
    + {l s='%copyright% %year% - Ecommerce software by %prestashop%' sprintf=['%prestashop%' => 'PrestaShop™', '%year%' => 'Y'|date, '%copyright%' => '©'] d='Shop.Theme.Global'} +
    +{/block} diff --git a/templates/checkout/_partials/header.tpl b/templates/checkout/_partials/header.tpl new file mode 100644 index 0000000..54df9a1 --- /dev/null +++ b/templates/checkout/_partials/header.tpl @@ -0,0 +1,76 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='header'} + {block name='header_nav'} + + {/block} + + {block name='header_top'} +
    +
    +
    +
    +
    + {hook h='displayTop'} +
    +
    +
    +
    + +
    +
    + {hook h='displayNavFullWidth'} + {/block} +{/block} diff --git a/templates/checkout/_partials/login-form.tpl b/templates/checkout/_partials/login-form.tpl new file mode 100644 index 0000000..45b49d6 --- /dev/null +++ b/templates/checkout/_partials/login-form.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/_partials/login-form.tpl'} + +{block name='form_buttons'} + +{/block} diff --git a/templates/checkout/_partials/order-confirmation-table.tpl b/templates/checkout/_partials/order-confirmation-table.tpl new file mode 100644 index 0000000..8708cea --- /dev/null +++ b/templates/checkout/_partials/order-confirmation-table.tpl @@ -0,0 +1,136 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +
    + {block name='order_items_table_head'} +

    {l s='Order items' d='Shop.Theme.Checkout'}

    +

    {l s='Unit price' d='Shop.Theme.Checkout'}

    +

    {l s='Quantity' d='Shop.Theme.Checkout'}

    +

    {l s='Total products' d='Shop.Theme.Checkout'}

    + {/block} +
    + +
    + + {block name='order_confirmation_table'} + {foreach from=$products item=product} +
    +
    + + + +
    +
    + {if $add_product_link}{/if} + {$product.name} + {if $add_product_link}{/if} + {if is_array($product.customizations) && $product.customizations|count} + {foreach from=$product.customizations item="customization"} +
    + {l s='Product customization' d='Shop.Theme.Catalog'} +
    + + {/foreach} + {/if} + {hook h='displayProductPriceBlock' product=$product type="unit_price"} +
    +
    +
    +
    {$product.price}
    +
    {$product.quantity}
    +
    {$product.total}
    +
    +
    +
    + {/foreach} + +
    + + + {foreach $subtotals as $subtotal} + {if $subtotal.type !== 'tax' && $subtotal.label !== null} + + + + + {/if} + {/foreach} + + {if !$configuration.display_prices_tax_incl && $configuration.taxes_enabled} + + + + + + + + + {else} + + + + + {/if} + {if $subtotals.tax.label !== null} + + + + {/if} +
    {$subtotal.label}{if 'discount' == $subtotal.type}- {/if}{$subtotal.value}
    {$totals.total.label} {$labels.tax_short}{$totals.total.value}
    {$totals.total_including_tax.label}{$totals.total_including_tax.value}
    {$totals.total.label} {if $configuration.taxes_enabled}{$labels.tax_short}{/if}{$totals.total.value}
    {l s='%label%:' sprintf=['%label%' => $subtotals.tax.label] d='Shop.Theme.Global'} {$subtotals.tax.value}
    + {/block} + +
    +
    diff --git a/templates/checkout/_partials/order-final-summary-table.tpl b/templates/checkout/_partials/order-final-summary-table.tpl new file mode 100755 index 0000000..a1cf318 --- /dev/null +++ b/templates/checkout/_partials/order-final-summary-table.tpl @@ -0,0 +1,38 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='checkout/_partials/order-confirmation-table.tpl'} + +{block name='order-items-table-head'} +
    +

    + {if $products_count == 1} + {l s='%product_count% item in your cart' sprintf=['%product_count%' => $products_count] d='Shop.Theme.Checkout'} + {else} + {l s='%products_count% items in your cart' sprintf=['%products_count%' => $products_count] d='Shop.Theme.Checkout'} + {/if} + mode_edit {l s='edit' d='Shop.Theme.Actions'} +

    +
    +{/block} diff --git a/templates/checkout/_partials/order-final-summary.tpl b/templates/checkout/_partials/order-final-summary.tpl new file mode 100755 index 0000000..e67a4a5 --- /dev/null +++ b/templates/checkout/_partials/order-final-summary.tpl @@ -0,0 +1,103 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    +
    +
    +

    {l s='Please check your order before payment' d='Shop.Theme.Checkout'}

    +
    +
    + +
    +
    +

    + {l s='Addresses' d='Shop.Theme.Checkout'} + mode_edit {l s='edit' d='Shop.Theme.Actions'} +

    +
    +
    +
    +
    +
    +
    +

    {l s='Your Delivery Address' d='Shop.Theme.Checkout'}

    + {$customer.addresses[$cart.id_address_delivery]['formatted'] nofilter} +
    +
    +
    +
    +
    +
    +

    {l s='Your Invoice Address' d='Shop.Theme.Checkout'}

    + {$customer.addresses[$cart.id_address_invoice]['formatted'] nofilter} +
    +
    +
    +
    + +
    +
    +

    + {l s='Shipping Method' d='Shop.Theme.Checkout'} + mode_edit {l s='edit' d='Shop.Theme.Actions'} +

    + +
    +
    +
    +
    + {if $selected_delivery_option.logo} + {$selected_delivery_option.name} + {else} +   + {/if} +
    +
    +
    + {$selected_delivery_option.name} +
    +
    + {$selected_delivery_option.delay} +
    +
    + {$selected_delivery_option.price} +
    +
    +
    +
    +
    + +
    + {block name='order_confirmation_table'} + {include file='checkout/_partials/order-final-summary-table.tpl' + products=$cart.products + products_count=$cart.products_count + subtotals=$cart.subtotals + totals=$cart.totals + labels=$cart.labels + add_product_link=true + } + {/block} +
    +
    diff --git a/templates/checkout/_partials/steps/addresses.tpl b/templates/checkout/_partials/steps/addresses.tpl new file mode 100644 index 0000000..2dc14b6 --- /dev/null +++ b/templates/checkout/_partials/steps/addresses.tpl @@ -0,0 +1,137 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='checkout/_partials/steps/checkout-step.tpl'} + +{block name='step_content'} +
    +
    + + {if !$use_same_address} +

    {l s='Shipping Address' d='Shop.Theme.Checkout'}

    + {/if} + + {if $use_same_address && !$cart.is_virtual} +

    + {l s='The selected address will be used both as your personal address (for invoice) and as your delivery address.' d='Shop.Theme.Checkout'} +

    + {elseif $use_same_address && $cart.is_virtual} +

    + {l s='The selected address will be used as your personal address (for invoice).' d='Shop.Theme.Checkout'} +

    + {/if} + + {if $show_delivery_address_form} +
    + {render file = 'checkout/_partials/address-form.tpl' + ui = $address_form + use_same_address = $use_same_address + type = "delivery" + form_has_continue_button = $form_has_continue_button + } +
    + {elseif $customer.addresses|count > 0} +
    + {include file = 'checkout/_partials/address-selector-block.tpl' + addresses = $customer.addresses + name = "id_address_delivery" + selected = $id_address_delivery + type = "delivery" + interactive = !$show_delivery_address_form and !$show_invoice_address_form + } +
    + + {if isset($delivery_address_error)} +

    {$delivery_address_error.exception}

    + {else} + + {/if} + +

    + {l s='add new address' d='Shop.Theme.Actions'} +

    + + {if $use_same_address && !$cart.is_virtual} +

    + + {l s='Billing address differs from shipping address' d='Shop.Theme.Checkout'} + +

    + {/if} + + {/if} + + {if !$use_same_address} + +

    {l s='Your Invoice Address' d='Shop.Theme.Checkout'}

    + + {if $show_invoice_address_form} +
    + {render file = 'checkout/_partials/address-form.tpl' + ui = $address_form + use_same_address = $use_same_address + type = "invoice" + form_has_continue_button = $form_has_continue_button + } +
    + {else} +
    + {include file = 'checkout/_partials/address-selector-block.tpl' + addresses = $customer.addresses + name = "id_address_invoice" + selected = $id_address_invoice + type = "invoice" + interactive = !$show_delivery_address_form and !$show_invoice_address_form + } +
    + + {if isset($invoice_address_error)} +

    {$invoice_address_error.exception}

    + {else} + + {/if} + +

    + {l s='add new address' d='Shop.Theme.Actions'} +

    + {/if} + + {/if} + + {if !$form_has_continue_button} +
    + + +
    + {/if} + +
    +
    +{/block} diff --git a/templates/checkout/_partials/steps/checkout-step.tpl b/templates/checkout/_partials/steps/checkout-step.tpl new file mode 100644 index 0000000..47773c8 --- /dev/null +++ b/templates/checkout/_partials/steps/checkout-step.tpl @@ -0,0 +1,46 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='step'} +
    +

    + + {$position} + {$title} + mode_edit {l s='Edit' d='Shop.Theme.Actions'} +

    + +
    + {block name='step_content'}DUMMY STEP CONTENT{/block} +
    +
    +{/block} diff --git a/templates/checkout/_partials/steps/payment.tpl b/templates/checkout/_partials/steps/payment.tpl new file mode 100644 index 0000000..2f14dfd --- /dev/null +++ b/templates/checkout/_partials/steps/payment.tpl @@ -0,0 +1,167 @@ +{extends file='checkout/_partials/steps/checkout-step.tpl'} + +{block name='step_content'} + + {hook h='displayPaymentTop'} + + {* used by javascript to correctly handle cart updates when we are on payment step (eg vouchers added) *} + + + {if !empty($display_transaction_updated_info)} +

    + {l s='Transaction amount has been correctly updated' d='Shop.Theme.Checkout'} +

    + {/if} + + {if $is_free} +

    {l s='No payment needed for this order' d='Shop.Theme.Checkout'}

    + {/if} +
    + {foreach from=$payment_options item="module_options"} + {foreach from=$module_options item="option"} +
    +
    + {* This is the way an option should be selected when Javascript is enabled *} + + + + + {* This is the way an option should be selected when Javascript is disabled *} +
    + {if $option.id === $selected_payment_option} + {l s='Selected' d='Shop.Theme.Checkout'} + {else} + + {/if} +
    + + + +
    +
    + + {if $option.additionalInformation} +
    + {$option.additionalInformation nofilter} +
    + {/if} + +
    + {if $option.form} + {$option.form nofilter} + {else} +
    + {foreach from=$option.inputs item=input} + + {/foreach} + +
    + {/if} +
    + {/foreach} + {foreachelse} +

    {l s='Unfortunately, there are no payment method available.' d='Shop.Theme.Checkout'}

    + {/foreach} +
    + + {if $conditions_to_approve|count} +

    + {* At the moment, we're not showing the checkboxes when JS is disabled + because it makes ensuring they were checked very tricky and overcomplicates + the template. Might change later. + *} + {l s='By confirming the order, you certify that you have read and agree with all of the conditions below:' d='Shop.Theme.Checkout'} +

    + +
    +
      + {foreach from=$conditions_to_approve item="condition" key="condition_name"} +
    • +
      + + + + +
      +
      + +
      +
      • + {/foreach} +
    +
    + {/if} + + {if $show_final_summary} + {include file='checkout/_partials/order-final-summary.tpl'} + {/if} + +
    +
    + + {if $show_final_summary} + + {/if} +
    +
    + {if $selected_payment_option and $all_conditions_approved} + + {/if} +
    +
    + + {hook h='displayPaymentByBinaries'} + + +{/block} diff --git a/templates/checkout/_partials/steps/personal-information.tpl b/templates/checkout/_partials/steps/personal-information.tpl new file mode 100644 index 0000000..13b6b10 --- /dev/null +++ b/templates/checkout/_partials/steps/personal-information.tpl @@ -0,0 +1,98 @@ +{extends file='checkout/_partials/steps/checkout-step.tpl'} + +{block name='step_content'} + {hook h='displayPersonalInformationTop' customer=$customer} + + {if $customer.is_logged && !$customer.is_guest} + +

    + {* [1][/1] is for a HTML tag. *} + {l s='Connected as [1]%firstname% %lastname%[/1].' + d='Shop.Theme.Customeraccount' + sprintf=[ + '[1]' => "", + '[/1]' => "", + '%firstname%' => $customer.firstname, + '%lastname%' => $customer.lastname + ] + } +

    +

    + {* [1][/1] is for a HTML tag. *} + {l + s='Not you? [1]Log out[/1]' + d='Shop.Theme.Customeraccount' + sprintf=[ + '[1]' => "", + '[/1]' => "" + ] + } +

    + {if !isset($empty_cart_on_logout) || $empty_cart_on_logout} +

    {l s='If you sign out now, your cart will be emptied.' d='Shop.Theme.Checkout'}

    + {/if} + +
    +
    + +
    + +
    + + {else} + + +
    + + +
    + + + {/if} +{/block} diff --git a/templates/checkout/_partials/steps/shipping.tpl b/templates/checkout/_partials/steps/shipping.tpl new file mode 100644 index 0000000..d6b5182 --- /dev/null +++ b/templates/checkout/_partials/steps/shipping.tpl @@ -0,0 +1,124 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='checkout/_partials/steps/checkout-step.tpl'} + +{block name='step_content'} +
    + {$hookDisplayBeforeCarrier nofilter} +
    + +
    + {if $delivery_options|count} +
    +
    + {block name='delivery_options'} +
    + {foreach from=$delivery_options item=carrier key=carrier_id} +
    +
    + + + + +
    + +
    + +
    + {/foreach} +
    + {/block} +
    +
    + + +
    + + {if $recyclablePackAllowed} + + + + + + {/if} + + {if $gift.allowed} + + + + + + +
    + + +
    + {/if} + +
    +
    + +
    + {else} +

    {l s='Unfortunately, there are no carriers available for your delivery address.' d='Shop.Theme.Checkout'}

    + {/if} +
    + +
    + {$hookDisplayAfterCarrier nofilter} +
    + +
    +{/block} diff --git a/templates/checkout/_partials/steps/unreachable.tpl b/templates/checkout/_partials/steps/unreachable.tpl new file mode 100644 index 0000000..158efa3 --- /dev/null +++ b/templates/checkout/_partials/steps/unreachable.tpl @@ -0,0 +1,31 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='step'} +
    +

    + {$position} {$title} +

    +
    +{/block} diff --git a/templates/checkout/cart-empty.tpl b/templates/checkout/cart-empty.tpl new file mode 100644 index 0000000..70d0d7d --- /dev/null +++ b/templates/checkout/cart-empty.tpl @@ -0,0 +1,45 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='checkout/cart.tpl'} + +{block name='content' append} + {hook h='displayCrossSellingShoppingCart'} +{/block} + +{block name='continue_shopping' append} + + chevron_left{l s='Continue shopping' d='Shop.Theme.Actions'} + +{/block} + +{block name='cart_actions'} +
    + +
    +{/block} + +{block name='continue_shopping'}{/block} +{block name='cart_voucher'}{/block} +{block name='display_reassurance'}{/block} diff --git a/templates/checkout/cart.tpl b/templates/checkout/cart.tpl new file mode 100644 index 0000000..fb0a4d5 --- /dev/null +++ b/templates/checkout/cart.tpl @@ -0,0 +1,87 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file=$layout} + +{block name='content'} + +
    +
    + + +
    + + +
    +
    +

    {l s='Shopping Cart' d='Shop.Theme.Checkout'}

    +
    +
    + {block name='cart_overview'} + {include file='checkout/_partials/cart-detailed.tpl' cart=$cart} + {/block} +
    + + {block name='continue_shopping'} + + chevron_left{l s='Continue shopping' d='Shop.Theme.Actions'} + + {/block} + + + {block name='hook_shopping_cart_footer'} + {hook h='displayShoppingCartFooter'} + {/block} +
    + + +
    + + {block name='cart_summary'} +
    + + {block name='hook_shopping_cart'} + {hook h='displayShoppingCart'} + {/block} + + {block name='cart_totals'} + {include file='checkout/_partials/cart-detailed-totals.tpl' cart=$cart} + {/block} + + {block name='cart_actions'} + {include file='checkout/_partials/cart-detailed-actions.tpl' cart=$cart} + {/block} + +
    + {/block} + + {block name='hook_reassurance'} + {hook h='displayReassurance'} + {/block} + +
    + +
    +
    +{/block} diff --git a/templates/checkout/checkout-process.tpl b/templates/checkout/checkout-process.tpl new file mode 100644 index 0000000..98065b2 --- /dev/null +++ b/templates/checkout/checkout-process.tpl @@ -0,0 +1,30 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{foreach from=$steps item="step" key="index"} + {render identifier = $step.identifier + position = ($index + 1) + ui = $step.ui + } +{/foreach} diff --git a/templates/checkout/checkout.tpl b/templates/checkout/checkout.tpl new file mode 100644 index 0000000..ed0134a --- /dev/null +++ b/templates/checkout/checkout.tpl @@ -0,0 +1,94 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + + + + + {block name='head'} + {include file='_partials/head.tpl'} + {/block} + + + + + {block name='hook_after_body_opening_tag'} + {hook h='displayAfterBodyOpeningTag'} + {/block} + + + + {block name='notifications'} + {include file='_partials/notifications.tpl'} + {/block} + +
    + {hook h="displayWrapperTop"} +
    + + {block name='content'} +
    +
    +
    + {block name='cart_summary'} + {render file='checkout/checkout-process.tpl' ui=$checkout_process} + {/block} +
    + +
    + + {block name='cart_summary'} + {include file='checkout/_partials/cart-summary.tpl' cart = $cart} + {/block} + + {hook h='displayReassurance'} +
    +
    +
    + {/block} +
    + {hook h="displayWrapperBottom"} +
    + +
    + {block name='footer'} + {include file='checkout/_partials/footer.tpl'} + {/block} +
    + + {block name='javascript_bottom'} + {include file="_partials/javascript.tpl" javascript=$javascript.bottom} + {/block} + + {block name='hook_before_body_closing_tag'} + {hook h='displayBeforeBodyClosingTag'} + {/block} + + + + diff --git a/templates/checkout/order-confirmation.tpl b/templates/checkout/order-confirmation.tpl new file mode 100644 index 0000000..d73a970 --- /dev/null +++ b/templates/checkout/order-confirmation.tpl @@ -0,0 +1,110 @@ +{extends file='page.tpl'} + +{block name='page_content_container' prepend} +
    +
    +
    +
    + + {block name='order_confirmation_header'} +

    + {l s='Your order is confirmed' d='Shop.Theme.Checkout'} +

    + {/block} + +

    + {l s='An email has been sent to your mail address %email%.' d='Shop.Theme.Checkout' sprintf=['%email%' => $customer.email]} + {if $order.details.invoice_url} + {* [1][/1] is for a HTML tag. *} + {l + s='You can also [1]download your invoice[/1]' + d='Shop.Theme.Checkout' + sprintf=[ + '[1]' => "", + '[/1]' => "" + ] + } + {/if} +

    + + {block name='hook_order_confirmation'} + {$HOOK_ORDER_CONFIRMATION nofilter} + {/block} + +
    +
    +
    +
    +{/block} + +{block name='page_content_container'} +
    +
    +
    + + {block name='order_confirmation_table'} + {include + file='checkout/_partials/order-confirmation-table.tpl' + products=$order.products + subtotals=$order.subtotals + totals=$order.totals + labels=$order.labels + add_product_link=false + } + {/block} + + {block name='order_details'} +
    +

    {l s='Order details' d='Shop.Theme.Checkout'}:

    +
      +
    • {l s='Order reference: %reference%' d='Shop.Theme.Checkout' sprintf=['%reference%' => $order.details.reference]}
      • +
    • {l s='Payment method: %method%' d='Shop.Theme.Checkout' sprintf=['%method%' => $order.details.payment]}
      • + {if !$order.details.is_virtual} +
    • + {l s='Shipping method: %method%' d='Shop.Theme.Checkout' sprintf=['%method%' => $order.carrier.name]}
      + {$order.carrier.delay} +
      • + {/if} +
    +
    + {/block} + +
    +
    +
    + + {block name='hook_payment_return'} + {if ! empty($HOOK_PAYMENT_RETURN)} +
    +
    +
    +
    + {$HOOK_PAYMENT_RETURN nofilter} +
    +
    +
    +
    + {/if} + {/block} + + {block name='customer_registration_form'} + {if $customer.is_guest} +
    +
    +

    {l s='Save time on your next order, sign up now' d='Shop.Theme.Checkout'}

    + {render file='customer/_partials/customer-form.tpl' ui=$register_form} +
    +
    + {/if} + {/block} + + {block name='hook_order_confirmation_1'} + {hook h='displayOrderConfirmation1'} + {/block} + + {block name='hook_order_confirmation_2'} +
    + {hook h='displayOrderConfirmation2'} +
    + {/block} +{/block} diff --git a/templates/cms/_partials/sitemap-nested-list.tpl b/templates/cms/_partials/sitemap-nested-list.tpl new file mode 100644 index 0000000..cf6044f --- /dev/null +++ b/templates/cms/_partials/sitemap-nested-list.tpl @@ -0,0 +1,38 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='sitemap_item'} + + {foreach $links as $link} +
  • + + {$link.label} + + {if isset($link.children) && $link.children|@count > 0} + {include file='cms/_partials/sitemap-nested-list.tpl' links=$link.children is_nested=true} + {/if} +
    • + {/foreach} + +{/block} diff --git a/templates/cms/category.tpl b/templates/cms/category.tpl new file mode 100644 index 0000000..d62e1b2 --- /dev/null +++ b/templates/cms/category.tpl @@ -0,0 +1,53 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {$cms_category.name} +{/block} + +{block name='page_content'} + {block name='cms_sub_categories'} + {if $sub_categories} +

    {l s='List of sub categories in %name%:' d='Shop.Theme.Global' sprintf=['%name%' => $cms_category.name]}

    + + {/if} + {/block} + + {block name='cms_sub_pages'} + {if $cms_pages} +

    {l s='List of pages in %category_name%:' d='Shop.Theme.Global' sprintf=['%category_name%' => $cms_category.name]}

    + + {/if} + {/block} +{/block} diff --git a/templates/cms/page.tpl b/templates/cms/page.tpl new file mode 100644 index 0000000..4839ab7 --- /dev/null +++ b/templates/cms/page.tpl @@ -0,0 +1,47 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {$cms.meta_title} +{/block} + +{block name='page_content_container'} +
    + + {block name='cms_content'} + {$cms.content nofilter} + {/block} + + {block name='hook_cms_dispute_information'} + {hook h='displayCMSDisputeInformation'} + {/block} + + {block name='hook_cms_print_button'} + {hook h='displayCMSPrintButton'} + {/block} + +
    +{/block} diff --git a/templates/cms/sitemap.tpl b/templates/cms/sitemap.tpl new file mode 100644 index 0000000..1a92472 --- /dev/null +++ b/templates/cms/sitemap.tpl @@ -0,0 +1,52 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {l s='Sitemap' d='Shop.Theme.Global'} +{/block} + +{block name='page_content_container'} +
    +
    +
    +

    {$our_offers}

    + {include file='cms/_partials/sitemap-nested-list.tpl' links=$links.offers} +
    +
    +

    {$categories}

    + {include file='cms/_partials/sitemap-nested-list.tpl' links=$links.categories} +
    +
    +

    {$your_account}

    + {include file='cms/_partials/sitemap-nested-list.tpl' links=$links.user_account} +
    +
    +

    {$pages}

    + {include file='cms/_partials/sitemap-nested-list.tpl' links=$links.pages} +
    +
    +
    +{/block} diff --git a/templates/cms/stores.tpl b/templates/cms/stores.tpl new file mode 100644 index 0000000..bb3c992 --- /dev/null +++ b/templates/cms/stores.tpl @@ -0,0 +1,88 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {l s='Our stores' d='Shop.Theme.Global'} +{/block} + +{block name='page_content_container'} +
    + + {foreach $stores as $store} +
    +
    +
    + {$store.image.legend} +
    +
    +

    {$store.name}

    +
    {$store.address.formatted nofilter}
    + {if $store.note || $store.phone || $store.fax || $store.email} + + {/if} +
    +
    + + {foreach $store.business_hours as $day} + + + + + {/foreach} +
    {$day.day|truncate:4:'.'} +
      + {foreach $day.hours as $h} +
    • {$h}
      • + {/foreach} +
    +
    +
    +
    +
    +
    +
    + {if $store.note} +

    {$store.note}

    + {/if} +

    +
      + {if $store.phone} +
    • {$store.phone}
      • + {/if} + {if $store.fax} +
    • {$store.fax}
      • + {/if} + {if $store.email} +
    • {$store.email}
      • + {/if} +
    +
    +
    +
    + {/foreach} + +
    +{/block} diff --git a/templates/contact.tpl b/templates/contact.tpl new file mode 100644 index 0000000..fc228c0 --- /dev/null +++ b/templates/contact.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_header_container'}{/block} + +{block name='left_column'} +
    + {widget name="ps_contactinfo" hook='displayLeftColumn'} +
    +{/block} + +{block name='page_content'} + {widget name="contactform"} +{/block} diff --git a/templates/customer/_partials/address-form.tpl b/templates/customer/_partials/address-form.tpl new file mode 100644 index 0000000..3f30e0f --- /dev/null +++ b/templates/customer/_partials/address-form.tpl @@ -0,0 +1,63 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name="address_form"} +
    + {include file='_partials/form-errors.tpl' errors=$errors['']} + + {block name="address_form_url"} +
    + {/block} + + {block name="address_form_fields"} +
    + {block name='form_fields'} + {foreach from=$formFields item="field"} + {block name='form_field'} + {form_field field=$field} + {/block} + {/foreach} + {/block} +
    + {/block} + + {block name="address_form_footer"} +
    + + {block name='form_buttons'} + + {/block} +
    + {/block} + +
    +
    +{/block} diff --git a/templates/customer/_partials/block-address.tpl b/templates/customer/_partials/block-address.tpl new file mode 100644 index 0000000..433672d --- /dev/null +++ b/templates/customer/_partials/block-address.tpl @@ -0,0 +1,45 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='address_block_item'} + +{/block} diff --git a/templates/customer/_partials/customer-form.tpl b/templates/customer/_partials/customer-form.tpl new file mode 100644 index 0000000..dba04d0 --- /dev/null +++ b/templates/customer/_partials/customer-form.tpl @@ -0,0 +1,54 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='customer_form'} + {block name='customer_form_errors'} + {include file='_partials/form-errors.tpl' errors=$errors['']} + {/block} + +
    +
    + {block "form_fields"} + {foreach from=$formFields item="field"} + {block "form_field"} + {form_field field=$field} + {/block} + {/foreach} + {$hook_create_account_form nofilter} + {/block} +
    + + {block name='customer_form_footer'} +
    + + {block "form_buttons"} + + {/block} +
    + {/block} + +
    +{/block} diff --git a/templates/customer/_partials/login-form.tpl b/templates/customer/_partials/login-form.tpl new file mode 100644 index 0000000..932480e --- /dev/null +++ b/templates/customer/_partials/login-form.tpl @@ -0,0 +1,60 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='login_form'} + + {block name='login_form_errors'} + {include file='_partials/form-errors.tpl' errors=$errors['']} + {/block} + +
    + +
    + {block name='login_form_fields'} + {foreach from=$formFields item="field"} + {block name='form_field'} + {form_field field=$field} + {/block} + {/foreach} + {/block} +
    + + {l s='Forgot your password?' d='Shop.Theme.Customeraccount'} + +
    +
    + + {block name='login_form_footer'} +
    + + {block name='form_buttons'} + + {/block} +
    + {/block} + +
    +{/block} diff --git a/templates/customer/_partials/my-account-links.tpl b/templates/customer/_partials/my-account-links.tpl new file mode 100644 index 0000000..1892017 --- /dev/null +++ b/templates/customer/_partials/my-account-links.tpl @@ -0,0 +1,34 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='my_account_links'} + + +{/block} diff --git a/templates/customer/_partials/order-detail-no-return.tpl b/templates/customer/_partials/order-detail-no-return.tpl new file mode 100644 index 0000000..005af9b --- /dev/null +++ b/templates/customer/_partials/order-detail-no-return.tpl @@ -0,0 +1,175 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='order_products_table'} +
    + + + + + + + + + + {foreach from=$order.products item=product} + + + + + + + {/foreach} + + {foreach $order.subtotals as $line} + {if $line.value} + + + + + {/if} + {/foreach} + + + + + +
    {l s='Product' d='Shop.Theme.Catalog'}{l s='Quantity' d='Shop.Theme.Catalog'}{l s='Unit price' d='Shop.Theme.Catalog'}{l s='Total price' d='Shop.Theme.Catalog'}
    + + + {$product.name} + +
    + {if $product.reference} + {l s='Reference' d='Shop.Theme.Catalog'}: {$product.reference}
    + {/if} + {if $product.customizations} + {foreach from=$product.customizations item="customization"} +
    + {l s='Product customization' d='Shop.Theme.Catalog'} +
    +
    + +
    + {/foreach} + {/if} +     		+ {if $product.customizations} + {foreach $product.customizations as $customization} + {$customization.quantity} + {/foreach} + {else} + {$product.quantity} + {/if} + {$product.price}{$product.total}
    {$line.label}{$line.value}
    {$order.totals.total.label}{$order.totals.total.value}
    +
    + +
    + {foreach from=$order.products item=product} +
    +
    +
    +
    {$product.name}
    + {if $product.reference} +
    {l s='Reference' d='Shop.Theme.Catalog'}: {$product.reference}
    + {/if} + {if $product.customizations} + {foreach $product.customizations as $customization} +
    + {l s='Product customization' d='Shop.Theme.Catalog'} +
    +
    +
    + {/foreach} + {/if} +
    +
    +
    +
    + {$product.price} +
    +
    + {if $product.customizations} + {foreach $product.customizations as $customization} + {$customization.quantity} + {/foreach} + {else} + {$product.quantity} + {/if} +
    +
    + {$product.total} +
    +
    +
    +
    +
    + {/foreach} +
    +
    + {foreach $order.subtotals as $line} + {if $line.value} +
    +
    {$line.label}
    +
    {$line.value}
    +
    + {/if} + {/foreach} +
    +
    {$order.totals.total.label}
    +
    {$order.totals.total.value}
    +
    +
    +{/block} diff --git a/templates/customer/_partials/order-detail-return.tpl b/templates/customer/_partials/order-detail-return.tpl new file mode 100644 index 0000000..1156ec3 --- /dev/null +++ b/templates/customer/_partials/order-detail-return.tpl @@ -0,0 +1,253 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='order_products_table'} +
    + +
    + + + + + + + + + + + + {foreach from=$order.products item=product name=products} + + + + + + + + + {/foreach} + + {foreach $order.subtotals as $line} + {if $line.value} + + + + + {/if} + {/foreach} + + + + + +
    {l s='Product' d='Shop.Theme.Catalog'}{l s='Quantity' d='Shop.Theme.Catalog'}{l s='Returned' d='Shop.Theme.Customeraccount'}{l s='Unit price' d='Shop.Theme.Catalog'}{l s='Total price' d='Shop.Theme.Catalog'}
    + {if !$product.customizations} + + + + {else} + {foreach $product.customizations as $customization} + + + + {/foreach} + {/if} + + {$product.name}
    + {if $product.reference} + {l s='Reference' d='Shop.Theme.Catalog'}: {$product.reference}
    + {/if} + {if $product.customizations} + {foreach from=$product.customizations item="customization"} +
    + {l s='Product customization' d='Shop.Theme.Catalog'} +
    +
    + +
    + {/foreach} + {/if} +     		+ {if !$product.customizations} +
    + {$product.quantity} +
    + {if $product.quantity > $product.qty_returned} +
    + +
    + {/if} + {else} + {foreach $product.customizations as $customization} +
    + {$customization.quantity} +
    +
    + +
    + {/foreach} +
    + {/if} +     		{$product.qty_returned}{$product.price}{$product.total}
    {$line.label}{$line.value}
    {$order.totals.total.label}{$order.totals.total.value}
    +
    + +
    + {foreach from=$order.products item=product} +
    +
    +
    + {if !$product.customizations} + + {else} + {foreach $product.customizations as $customization} + + {/foreach} + {/if} +
    +
    +
    +
    +
    {$product.name}
    + {if $product.reference} +
    {l s='Reference' d='Shop.Theme.Catalog'}: {$product.reference}
    + {/if} + {if $product.customizations} + {foreach $product.customizations as $customization} +
    + {l s='Product customization' d='Shop.Theme.Catalog'} +
    +
    +
    + {/foreach} + {/if} +
    +
    +
    +
    + {$product.price} +
    +
    + {if $product.customizations} + {foreach $product.customizations as $customization} +
    {l s='Quantity' d='Shop.Theme.Catalog'}: {$customization.quantity}
    +
    + {/foreach} + {else} +
    {l s='Quantity' d='Shop.Theme.Catalog'}: {$product.quantity}
    + {if $product.quantity > $product.qty_returned} +
    + {/if} + {/if} + {if $product.qty_returned > 0} +
    {l s='Returned' d='Shop.Theme.Customeraccount'}: {$product.qty_returned}
    + {/if} +
    +
    + {$product.total} +
    +
    +
    +
    +
    +
    +
    + {/foreach} +
    +
    + {foreach $order.subtotals as $line} + {if $line.value} +
    +
    {$line.label}
    +
    {$line.value}
    +
    + {/if} + {/foreach} +
    +
    {$order.totals.total.label}
    +
    {$order.totals.total.value}
    +
    +
    + +
    +
    +

    {l s='Merchandise return' d='Shop.Theme.Customeraccount'}

    +

    {l s='If you wish to return one or more products, please mark the corresponding boxes and provide an explanation for the return. When complete, click the button below.' d='Shop.Theme.Customeraccount'}

    +
    +
    +
    + +
    +
    +
    + + +
    +
    + +
    +{/block} diff --git a/templates/customer/_partials/order-messages.tpl b/templates/customer/_partials/order-messages.tpl new file mode 100644 index 0000000..daf71a5 --- /dev/null +++ b/templates/customer/_partials/order-messages.tpl @@ -0,0 +1,85 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{block name='order_messages_table'} + {if $order.messages} +
    +

    {l s='Messages' d='Shop.Theme.Customeraccount'}

    + {foreach from=$order.messages item=message} +
    +
    + {$message.name}
    + {$message.message_date} +
    +
    + {$message.message nofilter} +
    +
    + {/foreach} +
    + {/if} +{/block} + +{block name='order_message_form'} +
    +
    + +
    +

    {l s='Add a message' d='Shop.Theme.Customeraccount'}

    +

    {l s='If you would like to add a comment about your order, please write it in the field below.' d='Shop.Theme.Customeraccount'}

    +
    + +
    + +
    + +
    + +
    +
    + +
    + +
    + +
    +
    + +
    + +
    + + +
    + +
    +
    +{/block} diff --git a/templates/customer/address.tpl b/templates/customer/address.tpl new file mode 100644 index 0000000..c97eb94 --- /dev/null +++ b/templates/customer/address.tpl @@ -0,0 +1,39 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/page.tpl'} + +{block name='page_title'} + {if $editing} + {l s='Update your address' d='Shop.Theme.Customeraccount'} + {else} + {l s='New address' d='Shop.Theme.Customeraccount'} + {/if} +{/block} + +{block name='page_content'} +
    + {render template="customer/_partials/address-form.tpl" ui=$address_form} +
    +{/block} diff --git a/templates/customer/addresses.tpl b/templates/customer/addresses.tpl new file mode 100644 index 0000000..8d59bc7 --- /dev/null +++ b/templates/customer/addresses.tpl @@ -0,0 +1,46 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/page.tpl'} + +{block name='page_title'} + {l s='Your addresses' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} + {foreach $customer.addresses as $address} +
    + {block name='customer_address'} + {include file='customer/_partials/block-address.tpl' address=$address} + {/block} +
    + {/foreach} +
    +
    + + + {l s='Create new address' d='Shop.Theme.Actions'} + +
    +{/block} diff --git a/templates/customer/authentication.tpl b/templates/customer/authentication.tpl new file mode 100644 index 0000000..3d940b9 --- /dev/null +++ b/templates/customer/authentication.tpl @@ -0,0 +1,46 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {l s='Log in to your account' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} + {block name='login_form_container'} + +
    + {block name='display_after_login_form'} + {hook h='displayCustomerLoginFormAfter'} + {/block} + + {/block} +{/block} diff --git a/templates/customer/discount.tpl b/templates/customer/discount.tpl new file mode 100644 index 0000000..c434a52 --- /dev/null +++ b/templates/customer/discount.tpl @@ -0,0 +1,96 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/page.tpl'} + +{block name='page_title'} + {l s='Your vouchers' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} + {if $cart_rules} + + + + + + + + + + + + + + {foreach from=$cart_rules item=cart_rule} + + + + + + + + + + {/foreach} + +
    {l s='Code' d='Shop.Theme.Checkout'}{l s='Description' d='Shop.Theme.Checkout'}{l s='Quantity' d='Shop.Theme.Checkout'}{l s='Value' d='Shop.Theme.Checkout'}{l s='Minimum' d='Shop.Theme.Checkout'}{l s='Cumulative' d='Shop.Theme.Checkout'}{l s='Expiration date' d='Shop.Theme.Checkout'}
    {$cart_rule.code}{$cart_rule.name}{$cart_rule.quantity_for_user}{$cart_rule.value}{$cart_rule.voucher_minimal}{$cart_rule.voucher_cumulable}{$cart_rule.voucher_date}
    +
    + {foreach from=$cart_rules item=cart_rule} +
    +
      +
    • + {l s='Code' d='Shop.Theme.Checkout'} + {$cart_rule.code} +
      • +
    • + {l s='Description' d='Shop.Theme.Checkout'} + {$cart_rule.name} +
      • +
    • + {l s='Quantity' d='Shop.Theme.Checkout'} + {$cart_rule.quantity_for_user} +
      • +
    • + {l s='Value' d='Shop.Theme.Checkout'} + {$cart_rule.value} +
      • +
    • + {l s='Minimum' d='Shop.Theme.Checkout'} + {$cart_rule.voucher_minimal} +
      • +
    • + {l s='Cumulative' d='Shop.Theme.Checkout'} + {$cart_rule.voucher_cumulable} +
      • +
    • + {l s='Expiration date' d='Shop.Theme.Checkout'} + {$cart_rule.voucher_date} +
      • +
    +
    + {/foreach} +
    + {/if} +{/block} diff --git a/templates/customer/guest-login.tpl b/templates/customer/guest-login.tpl new file mode 100644 index 0000000..356e81b --- /dev/null +++ b/templates/customer/guest-login.tpl @@ -0,0 +1,79 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {l s='Guest Order Tracking' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} +
    +
    +

    {l s='To track your order, please enter the following information:' d='Shop.Theme.Customeraccount'}

    +
    + +
    + +
    + +
    + +
    + {l s='For example: QIIXJXNUI or QIIXJXNUI#1' d='Shop.Theme.Customeraccount'} +
    +
    +
    + +
    + +
    + +
    +
    + +
    + +
    + +
    +
    +{/block} diff --git a/templates/customer/guest-tracking.tpl b/templates/customer/guest-tracking.tpl new file mode 100644 index 0000000..52a149b --- /dev/null +++ b/templates/customer/guest-tracking.tpl @@ -0,0 +1,70 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/order-detail.tpl'} + +{block name='page_title'} + {l s='Guest Tracking' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='order_detail'} + {include file='customer/_partials/order-detail-no-return.tpl'} +{/block} + +{block name='order_messages'} +{/block} + +{block name='page_content' append} + {block name='guest_to_customer'} +
    +
    +

    {l s='Transform your guest account into a customer account and enjoy:' d='Shop.Theme.Customeraccount'}

    +
      +
    • -{l s='Personalized and secure access' d='Shop.Theme.Customeraccount'}
      • +
    • -{l s='Fast and easy checkout' d='Shop.Theme.Customeraccount'}
      • +
    • -{l s='Easier merchandise return' d='Shop.Theme.Customeraccount'}
      • +
    +
    + +
    + + + +
    + +
    + + + + + + +
    + +
    + {/block} +{/block} diff --git a/templates/customer/history.tpl b/templates/customer/history.tpl new file mode 100644 index 0000000..422757f --- /dev/null +++ b/templates/customer/history.tpl @@ -0,0 +1,119 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/page.tpl'} + +{block name='page_title'} + {l s='Order history' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} +
    {l s='Here are the orders you\'ve placed since your account was created.' d='Shop.Theme.Customeraccount'}
    + + {if $orders} + + + + + + + + + + + + + + {foreach from=$orders item=order} + + + + + + + + + + {/foreach} + +
    {l s='Order reference' d='Shop.Theme.Checkout'}{l s='Date' d='Shop.Theme.Checkout'}{l s='Total price' d='Shop.Theme.Checkout'}{l s='Payment' d='Shop.Theme.Checkout'}{l s='Status' d='Shop.Theme.Checkout'}{l s='Invoice' d='Shop.Theme.Checkout'} 
    {$order.details.reference}{$order.details.order_date}{$order.totals.total.value}{$order.details.payment} + + {$order.history.current.ostate_name} + + + {if $order.details.invoice_url} + + {else} + - + {/if} + + + {l s='Details' d='Shop.Theme.Customeraccount'} + + {if $order.details.reorder_url} + {l s='Reorder' d='Shop.Theme.Actions'} + {/if} +
    + +
    + {foreach from=$orders item=order} +
    +
    +
    +

    {$order.details.reference}

     +
    {$order.details.order_date}
    +
    {$order.totals.total.value}
    +
    + + {$order.history.current.ostate_name} + +
    +
    +
    + + {if $order.details.reorder_url} + + {/if} +
    +
    +
    + {/foreach} +
    + + {/if} +{/block} diff --git a/templates/customer/identity.tpl b/templates/customer/identity.tpl new file mode 100644 index 0000000..646668b --- /dev/null +++ b/templates/customer/identity.tpl @@ -0,0 +1,33 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends 'customer/page.tpl'} + +{block name='page_title'} + {l s='Your personal information' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} + {render file='customer/_partials/customer-form.tpl' ui=$customer_form} +{/block} diff --git a/templates/customer/my-account.tpl b/templates/customer/my-account.tpl new file mode 100644 index 0000000..27e9a0b --- /dev/null +++ b/templates/customer/my-account.tpl @@ -0,0 +1,111 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/page.tpl'} + +{block name='page_title'} + {l s='Your account' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} +
    +
    + + + + + {l s='Information' d='Shop.Theme.Customeraccount'} + + + + {if $customer.addresses|count} + + + + {l s='Addresses' d='Shop.Theme.Customeraccount'} + + + {else} + + + + {l s='Add first address' d='Shop.Theme.Customeraccount'} + + + {/if} + + {if !$configuration.is_catalog} + + + + {l s='Order history and details' d='Shop.Theme.Customeraccount'} + + + {/if} + + {if !$configuration.is_catalog} + + + + {l s='Credit slips' d='Shop.Theme.Customeraccount'} + + + {/if} + + {if $configuration.voucher_enabled && !$configuration.is_catalog} + + + + {l s='Vouchers' d='Shop.Theme.Customeraccount'} + + + {/if} + + {if $configuration.return_enabled && !$configuration.is_catalog} + + + + {l s='Merchandise returns' d='Shop.Theme.Customeraccount'} + + + {/if} + + {block name='display_customer_account'} + {hook h='displayCustomerAccount'} + {/block} + +
    +
    +{/block} + + +{block name='page_footer'} + {block name='my_account_links'} +
    + + {l s='Sign out' d='Shop.Theme.Actions'} + +
    + {/block} +{/block} diff --git a/templates/customer/order-detail.tpl b/templates/customer/order-detail.tpl new file mode 100644 index 0000000..44b9afc --- /dev/null +++ b/templates/customer/order-detail.tpl @@ -0,0 +1,213 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/page.tpl'} + +{block name='page_title'} + {l s='Order details' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} + {block name='order_infos'} +
    +
    +
    +
    + + {l + s='Order Reference %reference% - placed on %date%' + d='Shop.Theme.Customeraccount' + sprintf=['%reference%' => $order.details.reference, '%date%' => $order.details.order_date] + } + +
    + {if $order.details.reorder_url} +
    + {l s='Reorder' d='Shop.Theme.Actions'} +
    + {/if} +
    +
    +
    + +
    +
      +
    • {l s='Carrier' d='Shop.Theme.Checkout'} {$order.carrier.name}
      • +
    • {l s='Payment method' d='Shop.Theme.Checkout'} {$order.details.payment}
      • + + {if $order.details.invoice_url} +
    • + + {l s='Download your invoice as a PDF file.' d='Shop.Theme.Customeraccount'} + +
      • + {/if} + + {if $order.details.recyclable} +
    • + {l s='You have given permission to receive your order in recycled packaging.' d='Shop.Theme.Customeraccount'} +
      • + {/if} + + {if $order.details.gift_message} +
    • {l s='You have requested gift wrapping for this order.' d='Shop.Theme.Customeraccount'}
      • +
    • {l s='Message' d='Shop.Theme.Customeraccount'} {$order.details.gift_message nofilter}
      • + {/if} +
    +
    +
    + {/block} + + {block name='order_history'} +
    +

    {l s='Follow your order\'s status step-by-step' d='Shop.Theme.Customeraccount'}

    + + + + + + + + + {foreach from=$order.history item=state} + + + + + {/foreach} + +
    {l s='Date' d='Shop.Theme.Global'}{l s='Status' d='Shop.Theme.Global'}
    {$state.history_date} + + {$state.ostate_name} + +
    +
    + {foreach from=$order.history item=state} +
    +
    {$state.history_date}
    +
    + + {$state.ostate_name} + +
    +
    + {/foreach} +
    +
    + {/block} + + {if $order.follow_up} +
    +

    {l s='Click the following link to track the delivery of your order' d='Shop.Theme.Customeraccount'}

    + {$order.follow_up} +
    + {/if} + + {block name='addresses'} +
    + {if $order.addresses.delivery} +
    +
    +

    {l s='Delivery address %alias%' d='Shop.Theme.Checkout' sprintf=['%alias%' => $order.addresses.delivery.alias]}

    +
    {$order.addresses.delivery.formatted nofilter}
    +
    +
    + {/if} + +
    +
    +

    {l s='Invoice address %alias%' d='Shop.Theme.Checkout' sprintf=['%alias%' => $order.addresses.invoice.alias]}

    +
    {$order.addresses.invoice.formatted nofilter}
    +
    +
    +
    +
    + {/block} + + {$HOOK_DISPLAYORDERDETAIL nofilter} + + {block name='order_detail'} + {if $order.details.is_returnable} + {include file='customer/_partials/order-detail-return.tpl'} + {else} + {include file='customer/_partials/order-detail-no-return.tpl'} + {/if} + {/block} + + {block name='order_carriers'} + {if $order.shipping} +
    + + + + + + + + + + + + {foreach from=$order.shipping item=line} + + + + + + + + {/foreach} + +
    {l s='Date' d='Shop.Theme.Global'}{l s='Carrier' d='Shop.Theme.Checkout'}{l s='Weight' d='Shop.Theme.Checkout'}{l s='Shipping cost' d='Shop.Theme.Checkout'}{l s='Tracking number' d='Shop.Theme.Checkout'}
    {$line.shipping_date}{$line.carrier_name}{$line.shipping_weight}{$line.shipping_cost}{$line.tracking nofilter}
    +
    + {foreach from=$order.shipping item=line} +
    +
      +
    • + {l s='Date' d='Shop.Theme.Global'} {$line.shipping_date} +
      • +
    • + {l s='Carrier' d='Shop.Theme.Checkout'} {$line.carrier_name} +
      • +
    • + {l s='Weight' d='Shop.Theme.Checkout'} {$line.shipping_weight} +
      • +
    • + {l s='Shipping cost' d='Shop.Theme.Checkout'} {$line.shipping_cost} +
      • +
    • + {l s='Tracking number' d='Shop.Theme.Checkout'} {$line.tracking nofilter} +
      • +
    +
    + {/foreach} +
    +
    + {/if} + {/block} + + {block name='order_messages'} + {include file='customer/_partials/order-messages.tpl'} + {/block} +{/block} diff --git a/templates/customer/order-follow.tpl b/templates/customer/order-follow.tpl new file mode 100644 index 0000000..9006b89 --- /dev/null +++ b/templates/customer/order-follow.tpl @@ -0,0 +1,98 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/page.tpl'} + +{block name='page_title'} + {l s='Merchandise returns' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} + + {if $ordersReturn && count($ordersReturn)} + +
    {l s='Here is a list of pending merchandise returns' d='Shop.Theme.Customeraccount'}
    + + + + + + + + + + + + + {foreach from=$ordersReturn item=return} + + + + + + + + {/foreach} + +
    {l s='Order' d='Shop.Theme.Customeraccount'}{l s='Return' d='Shop.Theme.Customeraccount'}{l s='Package status' d='Shop.Theme.Customeraccount'}{l s='Date issued' d='Shop.Theme.Customeraccount'}{l s='Returns form' d='Shop.Theme.Customeraccount'}
    {$return.reference}{$return.return_number}{$return.state_name}{$return.return_date} + {if $return.print_url} + {l s='Print out' d='Shop.Theme.Actions'} + {else} + - + {/if} +
    +
    + {foreach from=$ordersReturn item=return} +
    +
      +
    • + {l s='Order' d='Shop.Theme.Customeraccount'} + {$return.reference} +
      • +
    • + {l s='Return' d='Shop.Theme.Customeraccount'} + {$return.return_number} +
      • +
    • + {l s='Package status' d='Shop.Theme.Customeraccount'} + {$return.state_name} +
      • +
    • + {l s='Date issued' d='Shop.Theme.Customeraccount'} + {$return.return_date} +
      • + {if $return.print_url} +
    • + {l s='Returns form' d='Shop.Theme.Customeraccount'} + {l s='Print out' d='Shop.Theme.Actions'} +
      • + {/if} +
    +
    + {/foreach} +
    + + {/if} + +{/block} diff --git a/templates/customer/order-return.tpl b/templates/customer/order-return.tpl new file mode 100644 index 0000000..6aa2365 --- /dev/null +++ b/templates/customer/order-return.tpl @@ -0,0 +1,151 @@ +{extends file='customer/page.tpl'} + +{block name='page_title'} +

    {l s='Return details' d='Shop.Theme.Customeraccount'}

    +{/block} + +{block name='page_content'} + {block name='order_return_infos'} +
    +
    +

    + {l + s='%number% on %date%' + d='Shop.Theme.Customeraccount' + sprintf=['%number%' => $return.return_number, '%date%' => $return.return_date]} + +

    +

    {l s='We have logged your return request.' d='Shop.Theme.Customeraccount'}

    +

    {l + s='Your package must be returned to us within %number% days of receiving your order.' + d='Shop.Theme.Customeraccount' + sprintf=['%number%' => $configuration.number_of_days_for_return]}

    +

    + {* [1][/1] is for a HTML tag. *} + {l + s='The current status of your merchandise return is: [1] %status% [/1]' + d='Shop.Theme.Customeraccount' + sprintf=[ + '[1]' => '', + '[/1]' => '', + '%status%' => $return.state_name + ] + } +

    +

    {l s='List of items to be returned:' d='Shop.Theme.Customeraccount'}

    + + + + + + + + + {foreach from=$products item=product} + + + + + {/foreach} + +
    {l s='Product' d='Shop.Theme.Catalog'}{l s='Quantity' d='Shop.Theme.Checkout'}
    + {$product.product_name} + {if $product.product_reference} +
    + {l s='Reference' d='Shop.Theme.Catalog'}: {$product.product_reference} + {/if} + {if $product.customizations} + {foreach from=$product.customizations item="customization"} +
    + {l s='Product customization' d='Shop.Theme.Catalog'} +
    + + {/foreach} + {/if} +     		+ {$product.product_quantity} +
    +
    +
    + {/block} + + {if $return.state == 2} +
    +
    +

    {l s='Reminder' d='Shop.Theme.Customeraccount'}

    +

    + {l + s='All merchandise must be returned in its original packaging and in its original state.' + d='Shop.Theme.Customeraccount' + }
    + {* [1][/1] is for a HTML tag. *} + {l + s='Please print out the [1]returns form[/1] and include it with your package.' + d='Shop.Theme.Customeraccount' + sprintf=[ + '[1]' => '', + '[/1]' => '' + ] + } +
    + {* [1][/1] is for a HTML tag. *} + {l + s='Please check the [1]returns form[/1] for the correct address.' + d='Shop.Theme.Customeraccount' + sprintf=[ + '[1]' => '', + '[/1]' => '' + ] + } +

    +

    + {l + s='When we receive your package, we will notify you by email. We will then begin processing order reimbursement.' + d='Shop.Theme.Customeraccount' + }
    + + {l + s='Please let us know if you have any questions.' + d='Shop.Theme.Customeraccount' + } +
    + {l + s='If the conditions of return listed above are not respected, we reserve the right to refuse your package and/or reimbursement.' + d='Shop.Theme.Customeraccount' + } +

    +
    +
    + {/if} +{/block} diff --git a/templates/customer/order-slip.tpl b/templates/customer/order-slip.tpl new file mode 100644 index 0000000..feb5662 --- /dev/null +++ b/templates/customer/order-slip.tpl @@ -0,0 +1,80 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='customer/page.tpl'} + +{block name='page_title'} + {l s='Credit slips' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} +
    {l s='Credit slips you have received after canceled orders.' d='Shop.Theme.Customeraccount'}
    + {if $credit_slips} + + + + + + + + + + + {foreach from=$credit_slips item=slip} + + + + + + + {/foreach} + +
    {l s='Order' d='Shop.Theme.Customeraccount'}{l s='Credit slip' d='Shop.Theme.Customeraccount'}{l s='Date issued' d='Shop.Theme.Customeraccount'}{l s='View credit slip' d='Shop.Theme.Customeraccount'}
    {$slip.order_reference}{$slip.credit_slip_number}{$slip.credit_slip_date} + +
    +
    + {foreach from=$credit_slips item=slip} +
    + +
    + {/foreach} +
    + {/if} +{/block} diff --git a/templates/customer/page.tpl b/templates/customer/page.tpl new file mode 100644 index 0000000..099c1f8 --- /dev/null +++ b/templates/customer/page.tpl @@ -0,0 +1,46 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='notifications'}{/block} + +{block name='page_content_container'} +
    + {block name='page_content_top'} + {block name='customer_notifications'} + {include file='_partials/notifications.tpl'} + {/block} + {/block} + {block name='page_content'} + + {/block} +
    +{/block} + +{block name='page_footer'} + {block name='my_account_links'} + {include file='customer/_partials/my-account-links.tpl'} + {/block} +{/block} diff --git a/templates/customer/password-email.tpl b/templates/customer/password-email.tpl new file mode 100644 index 0000000..dcfbc60 --- /dev/null +++ b/templates/customer/password-email.tpl @@ -0,0 +1,74 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {l s='Forgot your password?' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} +
    + +
      + {foreach $errors as $error} +
    • + + + + + +

      {$error}

      +
      • + {/foreach} +
    + +
    +

    {l s='Please enter the email address you used to register. You will receive a temporary link to reset your password.' d='Shop.Theme.Customeraccount'}

    +
    + +
    +
    + + + + +
    +
    + +
    +{/block} + +{block name='page_footer'} + +{/block} diff --git a/templates/customer/password-infos.tpl b/templates/customer/password-infos.tpl new file mode 100644 index 0000000..d829349 --- /dev/null +++ b/templates/customer/password-infos.tpl @@ -0,0 +1,50 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {l s='Forgot your password?' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} +
      + {foreach $successes as $success} +
    • + + + + + +

      {$success}

      +
      • + {/foreach} +
    +{/block} + +{block name='page_footer'} + +{/block} diff --git a/templates/customer/password-new.tpl b/templates/customer/password-new.tpl new file mode 100644 index 0000000..fc37640 --- /dev/null +++ b/templates/customer/password-new.tpl @@ -0,0 +1,90 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {l s='Reset your password' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} +
    +
      + {foreach $errors as $error} +
    • + + + + + +

      {$error}

      +
      • + {/foreach} +
    +
    + + + +
    +
    + +
    + +
    +
    + +
    + +
    + +
    +
    + + + + + +
    +
    + +
    +
    +
    + +
    +
    +{/block} + +{block name='page_footer'} + +{/block} diff --git a/templates/customer/registration.tpl b/templates/customer/registration.tpl new file mode 100644 index 0000000..9f71703 --- /dev/null +++ b/templates/customer/registration.tpl @@ -0,0 +1,39 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {l s='Create an account' d='Shop.Theme.Customeraccount'} +{/block} + +{block name='page_content'} + {block name='register_form_container'} + {$hook_create_account_top nofilter} +
    +

    {l s='Already have an account?' d='Shop.Theme.Customeraccount'} {l s='Log in instead!' d='Shop.Theme.Customeraccount'}

    + {render file='customer/_partials/customer-form.tpl' ui=$register_form} +
    + {/block} +{/block} diff --git a/templates/errors/404.tpl b/templates/errors/404.tpl new file mode 100644 index 0000000..022157f --- /dev/null +++ b/templates/errors/404.tpl @@ -0,0 +1,33 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='page.tpl'} + +{block name='page_title'} + {$page.title} +{/block} + +{block name='page_content_container'} + {include file='errors/not-found.tpl'} +{/block} diff --git a/templates/errors/forbidden.tpl b/templates/errors/forbidden.tpl new file mode 100644 index 0000000..90dacff --- /dev/null +++ b/templates/errors/forbidden.tpl @@ -0,0 +1,30 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file=$layout} + +{block name='content'} +
    +
    +{/block} diff --git a/templates/errors/maintenance.tpl b/templates/errors/maintenance.tpl new file mode 100644 index 0000000..de7bea8 --- /dev/null +++ b/templates/errors/maintenance.tpl @@ -0,0 +1,61 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='layouts/layout-error.tpl'} + +{block name='content'} + +
    + + {block name='page_header_container'} +
    + {block name='page_header_logo'} + + {/block} + + {block name='hook_maintenance'} + {$HOOK_MAINTENANCE nofilter} + {/block} + + {block name='page_header'} +

    {block name='page_title'}{l s='We\'ll be back soon.' d='Shop.Theme.Global'}{/block}

    + {/block} +
    + {/block} + + {block name='page_content_container'} +
    + {block name='page_content'} + {$maintenance_text nofilter} + {/block} +
    + {/block} + + {block name='page_footer_container'} + + {/block} + +
    + +{/block} diff --git a/templates/errors/not-found.tpl b/templates/errors/not-found.tpl new file mode 100644 index 0000000..8a932e8 --- /dev/null +++ b/templates/errors/not-found.tpl @@ -0,0 +1,40 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +
    + {block name='page_content'} + +

    {l s='Sorry for the inconvenience.' d='Shop.Theme.Global'}

    +

    {l s='Search again what you are looking for' d='Shop.Theme.Global'}

    + + {block name='search'} + {hook h='displaySearch'} + {/block} + + {block name='hook_not_found'} + {hook h='displayNotFound'} + {/block} + + {/block} +
    diff --git a/templates/errors/restricted-country.tpl b/templates/errors/restricted-country.tpl new file mode 100644 index 0000000..beb1095 --- /dev/null +++ b/templates/errors/restricted-country.tpl @@ -0,0 +1,55 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='layouts/layout-error.tpl'} + +{block name='content'} + +
    + + {block name='page_header_container'} +
    + + {block name='page_header'} +

    {block name='page_title'}{$shop.name}{/block}

    + {/block} +
    + {/block} + + {block name='page_content_container'} +
    + {block name='page_content'} +

    {l s='403 Forbidden' d='Shop.Theme.Global'}

    +

    {l s='You cannot access this store from your country. We apologize for the inconvenience.' d='Shop.Theme.Global'}

    + {/block} +
    + {/block} + + {block name='page_footer_container'} + + {/block} + +
    + +{/block} diff --git a/templates/errors/static/500.html b/templates/errors/static/500.html new file mode 100644 index 0000000..e69de29 diff --git a/templates/errors/static/503.html b/templates/errors/static/503.html new file mode 100644 index 0000000..e69de29 diff --git a/templates/index.tpl b/templates/index.tpl new file mode 100644 index 0000000..c92f8e6 --- /dev/null +++ b/templates/index.tpl @@ -0,0 +1,90 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + + + + + {block name='head'} + {include file='_partials/head.tpl'} + {/block} + + + + + {block name='hook_after_body_opening_tag'} + {hook h='displayAfterBodyOpeningTag'} + {/block} + +
    + {block name='product_activation'} + {include file='catalog/_partials/product-activation.tpl'} + {/block} + + + + {block name='notifications'} + {include file='_partials/notifications.tpl'} + {/block} + +
    + {$homeslider} +
    + +
    + {hook h="displayWrapperTop"} +
    + {block name="content_wrapper"} +
    + {hook h="displayContentWrapperTop"} + {$HOOK_HOME nofilter} + {hook h="displayContentWrapperBottom"} +
    + {/block} +
    + {hook h="displayWrapperBottom"} +
    + +
    + {block name="footer"} + {include file="_partials/footer.tpl"} + {/block} +
    + +
    + + {block name='javascript_bottom'} + {include file="_partials/javascript.tpl" javascript=$javascript.bottom} + {/block} + + {block name='hook_before_body_closing_tag'} + {hook h='displayBeforeBodyClosingTag'} + {/block} + + + diff --git a/templates/layouts/layout-both-columns.tpl b/templates/layouts/layout-both-columns.tpl new file mode 100644 index 0000000..c8ba6da --- /dev/null +++ b/templates/layouts/layout-both-columns.tpl @@ -0,0 +1,114 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + + + + + {block name='head'} + {include file='_partials/head.tpl'} + {/block} + + + + + {block name='hook_after_body_opening_tag'} + {hook h='displayAfterBodyOpeningTag'} + {/block} + +
    + {block name='product_activation'} + {include file='catalog/_partials/product-activation.tpl'} + {/block} + + + + {block name='notifications'} + {include file='_partials/notifications.tpl'} + {/block} + +
    + {hook h="displayWrapperTop"} +
    + {if $page.page_name !== 'index'} + {block name='breadcrumb'} + {include file='_partials/breadcrumb.tpl'} + {/block} + {/if} + + {block name="left_column"} +
    + {if $page.page_name == 'product'} + {hook h='displayLeftColumnProduct'} + {else} + {hook h="displayLeftColumn"} + {/if} +
    + {/block} + + {block name="content_wrapper"} +
    + {hook h="displayContentWrapperTop"} + {block name="content"} +

    Hello world! This is HTML5 Boilerplate.

    + {/block} + {hook h="displayContentWrapperBottom"} +
    + {/block} + + {block name="right_column"} +
    + {if $page.page_name == 'product'} + {hook h='displayRightColumnProduct'} + {else} + {hook h="displayRightColumn"} + {/if} +
    + {/block} +
    + {hook h="displayWrapperBottom"} +
    + +
    + {block name="footer"} + {include file="_partials/footer.tpl"} + {/block} +
    + +
    + + {block name='javascript_bottom'} + {include file="_partials/javascript.tpl" javascript=$javascript.bottom} + {/block} + + {block name='hook_before_body_closing_tag'} + {hook h='displayBeforeBodyClosingTag'} + {/block} + + + diff --git a/templates/layouts/layout-content-only.tpl b/templates/layouts/layout-content-only.tpl new file mode 100644 index 0000000..a3f38dc --- /dev/null +++ b/templates/layouts/layout-content-only.tpl @@ -0,0 +1,41 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='layouts/layout-both-columns.tpl'} + +{block name='header'}{/block} +{block name='left_column'}{/block} +{block name='right_column'}{/block} + +{block name='content_wrapper'} +
    + {hook h="displayContentWrapperTop"} + {block name='content'} +

    Hello world! This is HTML5 Boilerplate.

    + {/block} + {hook h="displayContentWrapperBottom"} +
    +{/block} + +{block name='footer'}{/block} diff --git a/templates/layouts/layout-error.tpl b/templates/layouts/layout-error.tpl new file mode 100644 index 0000000..35f221e --- /dev/null +++ b/templates/layouts/layout-error.tpl @@ -0,0 +1,55 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} + + + + + + + + {block name='head_seo'} + {block name='head_seo_title'}{/block} + + + {/block} + + + {block name='stylesheets'} + {include file="_partials/stylesheets.tpl" stylesheets=$stylesheets} + {/block} + + + + + +
    + {block name='content'} +

    Hello world! This is HTML5 Boilerplate.

    + {/block} +
    + + + + diff --git a/templates/layouts/layout-full-width.tpl b/templates/layouts/layout-full-width.tpl new file mode 100644 index 0000000..bb0d027 --- /dev/null +++ b/templates/layouts/layout-full-width.tpl @@ -0,0 +1,38 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='layouts/layout-both-columns.tpl'} + +{block name='left_column'}{/block} +{block name='right_column'}{/block} + +{block name='content_wrapper'} +
    + {hook h="displayContentWrapperTop"} + {block name='content'} +

    Hello world! This is HTML5 Boilerplate.

    + {/block} + {hook h="displayContentWrapperBottom"} +
    +{/block} diff --git a/templates/layouts/layout-left-column.tpl b/templates/layouts/layout-left-column.tpl new file mode 100644 index 0000000..242d95c --- /dev/null +++ b/templates/layouts/layout-left-column.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='layouts/layout-both-columns.tpl'} + +{block name='right_column'}{/block} + +{block name='content_wrapper'} +
    + {hook h="displayContentWrapperTop"} + {block name='content'} +

    Hello world! This is HTML5 Boilerplate.

    + {/block} + {hook h="displayContentWrapperBottom"} +
    +{/block} diff --git a/templates/layouts/layout-right-column.tpl b/templates/layouts/layout-right-column.tpl new file mode 100644 index 0000000..e1fdb52 --- /dev/null +++ b/templates/layouts/layout-right-column.tpl @@ -0,0 +1,37 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file='layouts/layout-both-columns.tpl'} + +{block name='left_column'}{/block} + +{block name='content_wrapper'} +
    + {hook h="displayContentWrapperTop"} + {block name='content'} +

    Hello world! This is HTML5 Boilerplate.

    + {/block} + {hook h="displayContentWrapperBottom"} +
    +{/block} diff --git a/templates/page.tpl b/templates/page.tpl new file mode 100644 index 0000000..0438a39 --- /dev/null +++ b/templates/page.tpl @@ -0,0 +1,58 @@ +{** + * 2007-2019 PrestaShop and Contributors + * + * NOTICE OF LICENSE + * + * This source file is subject to the Academic Free License 3.0 (AFL-3.0) + * that is bundled with this package in the file LICENSE.txt. + * It is also available through the world-wide-web at this URL: + * https://opensource.org/licenses/AFL-3.0 + * If you did not receive a copy of the license and are unable to + * obtain it through the world-wide-web, please send an email + * to license@prestashop.com so we can send you a copy immediately. + * + * DISCLAIMER + * + * Do not edit or add to this file if you wish to upgrade PrestaShop to newer + * versions in the future. If you wish to customize PrestaShop for your + * needs please refer to https://www.prestashop.com for more information. + * + * @author PrestaShop SA + * @copyright 2007-2019 PrestaShop SA and Contributors + * @license https://opensource.org/licenses/AFL-3.0 Academic Free License 3.0 (AFL-3.0) + * International Registered Trademark & Property of PrestaShop SA + *} +{extends file=$layout} + +{block name='content'} + +
    + + {block name='page_header_container'} + {block name='page_title' hide} +
    +

    {$smarty.block.child}

    +
    + {/block} + {/block} + + {block name='page_content_container'} +
    + {block name='page_content_top'}{/block} + {block name='page_content'} + + {/block} +
    + {/block} + + {block name='page_footer_container'} + + {/block} + +
    + +{/block}